Index: trunk/LMDZ.MARS/libf/dyn3d/iniprint.h
===================================================================
--- trunk/LMDZ.MARS/libf/dyn3d/iniprint.h	(revision 1535)
+++ 	(revision )
@@ -1,11 +1,0 @@
-!
-! $Id: $
-!
-!
-! handle debug and output levels
-! lunout:    unit of file where outputs will be sent
-!                           (default is 6, standard output)
-! prt_level: level of informative output messages (0 = minimum)
-!
-      INTEGER lunout, prt_level
-      COMMON /comprint/ lunout, prt_level
Index: trunk/LMDZ.MARS/libf/dynphy_lonlat/calfis.F
===================================================================
--- trunk/LMDZ.MARS/libf/dynphy_lonlat/calfis.F	(revision 1540)
+++ trunk/LMDZ.MARS/libf/dynphy_lonlat/calfis.F	(revision 1540)
@@ -0,0 +1,554 @@
+      SUBROUTINE calfis(nq, lafin, rdayvrai,rday_ecri, heure,
+     $            pucov,pvcov,pteta,pq,pmasse,pps,pp,ppk,pphis,pphi,
+     $            pducov,pdvcov,pdteta,pdq,pw,
+     $            pdufi,pdvfi,pdhfi,pdqfi,pdpsfi,tracer )
+c
+c    Auteur :  P. Le Van, F. Hourdin 
+c   .........
+
+      USE comvert_mod, ONLY: preff
+      USE comconst_mod, ONLY: dtphys,cpp,kappa,pi
+
+      IMPLICIT NONE
+c=======================================================================
+c
+c   1. rearrangement des tableaux et transformation
+c      variables dynamiques  >  variables physiques
+c   2. calcul des termes physiques
+c   3. retransformation des tendances physiques en tendances dynamiques
+c
+c   remarques:
+c   ----------
+c
+c    - les vents sont donnes dans la physique par leurs composantes 
+c      naturelles.
+c    - la variable thermodynamique de la physique est une variable
+c      intensive :   T 
+c      pour la dynamique on prend    T * ( preff / p(l) ) **kappa
+c    - les deux seules variables dependant de la geometrie necessaires
+c      pour la physique sont la latitude pour le rayonnement et 
+c      l'aire de la maille quand on veut integrer une grandeur 
+c      horizontalement.
+c    - les points de la physique sont les points scalaires de la 
+c      la dynamique; numerotation:
+c          1 pour le pole nord
+c          (jjm-1)*iim pour l'interieur du domaine
+c          ngridmx pour le pole sud
+c      ---> ngridmx=2+(jjm-1)*iim
+c
+c     Input :
+c     -------
+c       ecritphy        frequence d'ecriture (en jours)de histphy
+c       pucov           covariant zonal velocity
+c       pvcov           covariant meridional velocity 
+c       pteta           potential temperature
+c       pps             surface pressure
+c       pmasse          masse d'air dans chaque maille
+c       pts             surface temperature  (K)
+c       pw              flux vertical (kg/s)
+c
+c    Output :
+c    --------
+c        pdufi          tendency for the natural zonal velocity (ms-1)
+c        pdvfi          tendency for the natural meridional velocity 
+c        pdhfi          tendency for the potential temperature
+c        pdtsfi         tendency for the surface temperature
+c
+c        tracer         Call tracer in  gcm.F ? (decided in callphys.def)
+c
+c=======================================================================
+c
+c-----------------------------------------------------------------------
+c
+c    0.  Declarations :
+c    ------------------
+
+#include "dimensions.h"
+#include "paramet.h"
+
+      INTEGER ngridmx,nq
+      PARAMETER( ngridmx = 2+(jjm-1)*iim - 1/jjm   )
+
+#include "comgeom2.h"
+!#include "control.h"
+
+c    Arguments :
+c    -----------
+      LOGICAL  lafin
+      REAL heure
+
+      REAL pvcov(iip1,jjm,llm)
+      REAL pucov(iip1,jjp1,llm)
+      REAL pteta(iip1,jjp1,llm)
+      REAL pmasse(iip1,jjp1,llm)
+      REAL pq(iip1,jjp1,llm,nq)
+      REAL pphis(iip1,jjp1)
+      REAL pphi(iip1,jjp1,llm)
+c
+      REAL pdvcov(iip1,jjm,llm)
+      REAL pducov(iip1,jjp1,llm)
+      REAL pdteta(iip1,jjp1,llm)
+      REAL pdq(iip1,jjp1,llm,nq)
+c
+      REAL pw(iip1,jjp1,llm)
+c
+      REAL pps(iip1,jjp1)
+      REAL pp(iip1,jjp1,llmp1)
+      REAL ppk(iip1,jjp1,llm)
+c
+      REAL pdvfi(iip1,jjm,llm)
+      REAL pdufi(iip1,jjp1,llm)
+      REAL pdhfi(iip1,jjp1,llm)
+      REAL pdqfi(iip1,jjp1,llm,nq)
+      REAL pdpsfi(iip1,jjp1)
+      logical tracer
+
+c    Local variables :
+c    -----------------
+
+      INTEGER i,j,l,ig0,ig,iq
+      REAL zpsrf(ngridmx)
+      REAL zplev(ngridmx,llm+1),zplay(ngridmx,llm)
+      REAL zphi(ngridmx,llm),zphis(ngridmx)
+c
+      REAL zufi(ngridmx,llm), zvfi(ngridmx,llm)
+      REAL ztfi(ngridmx,llm),zqfi(ngridmx,llm,nq)
+c
+      REAL zvervel(ngridmx,llm)
+c
+      REAL zdufi(ngridmx,llm),zdvfi(ngridmx,llm)
+      REAL zdtfi(ngridmx,llm),zdqfi(ngridmx,llm,nq)
+      REAL zdpsrf(ngridmx)
+c
+      REAL zsin(iim),zcos(iim),z1(iim)
+      REAL zsinbis(iim),zcosbis(iim),z1bis(iim)
+      REAL unskap, pksurcp
+c
+      
+      EXTERNAL gr_dyn_fi,gr_fi_dyn
+      EXTERNAL physiq,multipl
+      REAL SSUM
+      EXTERNAL SSUM
+
+      REAL latfi(ngridmx),lonfi(ngridmx)
+      REAL airefi(ngridmx)
+      SAVE latfi, lonfi, airefi
+
+      LOGICAL firstcal, debut
+      DATA firstcal/.true./
+      SAVE firstcal,debut
+      REAL rdayvrai,rday_ecri
+c
+c-----------------------------------------------------------------------
+c
+c    1. Initialisations :
+c    --------------------
+c
+
+
+      IF (ngridmx.NE.2+(jjm-1)*iim) THEN
+         PRINT*,'STOP dans calfis'
+         PRINT*,'La dimension ngridmx doit etre egale a 2 + (jjm-1)*iim'
+         PRINT*,'  ngridmx  jjm   iim   '
+         PRINT*,ngridmx,jjm,iim
+         STOP
+      ENDIF
+
+c-----------------------------------------------------------------------
+c   latitude, longitude et aires des mailles pour la physique:
+c   ----------------------------------------------------------
+
+c
+      IF ( firstcal )  THEN
+          debut = .TRUE.
+      ELSE
+          debut = .FALSE.
+      ENDIF
+
+c
+!      IF (firstcal) THEN
+!         latfi(1)=rlatu(1)
+!         lonfi(1)=0.
+!         DO j=2,jjm
+!            DO i=1,iim
+!               latfi((j-2)*iim+1+i)= rlatu(j)
+!               lonfi((j-2)*iim+1+i)= rlonv(i)
+!            ENDDO
+!         ENDDO
+!         latfi(ngridmx)= rlatu(jjp1)
+!         lonfi(ngridmx)= 0.
+!         
+!         ! build airefi(), mesh area on physics grid
+!         CALL gr_dyn_fi(1,iip1,jjp1,ngridmx,aire,airefi)
+!         ! Poles are single points on physics grid
+!         airefi(1)=airefi(1)*iim
+!         airefi(ngridmx)=airefi(ngridmx)*iim
+!
+!         CALL inifis(ngridmx,llm,nq,day_ini,daysec,dtphys,
+!     .                latfi,lonfi,airefi,rad,g,r,cpp)
+!      ENDIF
+
+c
+c-----------------------------------------------------------------------
+c   40. transformation des variables dynamiques en variables physiques:
+c   ---------------------------------------------------------------
+
+c   41. pressions au sol (en Pascals)
+c   ----------------------------------
+
+       
+      zpsrf(1) = pps(1,1)
+
+      ig0  = 2
+      DO j = 2,jjm
+         CALL SCOPY( iim,pps(1,j),1,zpsrf(ig0), 1 )
+         ig0 = ig0+iim
+      ENDDO
+
+      zpsrf(ngridmx) = pps(1,jjp1)
+
+
+c   42. pression intercouches :
+c
+c   -----------------------------------------------------------------
+c     .... zplev  definis aux (llm +1) interfaces des couches  ....
+c     .... zplay  definis aux (  llm )    milieux des couches  .... 
+c   -----------------------------------------------------------------
+
+c    ...    Exner = cp * ( p(l) / preff ) ** kappa     ....
+c
+       unskap   = 1./ kappa
+c
+      DO l = 1, llmp1
+        zplev( 1,l ) = pp(1,1,l)
+        ig0 = 2
+          DO j = 2, jjm
+             DO i =1, iim
+              zplev( ig0,l ) = pp(i,j,l)
+              ig0 = ig0 +1
+             ENDDO
+          ENDDO
+        zplev( ngridmx,l ) = pp(1,jjp1,l)
+      ENDDO
+c
+c
+
+c   43. temperature naturelle (en K) et pressions milieux couches .
+c   ---------------------------------------------------------------
+
+      DO l=1,llm
+
+         pksurcp     =  ppk(1,1,l) / cpp
+         zplay(1,l)  =  preff * pksurcp ** unskap
+         ztfi(1,l)   =  pteta(1,1,l) *  pksurcp
+         ig0         =  2
+
+         DO j = 2, jjm
+            DO i = 1, iim
+              pksurcp        = ppk(i,j,l) / cpp
+              zplay(ig0,l)   = preff * pksurcp ** unskap
+              ztfi(ig0,l)    = pteta(i,j,l)  * pksurcp
+              ig0            = ig0 + 1
+            ENDDO
+         ENDDO
+
+         pksurcp       = ppk(1,jjp1,l) / cpp
+         zplay(ig0,l)  = preff * pksurcp ** unskap
+         ztfi (ig0,l)  = pteta(1,jjp1,l)  * pksurcp
+
+      ENDDO
+
+      DO l=1, llm
+        DO ig=1,ngridmx
+             if (ztfi(ig,l).lt.15) then
+                  write(*,*) 'New Temperature below 15 K !!! '
+	              write(*,*) 'Stop in calfis.F '
+	              write(*,*) 'ig=', ig, ' l=', l
+                      write(*,*) 'ztfi(ig,l)=',ztfi(ig,l)
+                  stop
+             end if
+        ENDDO
+      ENDDO
+
+
+
+c   43.bis Taceurs (en kg/kg)
+c   --------------------------
+      DO iq=1,nq
+         DO l=1,llm
+            zqfi(1,l,iq) = pq(1,1,l,iq)
+            ig0          = 2
+            DO j=2,jjm
+               DO i = 1, iim
+                  zqfi(ig0,l,iq)  = pq(i,j,l,iq)
+                  ig0             = ig0 + 1
+               ENDDO
+            ENDDO
+            zqfi(ig0,l,iq) = pq(1,jjp1,l,iq)
+         ENDDO
+      ENDDO
+
+c   Geopotentiel calcule par rapport a la surface locale:
+c   -----------------------------------------------------
+
+      CALL gr_dyn_fi(llm,iip1,jjp1,ngridmx,pphi,zphi)
+      CALL gr_dyn_fi(1,iip1,jjp1,ngridmx,pphis,zphis)
+      DO l=1,llm
+         DO ig=1,ngridmx
+            zphi(ig,l)=zphi(ig,l)-zphis(ig)
+         ENDDO
+      ENDDO
+
+c   Calcul de la vitesse  verticale (m/s) pour diagnostique 
+c   -------------------------------
+c     pw est en kg/s
+c On interpole "lineairement" la temperature entre les couches(FF,10/95)
+
+!      DO ig=1,ngridmx
+!         zvervel(ig,1)=0.
+!      END DO
+!      DO l=2,llm
+!        zvervel(1,l)=(pw(1,1,l)/apoln)
+!     &  * r *0.5*(ztfi(1,l)+ztfi(1,l-1)) /zplev(1,l)              
+!        ig0=2
+!       DO j=2,jjm
+!           DO i = 1, iim
+!              zvervel(ig0,l) = pw(i,j,l) * unsaire(i,j)
+!     &        * r *0.5*(ztfi(ig0,l)+ztfi(ig0,l-1)) /zplev(ig0,l)              
+!              ig0 = ig0 + 1
+!           ENDDO
+!       ENDDO
+!        zvervel(ig0,l)=(pw(1,jjp1,l)/apols)
+!     &  * r *0.5*(ztfi(ig0,l)+ztfi(ig0,l-1)) /zplev(ig0,l)              
+!      ENDDO
+
+c    .........  Reindexation : calcul de zvervel au MILIEU des couches
+!       DO l=1,llm-1
+!	      DO ig=1,ngridmx
+!		     zvervel(ig,l) = 0.5*(zvervel(ig,l)+zvervel(ig,l+1))
+!          END DO 
+!       END DO 
+c      (dans la couche llm, on garde la valeur à la limite inférieure llm)
+
+c   45. champ u:
+c   ------------
+
+      DO 50 l=1,llm
+
+         DO 25 j=2,jjm
+            ig0 = 1+(j-2)*iim
+            zufi(ig0+1,l)= 0.5 * 
+     $      ( pucov(iim,j,l)/cu(iim,j) + pucov(1,j,l)/cu(1,j) )
+            DO 10 i=2,iim
+               zufi(ig0+i,l)= 0.5 *
+     $         ( pucov(i-1,j,l)/cu(i-1,j) + pucov(i,j,l)/cu(i,j) )
+10         CONTINUE
+25      CONTINUE
+
+50    CONTINUE
+
+
+c   46.champ v:
+c   -----------
+
+      DO l=1,llm
+         DO j=2,jjm
+            ig0=1+(j-2)*iim
+            DO i=1,iim
+               zvfi(ig0+i,l)= 0.5 *
+     $         ( pvcov(i,j-1,l)/cv(i,j-1) + pvcov(i,j,l)/cv(i,j) )
+            ENDDO
+         ENDDO
+      ENDDO
+
+
+c   47. champs de vents aux pole nord   
+c   ------------------------------
+c        U = 1 / pi  *  integrale [ v * cos(long) * d long ]
+c        V = 1 / pi  *  integrale [ v * sin(long) * d long ]
+
+      DO l=1,llm
+
+         z1(1)   =(rlonu(1)-rlonu(iim)+2.*pi)*pvcov(1,1,l)/cv(1,1)
+         z1bis(1)=(rlonu(1)-rlonu(iim)+2.*pi)*pdvcov(1,1,l)/cv(1,1)
+         DO i=2,iim
+            z1(i)   =(rlonu(i)-rlonu(i-1))*pvcov(i,1,l)/cv(i,1)
+            z1bis(i)=(rlonu(i)-rlonu(i-1))*pdvcov(i,1,l)/cv(i,1)
+         ENDDO
+
+         DO i=1,iim
+            zcos(i)   = COS(rlonv(i))*z1(i)
+            zcosbis(i)= COS(rlonv(i))*z1bis(i)
+            zsin(i)   = SIN(rlonv(i))*z1(i)
+            zsinbis(i)= SIN(rlonv(i))*z1bis(i)
+         ENDDO
+
+         zufi(1,l)  = SSUM(iim,zcos,1)/pi
+         zvfi(1,l)  = SSUM(iim,zsin,1)/pi
+
+      ENDDO
+
+
+c   48. champs de vents aux pole sud:
+c   ---------------------------------
+c        U = 1 / pi  *  integrale [ v * cos(long) * d long ]
+c        V = 1 / pi  *  integrale [ v * sin(long) * d long ]
+
+      DO l=1,llm
+
+         z1(1)   =(rlonu(1)-rlonu(iim)+2.*pi)*pvcov(1,jjm,l)/cv(1,jjm)
+         z1bis(1)=(rlonu(1)-rlonu(iim)+2.*pi)*pdvcov(1,jjm,l)/cv(1,jjm)
+         DO i=2,iim
+            z1(i)   =(rlonu(i)-rlonu(i-1))*pvcov(i,jjm,l)/cv(i,jjm)
+            z1bis(i)=(rlonu(i)-rlonu(i-1))*pdvcov(i,jjm,l)/cv(i,jjm)
+      ENDDO
+
+         DO i=1,iim
+            zcos(i)    = COS(rlonv(i))*z1(i)
+            zcosbis(i) = COS(rlonv(i))*z1bis(i)
+            zsin(i)    = SIN(rlonv(i))*z1(i)
+            zsinbis(i) = SIN(rlonv(i))*z1bis(i)
+      ENDDO
+
+         zufi(ngridmx,l)  = SSUM(iim,zcos,1)/pi
+         zvfi(ngridmx,l)  = SSUM(iim,zsin,1)/pi
+
+      ENDDO
+
+c-----------------------------------------------------------------------
+c   Appel de la physique:
+c   ---------------------
+
+
+      CALL physiq (ngridmx,llm,nq,
+     ,     debut,lafin,
+     ,     rday_ecri,heure,dtphys,
+     ,     zplev,zplay,zphi,
+     ,     zufi, zvfi,ztfi, zqfi,  
+!     ,     zvervel,
+     ,     pw,
+C - sorties
+     s     zdufi, zdvfi, zdtfi, zdqfi,zdpsrf,tracer)
+
+
+c-----------------------------------------------------------------------
+c   transformation des tendances physiques en tendances dynamiques:
+c   ---------------------------------------------------------------
+
+c  tendance sur la pression :
+c  -----------------------------------
+
+      CALL gr_fi_dyn(1,ngridmx,iip1,jjp1,zdpsrf,pdpsfi)
+c
+ccc     CALL multipl(ip1jmp1,aire,pdpsfi,pdpsfi)
+
+c   62. enthalpie potentielle
+c   ---------------------
+
+      DO l=1,llm
+
+         DO i=1,iip1
+          pdhfi(i,1,l)    = cpp *  zdtfi(1,l)      / ppk(i, 1  ,l)
+          pdhfi(i,jjp1,l) = cpp *  zdtfi(ngridmx,l)/ ppk(i,jjp1,l)
+         ENDDO
+
+         DO j=2,jjm
+            ig0=1+(j-2)*iim
+            DO i=1,iim
+               pdhfi(i,j,l) = cpp * zdtfi(ig0+i,l) / ppk(i,j,l)
+            ENDDO
+               pdhfi(iip1,j,l) =  pdhfi(1,j,l)
+         ENDDO
+
+      ENDDO
+
+
+c   62. humidite specifique
+c   ---------------------
+
+      DO iq=1,nq
+         DO l=1,llm
+            DO i=1,iip1
+               pdqfi(i,1,l,iq)    = zdqfi(1,l,iq)
+               pdqfi(i,jjp1,l,iq) = zdqfi(ngridmx,l,iq)
+            ENDDO
+            DO j=2,jjm
+               ig0=1+(j-2)*iim
+               DO i=1,iim
+                  pdqfi(i,j,l,iq) = zdqfi(ig0+i,l,iq)
+               ENDDO
+               pdqfi(iip1,j,l,iq) = pdqfi(1,j,l,iq)
+            ENDDO
+         ENDDO
+      ENDDO
+
+c   65. champ u:
+c   ------------
+
+      DO l=1,llm
+
+         DO i=1,iip1
+            pdufi(i,1,l)    = 0.
+            pdufi(i,jjp1,l) = 0.
+         ENDDO
+
+         DO j=2,jjm
+            ig0=1+(j-2)*iim
+            DO i=1,iim-1
+               pdufi(i,j,l)=
+     $         0.5*(zdufi(ig0+i,l)+zdufi(ig0+i+1,l))*cu(i,j)
+            ENDDO
+            pdufi(iim,j,l)=
+     $      0.5*(zdufi(ig0+1,l)+zdufi(ig0+iim,l))*cu(iim,j)
+            pdufi(iip1,j,l)=pdufi(1,j,l)
+         ENDDO
+
+      ENDDO
+
+
+c   67. champ v:
+c   ------------
+
+      DO l=1,llm
+
+         DO j=2,jjm-1
+            ig0=1+(j-2)*iim
+            DO i=1,iim
+               pdvfi(i,j,l)=
+     $         0.5*(zdvfi(ig0+i,l)+zdvfi(ig0+i+iim,l))*cv(i,j)
+            ENDDO
+            pdvfi(iip1,j,l) = pdvfi(1,j,l)
+         ENDDO
+      ENDDO
+
+
+c   68. champ v pres des poles:
+c   ---------------------------
+c      v = U * cos(long) + V * SIN(long)
+
+      DO l=1,llm
+
+         DO i=1,iim
+            pdvfi(i,1,l)=
+     $      zdufi(1,l)*COS(rlonv(i))+zdvfi(1,l)*SIN(rlonv(i))
+            pdvfi(i,jjm,l)=zdufi(ngridmx,l)*COS(rlonv(i))
+     $      +zdvfi(ngridmx,l)*SIN(rlonv(i))
+            pdvfi(i,1,l)=
+     $      0.5*(pdvfi(i,1,l)+zdvfi(i+1,l))*cv(i,1)
+            pdvfi(i,jjm,l)=
+     $      0.5*(pdvfi(i,jjm,l)+zdvfi(ngridmx-iip1+i,l))*cv(i,jjm)
+          ENDDO
+
+         pdvfi(iip1,1,l)  = pdvfi(1,1,l)
+         pdvfi(iip1,jjm,l)= pdvfi(1,jjm,l)
+
+      ENDDO
+
+c-----------------------------------------------------------------------
+
+700   CONTINUE
+
+      firstcal = .FALSE.
+
+      RETURN
+      END
Index: trunk/LMDZ.MARS/libf/dynphy_lonlat/gr_dyn_fi.F
===================================================================
--- trunk/LMDZ.MARS/libf/dynphy_lonlat/gr_dyn_fi.F	(revision 1540)
+++ trunk/LMDZ.MARS/libf/dynphy_lonlat/gr_dyn_fi.F	(revision 1540)
@@ -0,0 +1,37 @@
+      SUBROUTINE gr_dyn_fi(nfield,im,jm,ngrid,pdyn,pfi)
+
+      IMPLICIT NONE
+c=======================================================================
+c   passage d'un champ de la grille scalaire a la grille physique
+c=======================================================================
+
+c-----------------------------------------------------------------------
+c   declarations:
+c   -------------
+
+      INTEGER im,jm,ngrid,nfield
+      REAL pdyn(im,jm,nfield)
+      REAL pfi(ngrid,nfield)
+
+      INTEGER j,ifield,ig
+      EXTERNAL SCOPY
+
+c-----------------------------------------------------------------------
+c   calcul:
+c   -------
+
+      IF(ngrid.NE.2+(jm-2)*(im-1)) STOP 'probleme de dim'
+c   traitement des poles
+      CALL SCOPY(nfield,pdyn,im*jm,pfi,ngrid)
+      CALL SCOPY(nfield,pdyn(1,jm,1),im*jm,pfi(ngrid,1),ngrid)
+
+c   traitement des point normaux
+      DO ifield=1,nfield
+         DO j=2,jm-1
+            ig=2+(j-2)*(im-1)
+            CALL SCOPY(im-1,pdyn(1,j,ifield),1,pfi(ig,ifield),1)
+         ENDDO
+      ENDDO
+
+      RETURN
+      END
Index: trunk/LMDZ.MARS/libf/dynphy_lonlat/gr_fi_dyn.F
===================================================================
--- trunk/LMDZ.MARS/libf/dynphy_lonlat/gr_fi_dyn.F	(revision 1540)
+++ trunk/LMDZ.MARS/libf/dynphy_lonlat/gr_fi_dyn.F	(revision 1540)
@@ -0,0 +1,38 @@
+      SUBROUTINE gr_fi_dyn(nfield,ngrid,im,jm,pfi,pdyn)
+      IMPLICIT NONE
+c=======================================================================
+c   passage d'un champ de la grille scalaire a la grille physique
+c=======================================================================
+
+c-----------------------------------------------------------------------
+c   declarations:
+c   -------------
+
+      INTEGER im,jm,ngrid,nfield
+      REAL pdyn(im,jm,nfield)
+      REAL pfi(ngrid,nfield)
+
+      INTEGER i,j,ifield,ig
+      EXTERNAL SCOPY
+
+c-----------------------------------------------------------------------
+c   calcul:
+c   -------
+
+      DO ifield=1,nfield
+c   traitement des poles
+         DO i=1,im
+            pdyn(i,1,ifield)=pfi(1,ifield)
+            pdyn(i,jm,ifield)=pfi(ngrid,ifield)
+         ENDDO
+
+c   traitement des point normaux
+         DO j=2,jm-1
+	    ig=2+(j-2)*(im-1)
+            CALL SCOPY(im-1,pfi(ig,ifield),1,pdyn(1,j,ifield),1)
+	    pdyn(im,j,ifield)=pdyn(1,j,ifield)
+         ENDDO
+      ENDDO
+
+      RETURN
+      END
Index: trunk/LMDZ.MARS/libf/dynphy_lonlat/phymars/caldyn0.F
===================================================================
--- trunk/LMDZ.MARS/libf/dynphy_lonlat/phymars/caldyn0.F	(revision 1540)
+++ trunk/LMDZ.MARS/libf/dynphy_lonlat/phymars/caldyn0.F	(revision 1540)
@@ -0,0 +1,1 @@
+link ../../dyn3d/caldyn0.F
Index: trunk/LMDZ.MARS/libf/dynphy_lonlat/phymars/datareadnc.F
===================================================================
--- trunk/LMDZ.MARS/libf/dynphy_lonlat/phymars/datareadnc.F	(revision 1540)
+++ trunk/LMDZ.MARS/libf/dynphy_lonlat/phymars/datareadnc.F	(revision 1540)
@@ -0,0 +1,301 @@
+c=======================================================================
+      SUBROUTINE datareadnc(relief,phisinit,alb,ith,z0,
+     &                    zmea,zstd,zsig,zgam,zthe)
+c=======================================================================
+c
+c
+c   Author: F. Hourdin      01/1997
+c   -------
+c
+c   Object: To read data from Martian surface to use in a GCM
+c   ------                from NetCDF file "surface.nc"
+c
+c
+c   Arguments:
+c   ----------
+c
+c     Inputs:
+c     ------
+c
+c     Outputs:
+c     --------
+c
+c=======================================================================
+c   donnees ALBEDO, INERTIE THERMIQUE, RELIEF:
+c
+c       Ces donnees sont au format NetCDF dans le fichier "surface.nc"
+c
+c   360 valeurs en longitude (de -179.5 a 179.5)
+c   180 valeurs en latitudes (de 89.5 a -89.5)
+c
+c   Pour les passer au format de la grille, on utilise "interp_horiz.F"
+c
+c   Il faut donc que ces donnees soient au format grille scalaire
+c               (imold+1 jmold+1)
+c       avec passage des coordonnees de la "boite" (rlonu, rlatv)
+c
+c   On prend imd (d pour donnees!) 
+c           imd = 360 avec copie de la 1ere valeur sur la imd+1 
+c                   (rlonud de -179 a -181)
+c           jmd = 179 
+c                   (rlatvd de 89 a -89)
+c=======================================================================
+
+! to use  'getin'
+       use ioipsl_getincom 
+      USE comconst_mod, ONLY: g,pi
+
+      implicit none
+
+#include "dimensions.h"
+#include "paramet.h"
+#include "comgeom.h"
+#include "netcdf.inc"
+#include "datafile.h"
+
+c=======================================================================
+c   Declarations:
+C=======================================================================
+
+      INTEGER    imd,jmd,imdp1,jmdp1
+      parameter    (imd=360,jmd=179,imdp1=361,jmdp1=180)
+
+      INTEGER    iimp1
+      parameter    (iimp1=iim+1-1/iim)
+
+! Arguments:
+      CHARACTER(len=3),intent(inout) :: relief
+      REAL,intent(out) :: phisinit(iimp1*jjp1)
+      REAL,intent(out) :: alb(iimp1*jjp1)
+      REAL,intent(out) :: ith(iimp1*jjp1)
+      REAL,intent(out) :: z0(iimp1*jjp1)
+      REAL,intent(out) :: zmea(imdp1*jmdp1)
+      REAL,intent(out) :: zstd(imdp1*jmdp1)
+      REAL,intent(out) :: zsig(imdp1*jmdp1)
+      REAL,intent(out) :: zgam(imdp1*jmdp1)
+      REAL,intent(out) :: zthe(imdp1*jmdp1)
+
+! Local variables:
+      REAL        zdata(imd*jmdp1)
+      REAL        zdataS(imdp1*jmdp1)
+      REAL        pfield(iimp1*jjp1)
+
+      INTEGER     ierr
+
+      INTEGER   unit,nvarid
+
+      INTEGER    i,j,k
+
+      INTEGER klatdat,ngridmxgdat
+      PARAMETER (klatdat=180,ngridmxgdat=360)
+
+c    on passe une grille en rlonu rlatv et im+1 jm a interp_horiz)
+
+      REAL longitude(imd),latitude(jmdp1) ! Pour lecture des donnees
+      REAL rlonud(imdp1),rlatvd(jmd)
+
+      CHARACTER*20 string
+      DIMENSION string(0:4)
+
+
+!#include "lmdstd.h"
+!#include "fxyprim.h"
+
+      pi=2.*ASIN(1.)
+
+c=======================================================================
+c    rlonud, rlatvd
+c=======================================================================
+
+c-----------------------------------------------------------------------
+c    Lecture NetCDF des donnees latitude et longitude
+c-----------------------------------------------------------------------
+      write(*,*) 'datareadnc: opening file surface.nc'
+
+      datafile="/u/lmdz/WWW/planets/mars/datadir" ! default path to surface.nc
+      call getin("datadir",datafile) ! but users may specify another path
+      
+      ierr = NF_OPEN (trim(datafile)//'/surface.nc',
+     &  NF_NOWRITE,unit)
+      IF (ierr.NE.NF_NOERR) THEN
+        write(*,*)'Error : cannot open file surface.nc '
+        write(*,*)'(in phymars/datareadnc.F)'
+        write(*,*)'It should be in :',trim(datafile),'/'
+        write(*,*)'1) You can set this path in the 
+     & callphys.def file:'
+        write(*,*)'   datadir=/path/to/the/datafiles'
+        write(*,*)'2) If necessary, surface.nc (and other datafiles)'
+        write(*,*)'   can be obtained online on:'
+        write(*,*)'http://www.lmd.jussieu.fr/~lmdz/planets/mars/datadir'
+        CALL ABORT
+      ENDIF
+
+c
+c Lecture des latitudes (coordonnees):
+c
+      ierr = NF_INQ_VARID (unit, "latitude", nvarid)
+#ifdef NC_DOUBLE
+      ierr = NF_GET_VAR_DOUBLE(unit, nvarid, latitude)
+#else
+      ierr = NF_GET_VAR_REAL(unit, nvarid, latitude)
+#endif
+c
+c Lecture des longitudes (coordonnees):
+c
+      ierr = NF_INQ_VARID (unit, "longitude", nvarid)
+#ifdef NC_DOUBLE
+      ierr = NF_GET_VAR_DOUBLE(unit, nvarid, longitude)
+#else
+      ierr = NF_GET_VAR_REAL(unit, nvarid, longitude)
+#endif
+
+c-----------------------------------------------------------------------
+c    Passage au format boites scalaires
+c-----------------------------------------------------------------------
+
+c-----------------------------------------------------------------------
+c       longitude(imd)        -->      rlonud(imdp1) 
+c-----------------------------------------------------------------------
+
+c Passage en coordonnees boites scalaires et en radian
+      do i=1,imd 
+          rlonud(i)=(longitude(i)+.5)*pi/180.
+      enddo
+
+c Repetition de la valeur im+1
+      rlonud(imdp1)=rlonud(1) + 2*pi
+
+c-----------------------------------------------------------------------
+c        latitude(jmdp1)         -->        rlonvd(jmd)
+c-----------------------------------------------------------------------
+
+c Passage en coordonnees boites scalaires et en radian
+      do j=1,jmd 
+          rlatvd(j)=(latitude(j)-.5)*pi/180.
+      enddo
+
+c=======================================================================
+c   lecture NetCDF de albedo, thermal, relief, zdtm (pour francois Lott)
+c=======================================================================
+
+      string(0) = 'z0'
+      string(1) = 'albedo'
+      string(2) = 'thermal'
+      if (relief.ne.'pla') then
+        write(*,*) ' MOLA topography'
+        relief = 'MOL'
+          string(3) = 'z'//relief
+      else
+          string(3) = 'zMOL'  ! pour qu''il lise qqchose sur le fichier
+                            ! remise a 0 derriere
+      endif
+      string(4) = 'zMOL'    ! lecture pour calcul topog. sous-maille
+ 
+
+      DO k=0,4
+          write(*,*) 'string',k,string(k)
+          
+c-----------------------------------------------------------------------
+c    initialisation
+c-----------------------------------------------------------------------
+      call initial0(iimp1*jjp1,pfield)
+      call initial0(imd*jmdp1,zdata)
+      call initial0(imdp1*jmdp1,zdataS)
+
+c-----------------------------------------------------------------------
+c    Lecture NetCDF  
+c-----------------------------------------------------------------------
+
+      ierr = NF_INQ_VARID (unit, string(k), nvarid)
+      if (ierr.ne.nf_noerr) then
+        write(*,*) 'datareadnc error, cannot find ',trim(string(k))
+        write(*,*) ' in file ',trim(datafile),'/surface.nc'
+        stop
+      endif
+#ifdef NC_DOUBLE
+      ierr = NF_GET_VAR_DOUBLE(unit, nvarid, zdata)
+#else
+      ierr = NF_GET_VAR_REAL(unit, nvarid, zdata)
+#endif
+      if (ierr.ne.nf_noerr) then
+        write(*,*) 'datareadnc: error failed loading ',trim(string(k))
+        stop
+      endif
+
+c-----------------------------------------------------------------------
+c        Cas particulier "Francois Lott" ( k=4 ) (relief sous-maille)
+c-----------------------------------------------------------------------
+      if (k.eq.4) then
+
+          zdata(:)=1000.*zdata(:)
+          longitude(:)=(pi/180.)*longitude(:)
+          latitude(:)=(pi/180.)*latitude(:)
+
+          call grid_noro1(360, 180, longitude, latitude, zdata,
+     .         iim, jjp1, rlonv, rlatu, zmea,zstd,zsig,zgam,zthe)
+
+      endif
+
+c-----------------------------------------------------------------------
+c   Passage de zdata en grille (imdp1 jmdp1)
+c-----------------------------------------------------------------------
+      do j=1,jmdp1
+          do i=1,imd
+              zdataS(i+imdp1*(j-1)) = zdata(i+ngridmxgdat*(j-1))
+          enddo
+          zdataS(imdp1+imdp1*(j-1)) = zdata(1+ngridmxgdat*(j-1))
+      enddo
+
+c-----------------------------------------------------------------------
+c    Interpolation
+c-----------------------------------------------------------------------
+      call interp_horiz(zdataS,pfield,imd,jmd,
+     .    iim, jjm,1,rlonud,rlatvd,rlonu,rlatv) 
+
+c-----------------------------------------------------------------------
+c    Periodicite    
+c-----------------------------------------------------------------------
+
+      do j=1,jjp1
+         pfield(iimp1*j) =  pfield(1+iimp1*(j-1))
+      enddo 
+ 
+c-----------------------------------------------------------------------
+c    Sauvegarde des champs    
+c-----------------------------------------------------------------------
+
+      if (k.eq.0) then                    ! z0
+         z0(1:iimp1*jjp1)=pfield(1:iimp1*jjp1)*.01
+         ! multiplied by 0.01 to have z0 in m
+      elseif (k.eq.1) then                    ! albedo
+         do i=1,iimp1*jjp1
+              alb(i) = pfield(i)
+          enddo
+      elseif (k.eq.2) then                ! thermal
+         do i=1,iimp1*jjp1
+              ith(i) = pfield(i)
+          enddo
+      elseif (k.eq.3) then                ! relief
+        if (relief.eq.'pla') then
+              call initial0(iimp1*jjp1,phisinit)
+        else
+             do i=1,iimp1*jjp1
+                  phisinit(i) = pfield(i)
+              enddo
+        endif
+      endif
+
+      ENDDO
+
+c-----------------------------------------------------------------------
+c    Traitement Phisinit
+c-----------------------------------------------------------------------
+
+      phisinit(1:iimp1*jjp1)=1000.*phisinit(1:iimp1*jjp1)
+      phisinit(:)=g*phisinit(:)
+
+c-----------------------------------------------------------------------
+c    FIN
+c-----------------------------------------------------------------------
+
+      END
Index: trunk/LMDZ.MARS/libf/dynphy_lonlat/phymars/defrun_new.F
===================================================================
--- trunk/LMDZ.MARS/libf/dynphy_lonlat/phymars/defrun_new.F	(revision 1540)
+++ trunk/LMDZ.MARS/libf/dynphy_lonlat/phymars/defrun_new.F	(revision 1540)
@@ -0,0 +1,1 @@
+link ../../dyn3d/defrun_new.F
Index: trunk/LMDZ.MARS/libf/dynphy_lonlat/phymars/exner_hyb.F
===================================================================
--- trunk/LMDZ.MARS/libf/dynphy_lonlat/phymars/exner_hyb.F	(revision 1540)
+++ trunk/LMDZ.MARS/libf/dynphy_lonlat/phymars/exner_hyb.F	(revision 1540)
@@ -0,0 +1,1 @@
+link ../../dyn3d/exner_hyb.F
Index: trunk/LMDZ.MARS/libf/dynphy_lonlat/phymars/grid_noro1.F
===================================================================
--- trunk/LMDZ.MARS/libf/dynphy_lonlat/phymars/grid_noro1.F	(revision 1540)
+++ trunk/LMDZ.MARS/libf/dynphy_lonlat/phymars/grid_noro1.F	(revision 1540)
@@ -0,0 +1,425 @@
+      SUBROUTINE grid_noro1(imdep, jmdep, xdata, ydata, entree,
+     .                 imar, jmar, x, y, zmea,zstd,zsig,zgam,zthe)
+c=======================================================================
+c (F. Lott) (voir aussi z.x. Li, A. Harzallah et L. Fairhead)
+c
+c      Calcul des parametres de l'orographie sous-maille necessaires
+c      au nouveau shema de representation des montagnes meso-echelles
+c      dans le modele.  Les points sont mis sur une grille rectangulaire
+c      pseudo-physique.  Typiquement, il y a iim+1 latitudes incluant
+c      le pole nord et le pole sud.  Il y a jjm+1 longitudes, y compris
+c      aux poles.  Aux poles les champs peuvent ont une valeurs repetee
+c      jjm+1 fois.....  La valeur du champs en jjm+1 (jmar) est celle
+c      en j=1.  
+c      Les parametres a,b,c,d representent les limites de la region
+c      de point de grille correspondant a un point decrit precedemment.
+c      Les moyennes sur ces regions des valeurs calculees a partir de
+c      l'USN, sont ponderees par un poids, fonction de la surface
+c      occuppe par ces donnees a l'interieure de la grille du modele.
+c      Dans la plupart des cas ce poid est le rapport entre la surface
+c      de la region de point de grille USN et la surface de la region
+c      de point de grille du modele.
+c       
+c
+c           (c)
+c        ----d-----
+c        | . . . .|
+c        |        |
+c     (b)a . * . .b(a)
+c        |        |
+c        | . . . .|
+c        ----c-----
+c           (d)
+C=======================================================================
+c INPUT:
+c        imdep, jmdep: dimensions X et Y pour depart
+c        xdata, ydata: coordonnees X et Y pour depart
+c        entree: champ d'entree a transformer
+c        dans ce programme, on assume que les donnees sont les altitudes
+c        de l'USNavy: imdep=iusn=2160, jmdep=jusn=1080.
+c OUTPUT:
+c        imar, jmar: dimensions X et Y d'arrivee
+c        x, y: coordonnees X et Y d'arrivee
+c        les champs de sorties sont sur une grille physique:
+c             zmea:  orographie moyenne
+c             zstd:  deviation standard de l'orographie sous-maille
+c             zsig:  pente de l'orographie sous-maille 
+c             zgam:  anisotropy de l'orographie sous maille
+c             zthe:  orientation de l'axe oriente dans la direction
+c                    de plus grande pente de l'orographie sous maille
+C=======================================================================
+c     IMPLICIT INTEGER (I,J)
+c     IMPLICIT REAL(X,Z) 
+
+       USE comconst_mod, ONLY: rad
+
+       implicit none
+       integer iusn,jusn,iext
+       parameter(iusn=360,jusn=180,iext=40)
+c!-*-      include 'param1'
+c!-*-      include 'comcstfi.h'
+#include "dimensions.h"
+c!-*-
+c!-*-      parameter(iim=cols,jjm=rows)
+      REAL xusn(iusn+2*iext),yusn(jusn+2)	
+      REAL zusn(iusn+2*iext,jusn+2),zusnfi(iusn+2*iext,jusn+2)
+
+c   modif declarations pour implicit none
+      real zmeanor,zmeasud,zstdnor,zstdsud,zsignor
+      real zsigsud,zweinor,zweisud
+      real xk,xl,xm,xw,xp,xq
+      real zmaxmea,zmaxstd,zmaxsig,zmaxgam,zmaxthe,zminthe
+      real zbordnor,zbordsud,zbordest,zbordoue,xpi
+      real zdeltax,zdeltay,zlenx,zleny,weighx,weighy,xincr
+      integer i,j,ii,jj,ideltax,ihalph
+
+      INTEGER imdep, jmdep
+      REAL xdata(imdep),ydata(jmdep) 
+      REAL entree(imdep,jmdep)
+c
+      INTEGER imar, jmar
+  
+      REAL ztz(iim+1,jjm+1),zxtzx(iim+1,jjm+1)
+      REAL zytzy(iim+1,jjm+1),zxtzy(iim+1,jjm+1)
+      REAL zxtzxusn(iusn+2*iext,jusn+2),zytzyusn(iusn+2*iext,jusn+2)
+      REAL zxtzyusn(iusn+2*iext,jusn+2)
+      REAL weight(iim+1,jjm+1)
+      REAL x(imar+1),y(jmar)
+      REAL zmea(imar+1,jmar),zstd(imar+1,jmar)
+      REAL zsig(imar+1,jmar),zgam(imar+1,jmar),zthe(imar+1,jmar)
+c
+      REAL a(2200),b(2200),c(1100),d(1100)
+c
+c  quelques constantes:
+c
+      print *,' parametres de l orographie a l echelle sous maille' 
+      print*,'rad =',rad
+      print*,'Long et lat entree'
+      print*,(x(i),i=1,imar+1)
+      print*,(y(j),j=1,jmar)
+       print*,'Long et lat donnees'
+      print*,(xdata(i),i=1,imdep)
+      print*,(ydata(j),j=1,jmdep)
+
+      xpi=acos(-1.)
+      zdeltay=2.*xpi/real(jusn)*rad
+c
+c  quelques tests de dimensions:
+c    
+      IF (imar.GT.2200 .OR. jmar.GT.1100) THEN
+         PRINT*, 'imar ou jmar trop grand', imar, jmar
+         CALL ABORT
+      ENDIF
+
+      IF(imdep.ne.iusn.or.jmdep.ne.jusn)then
+         print *,' imdep ou jmdep mal dimensionnes:',imdep,jmdep
+         call abort
+      ENDIF
+
+      IF(imar+1.gt.iim+1.or.jmar.gt.jjm+1)THEN
+        print *,' imar ou jmar mal dimensionnes:',imar,jmar
+        call abort
+      ENDIF
+c
+C  Extension de la base de donnee de l'USN pour faciliter
+C  les calculs ulterieurs:
+c
+      DO j=1,jusn
+        yusn(j+1)=ydata(j)
+      DO i=1,iusn
+        zusn(i+iext,j+1)=entree(i,j)
+        xusn(i+iext)=xdata(i)
+      ENDDO
+      DO i=1,iext
+        zusn(i,j+1)=entree(iusn-iext+i,j)
+        xusn(i)=xdata(iusn-iext+i)-2.*xpi
+        zusn(iusn+iext+i,j+1)=entree(i,j)
+        xusn(iusn+iext+i)=xdata(i)+2.*xpi
+      ENDDO
+      ENDDO
+
+        yusn(1)=ydata(1)+(ydata(1)-ydata(2))
+        yusn(jusn+2)=ydata(jusn)+(ydata(jusn)-ydata(jusn-1))
+       DO i=1,iusn/2+iext
+        zusn(i,1)=zusn(i+iusn/2,2)
+        zusn(i+iusn/2+iext,1)=zusn(i,2)
+        zusn(i,jusn+2)=zusn(i+iusn/2,jusn+1)
+        zusn(i+iusn/2+iext,jusn+2)=zusn(i,jusn+1)
+       ENDDO
+c
+c  Calcul d'une orographie filtree aux hautes latitudes
+c  pour permettre des calculs plus isotropiques sur la pente
+c  des montagnes
+c
+       DO i=1,IUSN+2*iext
+       DO J=1,JUSN+2
+          zusnfi(i,j)=0.0
+       ENDDO
+       ENDDO
+
+      DO j=1,jusn
+            ideltax=1./cos(yusn(j+1))
+            ideltax=min(iusn/2-1,ideltax)
+            IF(MOD(IDELTAX,2).EQ.0)THEN
+              IDELTAX=IDELTAX+1
+            ENDIF
+            IHALPH=(IDELTAX-1)/2 
+c           print *,' ideltax=',ideltax
+         IF(ideltax.eq.1)THEN
+            DO i=1,iusn
+               zusnfi(i+iext,j+1)=entree(i,j)
+            ENDDO   
+         ELSE
+            DO i=1,ihalph
+               DO ii=1,i+ihalph
+               zusnfi(i+iext,j+1)=zusnfi(i+iext,j+1)+entree(ii,j)
+               ENDDO
+               DO ii=ihalph-i,0,-1
+               zusnfi(i+iext,j+1)=zusnfi(i+iext,j+1)+entree(iusn-ii,j)
+               ENDDO  
+               zusnfi(i+iext,j+1)=zusnfi(i+iext,j+1)/real(ideltax)
+            ENDDO   
+            DO i=iusn-ihalph+1,iusn
+               DO ii = i-ihalph,iusn
+               zusnfi(i+iext,j+1)=zusnfi(i+iext,j+1)+entree(ii,j)
+               ENDDO 
+               DO ii = 1,ihalph+i-iusn
+               zusnfi(i+iext,j+1)=zusnfi(i+iext,j+1)+entree(ii,j)
+               ENDDO
+               zusnfi(i+iext,j+1)=zusnfi(i+iext,j+1)/real(ideltax)
+            ENDDO
+            DO i=ihalph+1,iusn-ihalph
+               DO ii=-ihalph,ihalph
+               zusnfi(i+iext,j+1)=zusnfi(i+iext,j+1)+entree(i+ii,j)
+               ENDDO
+               zusnfi(i+iext,j+1)=zusnfi(i+iext,j+1)/real(ideltax)
+            ENDDO
+         ENDIF
+            DO i=1,iext
+               zusnfi(i,j+1)=zusnfi(iusn-iext+i,j+1)
+               zusnfi(i+iusn+iext,j+1)=zusnfi(i,j+1)
+            ENDDO
+      ENDDO
+c  
+c Calculer les limites des zones des nouveaux points
+c
+      a(1) = x(1) - (x(2)-x(1))/2.0
+      b(1) = (x(1)+x(2))/2.0
+      DO i = 2, imar-1
+         a(i) = b(i-1)
+         b(i) = (x(i)+x(i+1))/2.0
+      ENDDO
+      a(imar) = b(imar-1)
+      b(imar) = x(imar) + (x(imar)-x(imar-1))/2.0
+
+      c(1) = y(1) - (y(2)-y(1))/2.0
+      d(1) = (y(1)+y(2))/2.0
+      DO j = 2, jmar-1
+         c(j) = d(j-1)
+         d(j) = (y(j)+y(j+1))/2.0
+      ENDDO
+      c(jmar) = d(jmar-1)
+      d(jmar) = y(jmar) + (y(jmar)-y(jmar-1))/2.0
+c
+c      quelques initialisations:
+      print*,'OKM1'
+c
+      DO i = 1, imar
+      DO j = 1, jmar
+         weight(i,j) = 0.0
+         zxtzx(i,j) = 0.0
+         zytzy(i,j) = 0.0
+         zxtzy(i,j) = 0.0
+         ztz(i,j) = 0.0
+         zmea(i,j) = 0.0
+         zstd(i,j)=0.0
+      ENDDO
+      ENDDO
+c
+c  calculs des correlations de pentes sur la grille de l'USN.
+c
+         DO j = 2,jusn+1 
+         DO i = 1, iusn+2*iext
+            zytzyusn(i,j)=0.0
+            zxtzxusn(i,j)=0.0
+            zxtzyusn(i,j)=0.0
+         ENDDO
+         ENDDO
+
+
+         DO j = 2,jusn+1 
+            zdeltax=zdeltay*cos(yusn(j))
+         DO i = 2, iusn+2*iext-1
+            zytzyusn(i,j)=(zusn(i,j+1)-zusn(i,j-1))**2/zdeltay**2
+            zxtzxusn(i,j)=(zusnfi(i+1,j)-zusnfi(i-1,j))**2/zdeltax**2
+            zxtzyusn(i,j)=(zusn(i,j+1)-zusn(i,j-1))/zdeltay
+     *                   *(zusnfi(i+1,j)-zusnfi(i-1,j))/zdeltax
+         ENDDO
+
+         ENDDO
+
+ 
+
+      print*,'OK0'
+c
+c  sommations des differentes quantites definies precedemment
+c  sur une grille du modele.
+c 
+      zleny=xpi/real(jusn)*rad
+      xincr=xpi/2./real(jusn)
+       DO ii = 1, imar
+       DO jj = 1, jmar
+c        PRINT *,' iteration ii jj:',ii,jj
+         DO j = 2,jusn+1 
+c         DO j = 3,jusn 
+            zlenx=zleny*cos(yusn(j))
+            zdeltax=zdeltay*cos(yusn(j))
+            zbordnor=(c(jj)-yusn(j)+xincr)*rad
+            zbordsud=(yusn(j)-d(jj)+xincr)*rad
+            weighy=amax1(0.,
+     *             amin1(zbordnor,zbordsud,zleny))
+         IF(weighy.ne.0)THEN
+         DO i = 2, iusn+2*iext-1
+            zbordest=(xusn(i)-a(ii)+xincr)*rad*cos(yusn(j))
+            zbordoue=(b(ii)+xincr-xusn(i))*rad*cos(yusn(j))
+            weighx=amax1(0.,
+     *             amin1(zbordest,zbordoue,zlenx))
+            IF(weighx.ne.0)THEN
+            weight(ii,jj)=weight(ii,jj)+weighx*weighy
+            zxtzx(ii,jj)=zxtzx(ii,jj)+zxtzxusn(i,j)*weighx*weighy
+            zytzy(ii,jj)=zytzy(ii,jj)+zytzyusn(i,j)*weighx*weighy
+            zxtzy(ii,jj)=zxtzy(ii,jj)+zxtzyusn(i,j)*weighx*weighy
+            ztz(ii,jj)  =ztz(ii,jj)  +zusn(i,j)*zusn(i,j)*weighx*weighy
+            zmea(ii,jj) =zmea(ii,jj)+zusn(i,j)*weighx*weighy
+            ENDIF
+         ENDDO
+         ENDIF
+         ENDDO
+       ENDDO
+       ENDDO
+c
+c  calculs des differents parametres necessaires au programme
+c  de parametrisation de l'orographie a l'echelle moyenne:
+c
+      zmaxmea=0.
+      zmaxstd=0.
+      zmaxsig=0.
+      zmaxgam=0.
+      zmaxthe=0.
+      zminthe=0.
+c     print 100,' '
+c100  format(1X,A1,'II JJ',4X,'H',8X,'SD',8X,'SI',3X,'GA',3X,'TH') 
+       print*,'OK1'
+       DO ii = 1, imar
+       DO jj = 1, jmar
+c       print*,'ok0'
+         IF (weight(ii,jj) .NE. 0.0) THEN
+c  Orography moyenne:
+c         print*,'ok1'
+           zmea (ii,jj)=zmea (ii,jj)/weight(ii,jj)
+           zxtzx(ii,jj)=zxtzx(ii,jj)/weight(ii,jj)
+           zytzy(ii,jj)=zytzy(ii,jj)/weight(ii,jj)
+           zxtzy(ii,jj)=zxtzy(ii,jj)/weight(ii,jj)
+           ztz(ii,jj)  =ztz(ii,jj)/weight(ii,jj)
+c         print*,'ok2'
+c  Deviation standard:
+           zstd(ii,jj)=sqrt(amax1(0.,ztz(ii,jj)-zmea(ii,jj)**2))
+c  Coefficients K, L et M:
+           xk=(zxtzx(ii,jj)+zytzy(ii,jj))/2.
+           xl=(zxtzx(ii,jj)-zytzy(ii,jj))/2.
+           xm=zxtzy(ii,jj)
+           xp=xk-sqrt(xl**2+xm**2)
+           xq=xk+sqrt(xl**2+xm**2)
+           xw=1.e-8
+           if(xp.le.xw) xp=0.
+           if(xq.le.xw) xq=xw
+           if(abs(xm).le.xw) xm=xw*sign(1.,xm)
+c          print*,'ok3'
+c pente: 
+           zsig(ii,jj)=sqrt(xq)
+c           zsig(ii,jj)=sqrt(2.*xk)
+c isotropy:
+           zgam(ii,jj)=xp/xq
+c angle theta:
+           zthe(ii,jj)=57.29577951*atan2(xm,xl)/2.
+
+c          print 101,ii,jj,
+c    *           zmea(ii,jj),zstd(ii,jj),zsig(ii,jj),zgam(ii,jj),
+c    *           zthe(ii,jj)
+c101  format(1x,2(1x,i2),2(1x,f7.1),1x,f7.4,2x,f4.2,1x,f5.1)     
+c          print*,'ok4'
+         ELSE
+c           PRINT*, 'probleme,ii,jj=', ii,jj
+c          print*,'ok1b'
+         ENDIF
+      zmaxmea=amax1(zmea(ii,jj),zmaxmea)
+c         print*,'oka'
+      zmaxstd=amax1(zstd(ii,jj),zmaxstd)
+c         print*,'okb'
+      zmaxsig=amax1(zsig(ii,jj),zmaxsig)
+c         print*,'okc'
+      zmaxgam=amax1(zgam(ii,jj),zmaxgam)
+c         print*,'okd'
+      zmaxthe=amax1(zthe(ii,jj),zmaxthe)
+c         print*,'oke'
+      zminthe=amin1(zthe(ii,jj),zminthe)
+c      print*,'ok5'
+       ENDDO
+       ENDDO
+
+      print *,'  MEAN ORO:',zmaxmea
+	  print *,'  ST. DEV.:',zmaxstd
+      print *,'  PENTE:',zmaxsig
+      print *,' ANISOTROP:',zmaxgam
+      print *,'  ANGLE:',zminthe,zmaxthe	
+      
+C
+c  On passe ce donnees sur la grille dite physique....(?)
+c  On met gamma et theta a 1. et 0. aux poles ou ces quantites
+c  n'ont pas vraiment de sens
+c
+      DO jj=1,jmar
+      zmea(imar+1,jj)=zmea(1,jj)
+      zstd(imar+1,jj)=zstd(1,jj)
+      zsig(imar+1,jj)=zsig(1,jj)
+      zgam(imar+1,jj)=zgam(1,jj)
+      zthe(imar+1,jj)=zthe(1,jj)
+      ENDDO
+
+
+      zmeanor=0.0
+      zmeasud=0.0
+      zstdnor=0.0
+      zstdsud=0.0
+      zsignor=0.0
+      zsigsud=0.0
+      zweinor=0.0
+      zweisud=0.0
+
+      DO ii=1,imar
+      zweinor=zweinor+              weight(ii,   1)
+      zweisud=zweisud+              weight(ii,jmar)
+      zmeanor=zmeanor+zmea(ii,   1)*weight(ii,   1)
+      zmeasud=zmeasud+zmea(ii,jmar)*weight(ii,jmar)
+      zstdnor=zstdnor+zstd(ii,   1)*weight(ii,   1)
+      zstdsud=zstdsud+zstd(ii,jmar)*weight(ii,jmar)
+      zsignor=zsignor+zsig(ii,   1)*weight(ii,   1)
+      zsigsud=zsigsud+zsig(ii,jmar)*weight(ii,jmar)
+      ENDDO
+
+      DO ii=1,imar+1
+      zmea(ii,   1)=zmeanor/zweinor
+      zmea(ii,jmar)=zmeasud/zweisud
+      zstd(ii,   1)=zstdnor/zweinor
+      zstd(ii,jmar)=zstdsud/zweisud
+      zsig(ii,   1)=zsignor/zweinor
+      zsig(ii,jmar)=zsigsud/zweisud
+      zgam(ii,   1)=1.
+      zgam(ii,jmar)=1.
+      zthe(ii,   1)=0.
+      zthe(ii,jmar)=0.
+      ENDDO
+
+
+      RETURN
+      END
Index: trunk/LMDZ.MARS/libf/dynphy_lonlat/phymars/ini_archive.F
===================================================================
--- trunk/LMDZ.MARS/libf/dynphy_lonlat/phymars/ini_archive.F	(revision 1540)
+++ trunk/LMDZ.MARS/libf/dynphy_lonlat/phymars/ini_archive.F	(revision 1540)
@@ -0,0 +1,521 @@
+c=======================================================================
+      subroutine ini_archive(nid,idayref,phis,ith,tab_cntrl_fi)
+c=======================================================================
+c
+c
+c   Date:    01/1997
+c   ----
+c
+c   Objet:  ecriture de l'entete du fichier "start_archive"
+c   -----
+c
+c	 Proche de iniwrite.F
+c
+c	 On ajoute dans le tableau "tab_cntrl" (dynamique), a partir de 51, 
+c	 les valeurs de tab_cntrl_fi (les 38 parametres de controle physiques
+c	 du RUN + ptotal et cotoicetotal)
+c
+c			tab_cntrl(50+l)=tab_cntrl_fi(l)
+c
+c   Arguments:
+c   ---------
+c
+c	Inputs:
+c   ------
+c
+c       nid            unite logique du fichier "start_archive"
+c       idayref        Valeur du jour initial a mettre dans
+c                      l'entete du fichier "start_archive"
+c       phis           geopotentiel au sol
+c       ith            soil thermal inertia
+c       tab_cntrl_fi   tableau des param physiques
+c
+
+c=======================================================================
+ 
+      use comsoil_h, only: nsoilmx, mlayer
+      USE comvert_mod, ONLY: ap,bp,aps,bps,pa,preff,presnivs,pseudoalt
+      USE comconst_mod, ONLY: daysec,dtvr,rad,omeg,g,cpp,kappa,pi
+      USE logic_mod, ONLY: fxyhypb,ysinus
+      USE serre_mod, ONLY: clon,clat,grossismx,grossismy,dzoomx,dzoomy
+      USE ener_mod, ONLY: etot0,ptot0,ztot0,stot0,ang0
+      implicit none
+
+#include "dimensions.h"
+#include "paramet.h"
+#include "comgeom.h"
+#include "netcdf.inc"
+
+c-----------------------------------------------------------------------
+c   Declarations
+c-----------------------------------------------------------------------
+
+c   Local:
+c   ------
+      INTEGER	length,l
+      parameter (length = 100)
+      REAL		tab_cntrl(length) ! tableau des parametres du run
+      INTEGER	loop
+      INTEGER	ierr, setvdim, putvdim, putdat, setname,cluvdb
+      INTEGER	setdim
+      INTEGER	ind1,indlast
+
+c   Arguments:
+c   ----------
+      INTEGER*4	idayref
+      REAL		phis(ip1jmp1)
+      real ith(ip1jmp1,nsoilmx)
+      REAL		tab_cntrl_fi(length)
+
+!Mars --------Ajouts-----------
+c   Variables locales pour NetCDF:
+c
+      INTEGER dims2(2), dims3(3) !, dims4(4)
+      INTEGER idim_index
+      INTEGER idim_rlonu, idim_rlonv, idim_rlatu, idim_rlatv
+      INTEGER idim_llmp1,idim_llm
+      INTEGER idim_tim
+      INTEGER idim_nsoilmx ! "subsurface_layers" dimension ID #
+      INTEGER nid,nvarid
+      real sig_s(llm),s(llm)
+
+      pi  = 2. * ASIN(1.)
+
+
+c-----------------------------------------------------------------------
+c   Remplissage du tableau des parametres de controle du RUN  (dynamique)
+c-----------------------------------------------------------------------
+
+      DO l=1,length
+         tab_cntrl(l)=0.
+      ENDDO
+
+ccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc
+      tab_cntrl(1)  = REAL(iim) ! nombre de points en longitude
+      tab_cntrl(2)  = REAL(jjm) ! nombre de points en latitude
+      tab_cntrl(3)  = REAL(llm) ! nombre de couches
+      tab_cntrl(4)  = REAL(idayref) ! jour 0
+      tab_cntrl(5)  = rad ! rayon de mars(m) ~3397200
+      tab_cntrl(6)  = omeg ! vitesse de rotation (rad.s-1)
+      tab_cntrl(7)  = g   ! gravite (m.s-2) ~3.72
+      tab_cntrl(8)  = cpp 
+      tab_cntrl(8)  = 43.49 !mars temporaire Masse molaire de l''atm (g.mol-1) ~43.49
+      tab_cntrl(9)  = kappa ! = r/cp  ~0.256793 (=rcp dans physique)
+      tab_cntrl(10) = daysec ! duree du sol (s)  ~88775
+      tab_cntrl(11) = dtvr ! pas de temps de la dynamique (s)
+      tab_cntrl(12) = etot0 ! energie totale    !
+      tab_cntrl(13) = ptot0 ! pression totalei   !    variables
+      tab_cntrl(14) = ztot0 ! enstrophie totale   !  de controle
+      tab_cntrl(15) = stot0 ! enthalpie totale   !    globales
+      tab_cntrl(16) = ang0 ! moment cinetique  !
+      tab_cntrl(17) = pa
+      tab_cntrl(18) = preff
+
+c    .....    parametres  pour le zoom      ......   
+
+      tab_cntrl(19)  = clon ! longitude en degres du centre du zoom
+      tab_cntrl(20)  = clat ! latitude en degres du centre du zoom
+      tab_cntrl(21)  = grossismx ! facteur de grossissement du zoom,selon longitude
+      tab_cntrl(22)  = grossismy ! facteur de grossissement du zoom ,selon latitude
+
+      IF ( fxyhypb )   THEN
+       tab_cntrl(23) = 1.
+       tab_cntrl(24) = dzoomx ! extension en longitude  de la zone du zoom
+       tab_cntrl(25) = dzoomy ! extension en latitude  de la zone du zoom
+      ELSE
+       tab_cntrl(23) = 0.
+       tab_cntrl(24) = dzoomx ! extension en longitude  de la zone du zoom
+       tab_cntrl(25) = dzoomy ! extension en latitude  de la zone du zoom
+       tab_cntrl(26) = 0.
+       IF ( ysinus)  tab_cntrl(26) = 1.
+      ENDIF
+
+c-----------------------------------------------------------------------
+c   Copie du tableau des parametres de controle du RUN  (physique)
+c		dans le tableau dynamique
+c-----------------------------------------------------------------------
+
+      DO l=1,50
+         tab_cntrl(50+l)=tab_cntrl_fi(l)
+      ENDDO
+
+c=======================================================================
+c	Ecriture NetCDF de l''entete du fichier "start_archive"
+c=======================================================================
+
+c
+c Preciser quelques attributs globaux:
+c
+      ierr = NF_PUT_ATT_TEXT (nid, NF_GLOBAL, "title", 21,
+     &                       "Fichier start_archive")
+c
+c Definir les dimensions du fichiers:
+c
+c     CHAMPS AJOUTES POUR LA VISUALISATION T,ps, etc... avec Grads ou ferret:
+      ierr = NF_DEF_DIM (nid, "latitude", jjp1, idim_rlatu)
+      ierr = NF_DEF_DIM (nid, "longitude", iip1, idim_rlonv)
+      ierr = NF_DEF_DIM (nid, "altitude", llm, idim_llm)
+      ierr = NF_DEF_DIM (nid,"subsurface_layers",nsoilmx,idim_nsoilmx)
+
+      ierr = NF_DEF_DIM (nid,"index", length, idim_index)
+      ierr = NF_DEF_DIM (nid,"rlonu", iip1, idim_rlonu)
+      ierr = NF_DEF_DIM (nid,"rlatv", jjm, idim_rlatv)
+      ierr = NF_DEF_DIM (nid,"interlayer", llmp1, idim_llmp1)
+      ierr = NF_DEF_DIM (nid,"Time", NF_UNLIMITED, idim_tim)
+
+c
+      ierr = NF_ENDDEF(nid) ! sortir du mode de definition
+
+c-----------------------------------------------------------------------
+c  Ecriture du tableau des parametres du run
+c-----------------------------------------------------------------------
+
+      call def_var(nid,"Time","Time","days since 00:00:00",1,
+     .            idim_tim,nvarid,ierr)
+
+      ierr = NF_REDEF (nid)
+#ifdef NC_DOUBLE
+      ierr = NF_DEF_VAR (nid,"controle",NF_DOUBLE,1,idim_index,nvarid)
+#else
+      ierr = NF_DEF_VAR (nid,"controle",NF_FLOAT,1,idim_index,nvarid)
+#endif
+      ierr = NF_PUT_ATT_TEXT (nid, nvarid, "title", 22,
+     .                       "Parametres de controle")
+      ierr = NF_ENDDEF(nid)
+#ifdef NC_DOUBLE
+      ierr = NF_PUT_VAR_DOUBLE (nid,nvarid,tab_cntrl)
+#else
+      ierr = NF_PUT_VAR_REAL (nid,nvarid,tab_cntrl)
+#endif
+
+c-----------------------------------------------------------------------
+c  Ecriture des longitudes et latitudes
+c-----------------------------------------------------------------------
+
+      ierr = NF_REDEF (nid)
+#ifdef NC_DOUBLE
+      ierr = NF_DEF_VAR (nid,"rlonu",NF_DOUBLE,1,idim_rlonu,nvarid)
+#else
+      ierr = NF_DEF_VAR (nid,"rlonu",NF_FLOAT,1,idim_rlonu,nvarid)
+#endif
+      ierr = NF_PUT_ATT_TEXT (nid, nvarid, "title", 23,
+     .                       "Longitudes des points U")
+      ierr = NF_ENDDEF(nid)
+#ifdef NC_DOUBLE
+      ierr = NF_PUT_VAR_DOUBLE (nid,nvarid,rlonu)
+#else
+      ierr = NF_PUT_VAR_REAL (nid,nvarid,rlonu)
+#endif
+c
+      ierr = NF_REDEF (nid)
+#ifdef NC_DOUBLE
+      ierr = NF_DEF_VAR (nid,"rlatu",NF_DOUBLE,1,idim_rlatu,nvarid)
+#else
+      ierr = NF_DEF_VAR (nid,"rlatu",NF_FLOAT,1,idim_rlatu,nvarid)
+#endif
+      ierr = NF_PUT_ATT_TEXT (nid, nvarid, "title", 22,
+     .                       "Latitudes des points U")
+      ierr = NF_ENDDEF(nid)
+#ifdef NC_DOUBLE
+      ierr = NF_PUT_VAR_DOUBLE (nid,nvarid,rlatu)
+#else
+      ierr = NF_PUT_VAR_REAL (nid,nvarid,rlatu)
+#endif
+c
+      ierr = NF_REDEF (nid)
+#ifdef NC_DOUBLE
+      ierr = NF_DEF_VAR (nid,"rlonv",NF_DOUBLE,1,idim_rlonv,nvarid)
+#else
+      ierr = NF_DEF_VAR (nid,"rlonv",NF_FLOAT,1,idim_rlonv,nvarid)
+#endif
+      ierr = NF_PUT_ATT_TEXT (nid, nvarid, "title", 23,
+     .                       "Longitudes des points V")
+      ierr = NF_ENDDEF(nid)
+#ifdef NC_DOUBLE
+      ierr = NF_PUT_VAR_DOUBLE (nid,nvarid,rlonv)
+#else
+      ierr = NF_PUT_VAR_REAL (nid,nvarid,rlonv)
+#endif
+c
+      ierr = NF_REDEF (nid)
+#ifdef NC_DOUBLE
+      ierr = NF_DEF_VAR (nid,"rlatv",NF_DOUBLE,1,idim_rlatv,nvarid)
+#else
+      ierr = NF_DEF_VAR (nid,"rlatv",NF_FLOAT,1,idim_rlatv,nvarid)
+#endif
+      ierr = NF_PUT_ATT_TEXT (nid, nvarid, "title", 22,
+     .                       "Latitudes des points V")
+      ierr = NF_ENDDEF(nid)
+#ifdef NC_DOUBLE
+      ierr = NF_PUT_VAR_DOUBLE (nid,nvarid,rlatv)
+#else
+      ierr = NF_PUT_VAR_REAL (nid,nvarid,rlatv)
+#endif
+
+c-----------------------------------------------------------------------
+c  Ecriture des niveaux verticaux
+c-----------------------------------------------------------------------
+
+c
+      ierr = NF_REDEF (nid)
+#ifdef NC_DOUBLE
+      ierr = NF_DEF_VAR (nid,"ap",NF_DOUBLE,1,idim_llmp1,nvarid)
+#else
+      ierr = NF_DEF_VAR (nid,"ap",NF_FLOAT,1,idim_llmp1,nvarid)
+#endif
+      ierr = NF_PUT_ATT_TEXT (nid, nvarid, "title", 32,
+     .                       "Coef A: niveaux pression hybride")
+      ierr = NF_ENDDEF(nid)
+#ifdef NC_DOUBLE
+      ierr = NF_PUT_VAR_DOUBLE (nid,nvarid,ap)
+#else
+      ierr = NF_PUT_VAR_REAL (nid,nvarid,ap)
+#endif
+c
+      ierr = NF_REDEF (nid)
+#ifdef NC_DOUBLE
+      ierr = NF_DEF_VAR (nid,"bp",NF_DOUBLE,1,idim_llmp1,nvarid)
+#else
+      ierr = NF_DEF_VAR (nid,"bp",NF_FLOAT,1,idim_llmp1,nvarid)
+#endif
+      ierr = NF_PUT_ATT_TEXT (nid, nvarid, "title", 35,
+     .                       "Coefficient B niveaux sigma hybride")
+      ierr = NF_ENDDEF(nid)
+#ifdef NC_DOUBLE
+      ierr = NF_PUT_VAR_DOUBLE (nid,nvarid,bp)
+#else
+      ierr = NF_PUT_VAR_REAL (nid,nvarid,bp)
+#endif
+c
+c ----------------------
+      ierr = NF_REDEF (nid)
+#ifdef NC_DOUBLE
+      ierr = NF_DEF_VAR (nid,"aps",NF_DOUBLE,1,idim_llm,nvarid)
+#else
+      ierr = NF_DEF_VAR (nid,"aps",NF_FLOAT,1,idim_llm,nvarid)
+#endif
+      ierr = NF_PUT_ATT_TEXT (nid, nvarid, "title", 36,
+     .      "Coef AS: hybrid pressure in midlayers")
+      ierr = NF_ENDDEF(nid)
+#ifdef NC_DOUBLE
+      ierr = NF_PUT_VAR_DOUBLE (nid,nvarid,aps)
+#else
+      ierr = NF_PUT_VAR_REAL (nid,nvarid,aps)
+#endif
+c
+c ----------------------
+      ierr = NF_REDEF (nid)
+#ifdef NC_DOUBLE
+      ierr = NF_DEF_VAR (nid,"bps",NF_DOUBLE,1,idim_llm,nvarid)
+#else
+      ierr = NF_DEF_VAR (nid,"bps",NF_FLOAT,1,idim_llm,nvarid)
+#endif
+      ierr = NF_PUT_ATT_TEXT (nid, nvarid, "title", 30,
+     .      "Coef BS: hybrid sigma midlayers")
+      ierr = NF_ENDDEF(nid)
+#ifdef NC_DOUBLE
+      ierr = NF_PUT_VAR_DOUBLE (nid,nvarid,bps)
+#else
+      ierr = NF_PUT_VAR_REAL (nid,nvarid,bps)
+#endif
+c
+c ----------------------
+
+      ierr = NF_REDEF (nid)
+#ifdef NC_DOUBLE
+      ierr = NF_DEF_VAR (nid,"presnivs",NF_DOUBLE,1,idim_llm,nvarid)
+#else
+      ierr = NF_DEF_VAR (nid,"presnivs",NF_FLOAT,1,idim_llm,nvarid)
+#endif
+      ierr = NF_ENDDEF(nid)
+#ifdef NC_DOUBLE
+      ierr = NF_PUT_VAR_DOUBLE (nid,nvarid,presnivs)
+#else
+      ierr = NF_PUT_VAR_REAL (nid,nvarid,presnivs)
+#endif
+c ------------------------------------------------------------------
+c  Variable uniquement pour visualisation avec Grads ou Ferret
+c ------------------------------------------------------------------
+      ierr = NF_REDEF (nid)
+#ifdef NC_DOUBLE
+      ierr = NF_DEF_VAR (nid,"latitude",NF_DOUBLE,1,idim_rlatu,nvarid)
+#else
+      ierr = NF_DEF_VAR (nid,"latitude",NF_FLOAT,1,idim_rlatu,nvarid)
+#endif
+      ierr =NF_PUT_ATT_TEXT(nid,nvarid,'units',13,"degrees_north")
+      ierr = NF_PUT_ATT_TEXT (nid,nvarid,"long_name", 14,
+     .      "North latitude")
+      ierr = NF_ENDDEF(nid)
+#ifdef NC_DOUBLE
+      ierr = NF_PUT_VAR_DOUBLE (nid,nvarid,rlatu/pi*180)
+#else
+      ierr = NF_PUT_VAR_REAL (nid,nvarid,rlatu/pi*180)
+#endif
+c----------------------
+       ierr = NF_REDEF (nid)
+#ifdef NC_DOUBLE
+      ierr =NF_DEF_VAR(nid,"longitude", NF_DOUBLE, 1, idim_rlonv,nvarid)
+#else
+      ierr = NF_DEF_VAR(nid,"longitude", NF_FLOAT, 1, idim_rlonv,nvarid)
+#endif
+      ierr = NF_PUT_ATT_TEXT (nid,nvarid,"long_name", 14,
+     .      "East longitude")
+      ierr = NF_PUT_ATT_TEXT(nid,nvarid,'units',12,"degrees_east")
+      ierr = NF_ENDDEF(nid)
+#ifdef NC_DOUBLE
+      ierr = NF_PUT_VAR_DOUBLE (nid,nvarid,rlonv/pi*180)
+#else
+      ierr = NF_PUT_VAR_REAL (nid,nvarid,rlonv/pi*180)
+#endif
+c--------------------------
+      ierr = NF_REDEF (nid)
+#ifdef NC_DOUBLE
+      ierr = NF_DEF_VAR (nid, "altitude", NF_DOUBLE, 1,
+     .       idim_llm,nvarid)
+#else
+      ierr = NF_DEF_VAR (nid, "altitude", NF_FLOAT, 1,
+     .       idim_llm,nvarid)
+#endif
+      ierr = NF_PUT_ATT_TEXT (nid,nvarid,"long_name",10,"pseudo-alt")
+      ierr = NF_PUT_ATT_TEXT (nid,nvarid,'units',2,"km")
+      ierr = NF_PUT_ATT_TEXT (nid,nvarid,'positive',2,"up")
+
+      ierr = NF_ENDDEF(nid)
+#ifdef NC_DOUBLE
+      ierr = NF_PUT_VAR_DOUBLE (nid,nvarid,pseudoalt)
+#else
+      ierr = NF_PUT_VAR_REAL (nid,nvarid,pseudoalt)
+#endif
+
+!-------------------------------
+! (soil) depth variable mlayer() (known from comsoil.h)
+!-------------------------------
+      ierr=NF_REDEF (nid) ! Enter NetCDF (re-)define mode
+      ! define variable
+#ifdef NC_DOUBLE
+      ierr=NF_DEF_VAR(nid,"soildepth",NF_DOUBLE,1,idim_nsoilmx,nvarid)
+#else
+      ierr=NF_DEF_VAR(nid,"soildepth",NF_FLOAT,1,idim_nsoilmx,nvarid)
+#endif
+      ierr=NF_PUT_ATT_TEXT (nid,nvarid,"long_name", 20,
+     .                        "Soil mid-layer depth")
+      ierr=NF_PUT_ATT_TEXT (nid,nvarid,"units",1,"m")
+      ierr=NF_PUT_ATT_TEXT (nid,nvarid,"positive",4,"down")
+      ierr=NF_ENDDEF(nid) ! Leave NetCDF define mode
+      ! write variable
+#ifdef NC_DOUBLE
+      ierr=NF_PUT_VAR_DOUBLE (nid,nvarid,mlayer)
+#else
+      ierr=NF_PUT_VAR_REAL (nid,nvarid,mlayer)
+#endif
+
+!---------------------
+! soil thermal inertia
+!---------------------
+      ierr=NF_REDEF (nid) ! Enter NetCDF (re-)define mode
+      dims3(1)=idim_rlonv
+      dims3(2)=idim_rlatu
+      dims3(3)=idim_nsoilmx
+      ! define variable
+#ifdef NC_DOUBLE
+      ierr=NF_DEF_VAR(nid,"inertiedat",NF_DOUBLE,3,dims3,nvarid)
+#else
+      ierr=NF_DEF_VAR(nid,"inertiedat",NF_FLOAT,3,dims3,nvarid)
+#endif
+      ierr=NF_PUT_ATT_TEXT (nid,nvarid,"long_name", 20,
+     &                        "Soil thermal inertia")
+      ierr=NF_PUT_ATT_TEXT (nid,nvarid,"units",15,
+     &                        "J.s-1/2.m-2.K-1")
+      ierr=NF_ENDDEF(nid) ! Leave NetCDF define mode
+      ! write variable
+#ifdef NC_DOUBLE
+      ierr=NF_PUT_VAR_DOUBLE (nid,nvarid,ith)
+#else
+      ierr=NF_PUT_VAR_REAL (nid,nvarid,ith)
+#endif
+
+c-----------------------------------------------------------------------
+c  Ecriture aire et coefficients de passage cov. <-> contra. <--> naturel
+c-----------------------------------------------------------------------
+
+      ierr = NF_REDEF (nid)
+      dims2(1) = idim_rlonu
+      dims2(2) = idim_rlatu
+#ifdef NC_DOUBLE
+      ierr = NF_DEF_VAR (nid,"cu",NF_DOUBLE,2,dims2,nvarid)
+#else
+      ierr = NF_DEF_VAR (nid,"cu",NF_FLOAT,2,dims2,nvarid)
+#endif
+      ierr = NF_PUT_ATT_TEXT (nid, nvarid, "title", 29,
+     .                       "Coefficient de passage pour U")
+      ierr = NF_ENDDEF(nid)
+#ifdef NC_DOUBLE
+      ierr = NF_PUT_VAR_DOUBLE (nid,nvarid,cu)
+#else
+      ierr = NF_PUT_VAR_REAL (nid,nvarid,cu)
+#endif
+c
+      ierr = NF_REDEF (nid)
+      dims2(1) = idim_rlonv
+      dims2(2) = idim_rlatv
+#ifdef NC_DOUBLE
+      ierr = NF_DEF_VAR (nid,"cv",NF_DOUBLE,2,dims2,nvarid)
+#else
+      ierr = NF_DEF_VAR (nid,"cv",NF_FLOAT,2,dims2,nvarid)
+#endif
+      ierr = NF_PUT_ATT_TEXT (nid, nvarid, "title", 29,
+     .                       "Coefficient de passage pour V")
+      ierr = NF_ENDDEF(nid)
+#ifdef NC_DOUBLE
+      ierr = NF_PUT_VAR_DOUBLE (nid,nvarid,cv)
+#else
+      ierr = NF_PUT_VAR_REAL (nid,nvarid,cv)
+#endif
+c
+c Aire de chaque maille:
+c
+      ierr = NF_REDEF (nid)
+      dims2(1) = idim_rlonv
+      dims2(2) = idim_rlatu
+#ifdef NC_DOUBLE
+      ierr = NF_DEF_VAR (nid,"aire",NF_DOUBLE,2,dims2,nvarid)
+#else
+      ierr = NF_DEF_VAR (nid,"aire",NF_FLOAT,2,dims2,nvarid)
+#endif
+      ierr = NF_PUT_ATT_TEXT (nid, nvarid, "title", 22,
+     .                       "Aires de chaque maille")
+      ierr = NF_ENDDEF(nid)
+#ifdef NC_DOUBLE
+      ierr = NF_PUT_VAR_DOUBLE (nid,nvarid,aire)
+#else
+      ierr = NF_PUT_VAR_REAL (nid,nvarid,aire)
+#endif
+
+c-----------------------------------------------------------------------
+c  Ecriture du geopentiel au sol
+c-----------------------------------------------------------------------
+
+      ierr = NF_REDEF (nid)
+      dims2(1) = idim_rlonv
+      dims2(2) = idim_rlatu
+#ifdef NC_DOUBLE
+      ierr = NF_DEF_VAR (nid,"phisinit",NF_DOUBLE,2,dims2,nvarid)
+#else
+      ierr = NF_DEF_VAR (nid,"phisinit",NF_FLOAT,2,dims2,nvarid)
+#endif
+      ierr = NF_PUT_ATT_TEXT (nid, nvarid, "title", 19,
+     .                       "Geopotentiel au sol")
+      ierr = NF_ENDDEF(nid)
+#ifdef NC_DOUBLE
+      ierr = NF_PUT_VAR_DOUBLE (nid,nvarid,phis)
+#else
+      ierr = NF_PUT_VAR_REAL (nid,nvarid,phis)
+#endif
+
+      PRINT*,'iim,jjm,llm,idayref',iim,jjm,llm,idayref
+      PRINT*,'rad,omeg,g,mugaz,kappa',
+     s rad,omeg,g,43.49,kappa !mars temporaire (ecrire mugaz ensuite)
+      PRINT*,'daysec,dtvr',daysec,dtvr
+
+      RETURN
+      END
Index: trunk/LMDZ.MARS/libf/dynphy_lonlat/phymars/iniphysiq_mod.F90
===================================================================
--- trunk/LMDZ.MARS/libf/dynphy_lonlat/phymars/iniphysiq_mod.F90	(revision 1540)
+++ trunk/LMDZ.MARS/libf/dynphy_lonlat/phymars/iniphysiq_mod.F90	(revision 1540)
@@ -0,0 +1,189 @@
+MODULE iniphysiq_mod
+
+CONTAINS
+
+subroutine iniphysiq(ii,jj,nlayer,punjours, pdayref,ptimestep,           &
+                     rlatu,rlatv,rlonu,rlonv,aire,cu,cv,                 &
+                     prad,pg,pr,pcpp,iflag_phys)
+
+use dimphy, only : klev ! number of atmospheric levels
+use mod_grid_phy_lmdz, only : klon_glo ! number of atmospheric columns
+                                       ! (on full grid)
+use mod_phys_lmdz_para, only : klon_omp, & ! number of columns (on local omp grid)
+                               klon_omp_begin, & ! start index of local omp subgrid
+                               klon_omp_end, & ! end index of local omp subgrid
+                               klon_mpi_begin ! start indes of columns (on local mpi grid)
+
+use comgeomphy, only : initcomgeomphy, &
+                       airephy, & ! physics grid area (m2)
+                       cuphy, & ! cu coeff. (u_covariant = cu * u)
+                       cvphy, & ! cv coeff. (v_covariant = cv * v)
+                       rlond, & ! longitudes
+                       rlatd ! latitudes
+use infotrac, only : nqtot ! number of advected tracers
+use comgeomfi_h, only: ini_fillgeom
+use temps_mod, only: day_ini, hour_ini
+use phys_state_var_init_mod, only: phys_state_var_init
+use regular_lonlat_mod, only: init_regular_lonlat, &
+                              east, west, north, south, &
+                              north_east, north_west, &
+                              south_west, south_east
+
+implicit none
+
+include "iniprint.h"
+
+real,intent(in) :: prad ! radius of the planet (m)
+real,intent(in) :: pg ! gravitational acceleration (m/s2)
+real,intent(in) :: pr ! ! reduced gas constant R/mu
+real,intent(in) :: pcpp ! specific heat Cp
+real,intent(in) :: punjours ! length (in s) of a standard day
+!integer,intent(in) :: ngrid ! number of horizontal grid points in the physics (full grid)
+integer,intent(in) :: nlayer ! number of atmospheric layers
+integer,intent(in) :: ii ! number of atmospheric coulumns along longitudes
+integer,intent(in) :: jj  ! number of atompsheric columns along latitudes
+real,intent(in) :: rlatu(jj+1) ! latitudes of the physics grid
+real,intent(in) :: rlatv(jj) ! latitude boundaries of the physics grid
+real,intent(in) :: rlonv(ii+1) ! longitudes of the physics grid
+real,intent(in) :: rlonu(ii+1) ! longitude boundaries of the physics grid
+real,intent(in) :: aire(ii+1,jj+1) ! area of the dynamics grid (m2)
+real,intent(in) :: cu((ii+1)*(jj+1)) ! cu coeff. (u_covariant = cu * u)
+real,intent(in) :: cv((ii+1)*jj) ! cv coeff. (v_covariant = cv * v)
+integer,intent(in) :: pdayref ! reference day of for the simulation
+real,intent(in) :: ptimestep !physics time step (s)
+integer,intent(in) :: iflag_phys ! type of physics to be called
+
+integer :: ibegin,iend,offset
+integer :: i,j
+character(len=20) :: modname='iniphysiq'
+character(len=80) :: abort_message
+real :: total_area_phy, total_area_dyn
+real :: pi
+
+! boundaries, on global grid
+real,allocatable :: boundslon_reg(:,:)
+real,allocatable :: boundslat_reg(:,:)
+
+! global array, on full physics grid:
+real,allocatable :: latfi(:)
+real,allocatable :: lonfi(:)
+real,allocatable :: cufi(:)
+real,allocatable :: cvfi(:)
+real,allocatable :: airefi(:)
+
+pi=2.*asin(1.0)
+
+IF (nlayer.NE.klev) THEN
+  write(*,*) 'STOP in ',trim(modname)
+  write(*,*) 'Problem with dimensions :'
+  write(*,*) 'nlayer     = ',nlayer
+  write(*,*) 'klev   = ',klev
+  abort_message = ''
+  CALL abort_gcm (modname,abort_message,1)
+ENDIF
+
+!IF (ngrid.NE.klon_glo) THEN
+!  write(*,*) 'STOP in ',trim(modname)
+!  write(*,*) 'Problem with dimensions :'
+!  write(*,*) 'ngrid     = ',ngrid
+!  write(*,*) 'klon   = ',klon_glo
+!  abort_message = ''
+!  CALL abort_gcm (modname,abort_message,1)
+!ENDIF
+
+! init regular global longitude-latitude grid points and boundaries
+ALLOCATE(boundslon_reg(ii,2))
+ALLOCATE(boundslat_reg(jj+1,2))
+  
+DO i=1,ii
+   boundslon_reg(i,east)=rlonu(i) 
+   boundslon_reg(i,west)=rlonu(i+1) 
+ENDDO
+
+boundslat_reg(1,north)= PI/2 
+boundslat_reg(1,south)= rlatv(1)
+DO j=2,jj
+   boundslat_reg(j,north)=rlatv(j-1) 
+   boundslat_reg(j,south)=rlatv(j) 
+ENDDO
+boundslat_reg(jj+1,north)= rlatv(jj) 
+boundslat_reg(jj+1,south)= -PI/2
+
+! Write values in module regular_lonlat_mod
+CALL init_regular_lonlat(ii,jj+1, rlonv(1:ii), rlatu, &
+                         boundslon_reg, boundslat_reg)
+
+! Generate global arrays on full physics grid
+allocate(latfi(klon_glo),lonfi(klon_glo),cufi(klon_glo),cvfi(klon_glo))
+latfi(1)=rlatu(1)
+lonfi(1)=0.
+cufi(1) = cu(1)
+cvfi(1) = cv(1)
+DO j=2,jj
+  DO i=1,ii
+    latfi((j-2)*ii+1+i)= rlatu(j)
+    lonfi((j-2)*ii+1+i)= rlonv(i)
+    cufi((j-2)*ii+1+i) = cu((j-1)*(ii+1)+i)
+    cvfi((j-2)*ii+1+i) = cv((j-1)*(ii+1)+i)
+  ENDDO
+ENDDO
+latfi(klon_glo)= rlatu(jj+1)
+lonfi(klon_glo)= 0.
+cufi(klon_glo) = cu((ii+1)*jj+1)
+cvfi(klon_glo) = cv((ii+1)*jj-ii)
+
+! build airefi(), mesh area on physics grid
+allocate(airefi(klon_glo))
+CALL gr_dyn_fi(1,ii+1,jj+1,klon_glo,aire,airefi)
+! Poles are single points on physics grid
+airefi(1)=sum(aire(1:ii,1))
+airefi(klon_glo)=sum(aire(1:ii,jj+1))
+
+! Sanity check: do total planet area match between physics and dynamics?
+total_area_dyn=sum(aire(1:ii,1:jj+1))
+total_area_phy=sum(airefi(1:klon_glo))
+IF (total_area_dyn/=total_area_phy) THEN
+  WRITE (lunout, *) 'iniphysiq: planet total surface discrepancy !!!'
+  WRITE (lunout, *) '     in the dynamics total_area_dyn=', total_area_dyn
+  WRITE (lunout, *) '  but in the physics total_area_phy=', total_area_phy
+  IF (abs(total_area_dyn-total_area_phy)>0.00001*total_area_dyn) THEN
+    ! stop here if the relative difference is more than 0.001%
+    abort_message = 'planet total surface discrepancy'
+    CALL abort_gcm(modname, abort_message, 1)
+  ENDIF
+ENDIF
+
+
+
+!$OMP PARALLEL 
+! Now generate local lon/lat/cu/cv/area arrays
+call initcomgeomphy
+
+!!!!$OMP PARALLEL PRIVATE(ibegin,iend) 
+!!!$OMP+         SHARED(parea,pcu,pcv,plon,plat)
+      
+offset=klon_mpi_begin-1
+airephy(1:klon_omp)=airefi(offset+klon_omp_begin:offset+klon_omp_end)
+cuphy(1:klon_omp)=cufi(offset+klon_omp_begin:offset+klon_omp_end)
+cvphy(1:klon_omp)=cvfi(offset+klon_omp_begin:offset+klon_omp_end)
+rlond(1:klon_omp)=lonfi(offset+klon_omp_begin:offset+klon_omp_end)
+rlatd(1:klon_omp)=latfi(offset+klon_omp_begin:offset+klon_omp_end)
+
+! copy some fundamental parameters to physics 
+! and do some initializations 
+call phys_state_var_init(klon_omp,nlayer,nqtot, &
+                         day_ini,hour_ini,punjours,ptimestep, &
+                         prad,pg,pr,pcpp)
+call ini_fillgeom(klon_omp,rlatd,rlond,airephy)
+call conf_phys(klon_omp,nlayer,nqtot)
+
+! Initialize some "temporal and calendar" related variables
+!CALL init_time(day_ini,hour_ini,punjours,ptimestep)
+
+!$OMP END PARALLEL
+
+
+end subroutine iniphysiq
+
+
+END MODULE iniphysiq_mod
Index: trunk/LMDZ.MARS/libf/dynphy_lonlat/phymars/interp_vert.F
===================================================================
--- trunk/LMDZ.MARS/libf/dynphy_lonlat/phymars/interp_vert.F	(revision 1540)
+++ trunk/LMDZ.MARS/libf/dynphy_lonlat/phymars/interp_vert.F	(revision 1540)
@@ -0,0 +1,70 @@
+c******************************************************
+      SUBROUTINE   interp_vert(varo,varn,lmo,lmn,apso,bpso,
+     &             aps,bps,ps,Nhoriz)
+c
+c interpolation lineaire pour passer
+c a une nouvelle discretisation verticale pour
+c les variables de GCM
+c Francois Forget (01/1995)
+c Modif pour coordonnees hybrides FF (03/2003)
+c**********************************************************
+
+      IMPLICIT NONE
+
+c   Declarations:
+c ==============
+c
+c  ARGUMENTS
+c  """""""""
+
+       integer lmo ! dimensions ancienne couches (input)
+       integer lmn ! dimensions nouvelle couches (input)
+
+       real apso(lmo),bpso(lmo)! anciennes coord hybrides midlayer (input)
+       real aps(lmn), bps(lmn)! nouvelles coord hybrides (midlayer) (input)
+
+       integer Nhoriz ! nombre de point horizontale (input)
+       real ps(nhoriz) !pression de surface (input)
+
+       real varo(Nhoriz,lmo) ! var dans l''ancienne grille (input)
+       real varn(Nhoriz,lmn) ! var dans la nouvelle grille (output)
+
+c Autres variables
+c """"""""""""""""
+       integer n, ln ,lo 
+       real coef
+       REAL sigmo(lmo) ! niveau sigma des variables dans les anciennes coord
+       REAL sigmn(lmn) ! niveau sigma des variables dans les nouvelles coord
+
+c run
+c ====
+
+      do n=1,Nhoriz
+        do ln=1,lmn
+            sigmn(ln)=aps(ln)/ps(n)+bps(ln)
+        end do
+        do lo=1,lmo
+            sigmo(lo)=apso(lo)/ps(n)+bpso(lo)
+        end do
+
+        do ln=1,lmn
+           if (sigmn(ln).ge.sigmo(1))then
+             varn(n,ln) =  varo(n,1)  
+           else if (sigmn(ln).le.sigmo(lmo)) then
+             varn(n,ln) =  varo(n,lmo)
+           else
+              do lo =1,lmo-1 
+                if ( (sigmn(ln).le.sigmo(lo)).and.
+     &             (sigmn(ln).gt.sigmo(lo+1)) )then
+                  coef = (sigmn(ln)-sigmo(lo))/(sigmo(lo+1)-sigmo(lo))
+                   varn(n,ln)=varo(n,lo) +coef*(varo(n,lo+1)-varo(n,lo))
+                end if
+              end do           
+           end if
+         end do
+
+      end do
+
+
+      return
+      end
Index: trunk/LMDZ.MARS/libf/dynphy_lonlat/phymars/lect_start_archive.F
===================================================================
--- trunk/LMDZ.MARS/libf/dynphy_lonlat/phymars/lect_start_archive.F	(revision 1540)
+++ trunk/LMDZ.MARS/libf/dynphy_lonlat/phymars/lect_start_archive.F	(revision 1540)
@@ -0,0 +1,1428 @@
+      SUBROUTINE lect_start_archive(ngrid,nlayer,nqtot,
+     &     date,tsurf,tsoil,emis,q2,
+     &     t,ucov,vcov,ps,co2ice,h,phisold_newgrid,
+     &     q,qsurf,tauscaling,surfith,nid)
+c=======================================================================
+c
+c
+c   Auteur:    05/1997 , 12/2003 : coord hybride  FF
+c   ------
+c
+c
+c   Objet:     Lecture des variables d'un fichier "start_archive"
+c              Plus besoin de régler ancienne valeurs grace
+c              a l'allocation dynamique de memoire (Yann Wanherdrick)
+c
+c
+c
+c=======================================================================
+      use infotrac, only: tname
+      use comsoil_h, only: nsoilmx, layer, mlayer, volcapa, inertiedat
+      use planete_h
+      USE comvert_mod, ONLY: ap,bp,aps,bps,preff
+      USE comconst_mod, ONLY: kappa,g,pi
+      implicit none
+
+#include "dimensions.h"
+#include "paramet.h"
+#include "comgeom2.h"
+#include "netcdf.inc"
+c=======================================================================
+c   Declarations
+c=======================================================================
+
+! routine arguments
+! -----------------
+      integer,intent(in) :: ngrid ! number of atmosphferic columns
+                                  ! on new physics grid
+      integer,intent(in) :: nlayer ! number of atmospheric layers
+                                   ! on new grid
+      integer,intent(in) :: nqtot ! number of advected tracers
+      REAL,INTENT(OUT) :: date
+      REAL,INTENT(OUT) :: vcov(iip1,jjm,llm),ucov(iip1,jjp1,llm) ! vents covariants
+      REAL,INTENT(OUT) :: h(iip1,jjp1,llm),ps(iip1,jjp1)
+      REAL,INTENT(OUT) :: q(iip1,jjp1,llm,nqtot)
+      REAL,INTENT(OUT) :: tsurf(ngrid) ! surface temperature
+      REAL,INTENT(OUT) :: tsoil(ngrid,nsoilmx) ! soil temperature
+      REAL,INTENT(OUT) :: co2ice(ngrid) ! CO2 ice layer
+      REAL,INTENT(OUT) :: emis(ngrid)
+      REAL,INTENT(OUT) :: q2(ngrid,nlayer+1),qsurf(ngrid,nqtot)
+      REAL,INTENT(OUT) :: tauscaling(ngrid) ! dust conversion factor
+      REAL,INTENT(OUT) :: phisold_newgrid(iip1,jjp1)
+      REAL,INTENT(OUT) :: t(iip1,jjp1,llm)
+      real,intent(in) :: surfith(iip1,jjp1) ! surface thermal inertia
+      INTEGER,INTENT(IN) :: nid ! input NetCDF file identifier
+
+
+
+c Old variables dimensions (from file)
+c------------------------------------
+      INTEGER   imold,jmold,lmold,nsoilold,nqold
+
+c Variables pour les lectures des fichiers "ini" 
+c--------------------------------------------------
+!      INTEGER sizei,
+      integer timelen,dimid
+!      INTEGER length
+!      parameter (length = 100)
+      INTEGER tab0
+      INTEGER isoil,iq,iqmax
+      CHARACTER*2   str2
+
+!      REAL dimfirst(4) ! tableau contenant les 1ers elements des dimensions
+
+!      REAL dimlast(4) ! tableau contenant les derniers elements des dimensions
+
+!      REAL dimcycl(4) ! tableau contenant les periodes des dimensions
+!      CHARACTER*120 dimsource
+!      CHARACTER*16 dimname
+!      CHARACTER*80 dimtitle
+!      CHARACTER*40 dimunits
+!      INTEGER   dimtype
+
+!      INTEGER dimord(4)  ! tableau contenant l''ordre
+!      data dimord /1,2,3,4/ ! de sortie des dimensions
+
+!      INTEGER vardim(4)
+      INTEGER   memo
+!      character (len=50) :: tmpname
+
+c Variable histoire 
+c------------------
+      REAL ::qtot(iip1,jjp1,llm)
+
+c autre variables dynamique nouvelle grille
+c------------------------------------------
+
+c!-*-
+!      integer klatdat,klongdat
+!      PARAMETER (klatdat=180,klongdat=360)
+
+c Physique sur grille scalaire 
+c----------------------------
+
+c variable physique
+c------------------
+c     REAL phisfi(ngrid)
+
+      INTEGER i,j,l
+      INTEGER nvarid
+c     REAL year_day,periheli,aphelie,peri_day
+c     REAL obliquit,z0,emin_turb,lmixmin
+c     REAL emissiv,emisice(2),albedice(2),tauvis
+c     REAL iceradius(2) , dtemisice(2)
+
+!      EXTERNAL RAN1
+!      REAL RAN1
+!      EXTERNAL geopot,inigeom
+      integer ierr
+!      integer ismin
+!      external ismin
+!      CHARACTER*80 datapath
+      integer, dimension(4) :: start,count
+
+c Variable nouvelle grille naturelle au point scalaire
+c------------------------------------------------------
+      real us(iip1,jjp1,llm),vs(iip1,jjp1,llm)
+      real tsurfS(iip1,jjp1),tsoilS(iip1,jjp1,nsoilmx)
+      real inertiedatS(iip1,jjp1,nsoilmx)
+      real co2iceS(iip1,jjp1),emisS(iip1,jjp1)
+      REAL q2S(iip1,jjp1,llm+1),qsurfS(iip1,jjp1,nqtot)
+      real tauscalingS(iip1,jjp1)
+
+      real ptotal, co2icetotal
+
+c Var intermediaires : vent naturel, mais pas coord scalaire
+c-----------------------------------------------------------
+      real vnat(iip1,jjm,llm),unat(iip1,jjp1,llm)
+
+
+c Variable de l'ancienne grille 
+c---------------------------------------------------------
+
+      real, dimension(:), allocatable :: timelist
+      real, dimension(:), allocatable :: rlonuold, rlatvold
+      real, dimension(:), allocatable :: rlonvold, rlatuold
+      real, dimension(:), allocatable :: apsold,bpsold
+      real, dimension(:), allocatable :: mlayerold
+      real, dimension(:,:,:), allocatable :: uold,vold,told,q2old
+      real, dimension(:,:,:), allocatable :: tsoilold,qsurfold
+      real, dimension(:,:,:),allocatable :: tsoiloldnew
+! tsoiloldnew: old soil values, but along new subterranean grid
+      real, dimension(:,:,:), allocatable :: inertiedatold
+! inertiedatoldnew: old inertia values, but along new subterranean grid
+      real, dimension(:,:,:), allocatable :: inertiedatoldnew
+      real, dimension(:,:), allocatable :: psold,phisold
+      real, dimension(:,:), allocatable :: co2iceold,tsurfold
+      real, dimension(:,:), allocatable :: emisold
+      real, dimension(:,:,:,:), allocatable :: qold
+      real, dimension(:,:), allocatable :: tauscalingold
+
+      real tab_cntrl(100)
+
+      real ptotalold, co2icetotalold
+
+      logical :: olddepthdef=.false. ! flag
+! olddepthdef=.true. if soil depths are in 'old' (unspecified) format
+      logical :: depthinterpol=.false. ! flag
+! depthinterpol=.true. if interpolation will be requiered
+      logical :: therminertia_3D=.true. ! flag
+! therminertia_3D=.true. if thermal inertia is 3D and read from datafile
+c Variable intermediaires iutilise pour l'extrapolation verticale 
+c----------------------------------------------------------------
+      real, dimension(:,:,:), allocatable :: var,varp1 
+      real, dimension(:), allocatable :: oldgrid, oldval
+      real, dimension(:), allocatable :: newval
+!      real, dimension(:), allocatable :: oldmlayer
+
+!      real surfithfi(ngrid)
+      ! surface thermal inertia at old horizontal grid resolution
+      real, dimension(:,:), allocatable :: surfithold 
+
+! flag which identifies if archive file is using old tracer names (qsurf01,...)
+      logical :: oldtracernames=.false.
+      integer :: counter
+      character(len=30) :: txt ! to store some text
+      real :: tmpval ! to store a temporary variable/value
+
+c=======================================================================
+
+! 0. Preliminary stuff
+
+! check if tracers follow old naming convention (q01, q02, q03, ...)
+      counter=0
+      do iq=1,nqtot
+        txt= " "
+        write(txt,'(a1,i2.2)')'q',iq
+        ierr=NF_INQ_VARID(nid,txt,nvarid)
+        if (ierr.ne.NF_NOERR) then
+          ! did not find old tracer name
+          exit ! might as well stop here
+        else
+          ! found old tracer name
+          counter=counter+1
+        endif
+      enddo
+      if (counter.eq.nqtot) then
+        write(*,*) "lect_start_archive: tracers seem to follow old ",
+     &             "naming convention (q01, q02,...)"
+        oldtracernames=.true.
+      endif
+
+
+!-----------------------------------------------------------------------
+! 1. Read data dimensions (i.e. size and length)
+!-----------------------------------------------------------------------
+
+! 1.2 Read the various dimension lengths of data in file 
+
+      ierr= NF_INQ_DIMID(nid,"Time",dimid)
+      if (ierr.ne.NF_NOERR) then
+         ierr= NF_INQ_DIMID(nid,"temps",dimid)
+      endif
+      ierr= NF_INQ_DIMLEN(nid,dimid,timelen)
+      if (ierr.ne.NF_NOERR) then
+        write(*,*) 'lect_start_archive error: cannot find Time length'
+        stop
+      else
+        write(*,*) "lect_start_archive: timelen=",timelen
+      endif
+
+      ierr= NF_INQ_DIMID(nid,"latitude",dimid)
+      if (ierr.ne.NF_NOERR) then
+         ierr= NF_INQ_DIMID(nid,"rlatu",dimid)
+      endif
+      ierr= NF_INQ_DIMLEN(nid,dimid,jmold)
+      if (ierr.ne.NF_NOERR) then
+        write(*,*) 'lect_start_archive error: cannot find lat length'
+        stop
+      else
+        write(*,*) "lect_start_archive: jmold=",jmold
+      endif
+      jmold=jmold-1
+
+      ierr= NF_INQ_DIMID(nid,"longitude",dimid)
+      if (ierr.ne.NF_NOERR) then
+         ierr= NF_INQ_DIMID(nid,"rlonv",dimid)
+      endif
+      ierr= NF_INQ_DIMLEN(nid,dimid,imold)
+      if (ierr.ne.NF_NOERR) then
+        write(*,*) 'lect_start_archive error: cannot find lon length'
+        stop
+      else
+        write(*,*) "lect_start_archive: imold=",imold
+      endif
+      imold=imold-1
+
+      ierr= NF_INQ_DIMID(nid,"altitude",dimid)
+      if (ierr.ne.NF_NOERR) then
+         ierr= NF_INQ_DIMID(nid,"sig_s",dimid)
+      endif
+      ierr= NF_INQ_DIMLEN(nid,dimid,lmold)
+      if (ierr.ne.NF_NOERR) then
+        write(*,*) 'lect_start_archive error: cannot find alt length'
+        stop
+      else
+        write(*,*) "lect_start_archive: lmold=",lmold
+      endif
+
+      nqold=0
+      do
+         write(str2,'(i2.2)') nqold+1
+         ierr= NF_INQ_VARID(nid,'q'//str2,dimid)
+!        write(*,*) 'q'//str2
+         if (ierr.eq.NF_NOERR) then
+            nqold=nqold+1
+         else
+            exit
+         endif
+      enddo
+
+! 1.2.1 find out the # of subsurface_layers
+      nsoilold=0 !dummy initialisation
+      ierr=NF_INQ_DIMID(nid,"subsurface_layers",dimid)
+      if (ierr.eq.NF_NOERR) then
+        ierr=NF_INQ_DIMLEN(nid,dimid,nsoilold)
+	if (ierr.ne.NF_NOERR) then
+	 write(*,*)'lec_start_archive: ',
+     &              'Failed reading subsurface_layers length'
+	endif
+      else
+        write(*,*)"lec_start_archive: did not find subsurface_layers"
+      endif
+
+      if (nsoilold.eq.0) then ! 'old' archive format;
+      ! must use Tg//str2 fields to compute nsoilold
+      write(*,*)"lec_start_archive: building nsoilold from Tg fields"
+        do
+	 write(str2,'(i2.2)') nsoilold+1
+	 ierr=NF_INQ_VARID(nid,'Tg'//str2,dimid)
+	 if (ierr.eq.NF_NOERR) then
+	  nsoilold=nsoilold+1
+	 else
+	  exit
+	 endif
+	enddo
+      endif
+
+
+      if (nsoilold.ne.nsoilmx) then ! interpolation will be required
+        depthinterpol=.true.
+      endif
+
+! 1.3 Report dimensions
+      
+      write(*,*) "lect_start_archive: Start_archive dimensions:"
+      write(*,*) "longitude: ",imold
+      write(*,*) "latitude: ",jmold
+      write(*,*) "altitude: ",lmold
+      if (nqold.gt.0) then
+        write(*,*) "old tracers q*: ",nqold
+      endif
+      write(*,*) "subsurface_layers: ",nsoilold
+      if (depthinterpol) then
+      write(*,*) " => Warning, nsoilmx= ",nsoilmx
+      write(*,*) '    which implies that you want subterranean interpola
+     &tion.'
+      write(*,*) '  Otherwise, set nsoilmx -in comsoil_h- to: ',nsoilold
+      endif
+      write(*,*) "time lenght: ",timelen
+      write(*,*) 
+
+!-----------------------------------------------------------------------
+! 2. Allocate arrays to store datasets
+!-----------------------------------------------------------------------
+
+      allocate(timelist(timelen))
+      allocate(rlonuold(imold+1), rlatvold(jmold))
+      allocate(rlonvold(imold+1), rlatuold(jmold+1))
+      allocate (apsold(lmold),bpsold(lmold))
+      allocate(uold(imold+1,jmold+1,lmold))
+      allocate(vold(imold+1,jmold+1,lmold))
+      allocate(told(imold+1,jmold+1,lmold))
+      allocate(psold(imold+1,jmold+1))
+      allocate(phisold(imold+1,jmold+1))
+      allocate(qold(imold+1,jmold+1,lmold,nqtot))
+      allocate(co2iceold(imold+1,jmold+1))
+      allocate(tsurfold(imold+1,jmold+1))
+      allocate(emisold(imold+1,jmold+1))
+      allocate(q2old(imold+1,jmold+1,lmold+1))
+!      allocate(tsoilold(imold+1,jmold+1,nsoilmx))
+      allocate(tsoilold(imold+1,jmold+1,nsoilold))
+      allocate(tsoiloldnew(imold+1,jmold+1,nsoilmx))
+      allocate(inertiedatold(imold+1,jmold+1,nsoilold)) ! soil thermal inertia
+      allocate(inertiedatoldnew(imold+1,jmold+1,nsoilmx))
+      ! surface thermal inertia at old horizontal grid resolution
+      allocate(surfithold(imold+1,jmold+1))
+      allocate(mlayerold(nsoilold))
+      allocate(qsurfold(imold+1,jmold+1,nqtot))
+      allocate(tauscalingold(imold+1,jmold+1))
+
+      allocate(var (imold+1,jmold+1,llm))
+      allocate(varp1 (imold+1,jmold+1,llm+1))
+
+      write(*,*) 'q2',ngrid,nlayer+1
+      write(*,*) 'q2S',iip1,jjp1,llm+1
+      write(*,*) 'q2old',imold+1,jmold+1,lmold+1
+
+!-----------------------------------------------------------------------
+! 3. Read time-independent data
+!-----------------------------------------------------------------------
+
+C-----------------------------------------------------------------------
+c 3.1. Lecture du tableau des parametres du run 
+c     (pour  la lecture ulterieure de "ptotalold" et "co2icetotalold")
+c-----------------------------------------------------------------------
+c
+      ierr = NF_INQ_VARID (nid, "controle", nvarid)
+      IF (ierr .NE. NF_NOERR) THEN
+         PRINT*, "Lect_start_archive: <controle> is missing"
+         CALL abort
+      ENDIF
+#ifdef NC_DOUBLE
+      ierr = NF_GET_VAR_DOUBLE(nid, nvarid, tab_cntrl)
+#else
+      ierr = NF_GET_VAR_REAL(nid, nvarid, tab_cntrl)
+#endif
+      IF (ierr .NE. NF_NOERR) THEN
+         PRINT*, "lect_start_archive: Failed loading <controle>"
+         CALL abort
+      ENDIF
+c
+      tab0 = 50
+
+c-----------------------------------------------------------------------
+c 3.2 Lecture des longitudes et latitudes
+c-----------------------------------------------------------------------
+c
+      ierr = NF_INQ_VARID (nid, "rlonv", nvarid)
+      IF (ierr .NE. NF_NOERR) THEN
+         PRINT*, "lect_start_archive: <rlonv> is missing"
+         CALL abort
+      ENDIF
+#ifdef NC_DOUBLE
+      ierr = NF_GET_VAR_DOUBLE(nid, nvarid, rlonvold)
+#else
+      ierr = NF_GET_VAR_REAL(nid, nvarid, rlonvold)
+#endif
+      IF (ierr .NE. NF_NOERR) THEN
+         PRINT*, "lect_start_archive: Failed loading <rlonv>"
+         CALL abort
+      ENDIF
+c
+      ierr = NF_INQ_VARID (nid, "rlatu", nvarid)
+      IF (ierr .NE. NF_NOERR) THEN
+         PRINT*, "lect_start_archive: <rlatu> is missing"
+         CALL abort
+      ENDIF 
+#ifdef NC_DOUBLE
+      ierr = NF_GET_VAR_DOUBLE(nid, nvarid, rlatuold)
+#else
+      ierr = NF_GET_VAR_REAL(nid, nvarid, rlatuold)
+#endif
+      IF (ierr .NE. NF_NOERR) THEN
+         PRINT*, "lect_start_archive: Failed loading <rlatu>"
+         CALL abort
+      ENDIF
+c
+      ierr = NF_INQ_VARID (nid, "rlonu", nvarid)
+      IF (ierr .NE. NF_NOERR) THEN
+         PRINT*, "lect_start_archive: <rlonu> is missing"
+         CALL abort
+      ENDIF
+#ifdef NC_DOUBLE
+      ierr = NF_GET_VAR_DOUBLE(nid, nvarid, rlonuold)
+#else
+      ierr = NF_GET_VAR_REAL(nid, nvarid, rlonuold)
+#endif
+      IF (ierr .NE. NF_NOERR) THEN
+         PRINT*, "lect_start_archive: Failed loading <rlonu>"
+         CALL abort
+      ENDIF
+c
+      ierr = NF_INQ_VARID (nid, "rlatv", nvarid)
+      IF (ierr .NE. NF_NOERR) THEN
+         PRINT*, "lect_start_archive: <rlatv> is missing"
+         CALL abort
+      ENDIF
+#ifdef NC_DOUBLE
+      ierr = NF_GET_VAR_DOUBLE(nid, nvarid, rlatvold)
+#else
+      ierr = NF_GET_VAR_REAL(nid, nvarid, rlatvold)
+#endif
+      IF (ierr .NE. NF_NOERR) THEN
+         PRINT*, "lect_start_archive: Failed loading <rlatv>"
+         CALL abort
+      ENDIF
+c
+
+c-----------------------------------------------------------------------
+c 3.3. Lecture des niveaux verticaux
+c-----------------------------------------------------------------------
+c
+      ierr = NF_INQ_VARID (nid, "aps", nvarid)
+      IF (ierr .NE. NF_NOERR) THEN
+         PRINT*, "lect_start_archive: <aps> is missing"
+         apsold=0
+         PRINT*, "<aps> set to 0"
+      ELSE
+#ifdef NC_DOUBLE
+         ierr = NF_GET_VAR_DOUBLE(nid, nvarid, apsold)
+#else
+         ierr = NF_GET_VAR_REAL(nid, nvarid, apsold)
+#endif
+         IF (ierr .NE. NF_NOERR) THEN
+            PRINT*, "lect_start_archive: Failed loading <aps>"
+         ENDIF
+      ENDIF
+c
+      ierr = NF_INQ_VARID (nid, "bps", nvarid)
+      IF (ierr .NE. NF_NOERR) THEN
+         PRINT*, "lect_start_archive: <bps> is missing"
+         PRINT*, "It must be an old start_archive, lets look for sig_s"
+         ierr = NF_INQ_VARID (nid, "sig_s", nvarid)
+         IF (ierr .NE. NF_NOERR) THEN
+            PRINT*, "Nothing to do..."
+            CALL abort
+         ENDIF
+      ENDIF
+#ifdef NC_DOUBLE
+      ierr = NF_GET_VAR_DOUBLE(nid, nvarid, bpsold)
+#else
+      ierr = NF_GET_VAR_REAL(nid, nvarid, bpsold)
+#endif
+      IF (ierr .NE. NF_NOERR) THEN
+         PRINT*, "lect_start_archive: Failed loading <bps>"
+         CALL abort
+      END IF
+
+c-----------------------------------------------------------------------
+c 3.4 Read Soil layers depths
+c-----------------------------------------------------------------------
+     
+      ierr=NF_INQ_VARID(nid,"soildepth",nvarid)
+      if (ierr.ne.NF_NOERR) then
+       write(*,*)'lect_start_archive: Could not find <soildepth>'
+       write(*,*)' => Assuming this is an archive in old format'
+       olddepthdef=.true.
+       depthinterpol=.true.
+       ! this is how soil depth was defined in ye old days
+	do isoil=1,nsoilold
+	  mlayerold(isoil)=sqrt(887.75/3.14)*((2.**(isoil-0.5))-1.)
+	enddo
+      else
+#ifdef NC_DOUBLE
+        ierr = NF_GET_VAR_DOUBLE(nid,nvarid,mlayerold)
+#else
+        ierr = NF_GET_VAR_REAL(nid,nvarid,mlayerold)
+#endif
+       if (ierr .NE. NF_NOERR) then
+         PRINT*, "lect_start_archive: Failed reading <soildepth>"
+         CALL abort
+       endif
+
+      endif !of if(ierr.ne.NF_NOERR)
+
+      ! Read (or build) mlayer()
+      if (depthinterpol) then
+       ! Build (default) new soil depths (mlayer(:) is in comsoil.h),
+       ! as in soil_settings.F
+       write(*,*)' => Building default soil depths'
+       do isoil=0,nsoilmx-1
+         mlayer(isoil)=2.e-4*(2.**(isoil-0.5))
+       enddo
+       write(*,*)' => mlayer: ',mlayer
+       ! Also build (default) new soil interlayer depth layer(:)
+       do isoil=1,nsoilmx
+         layer(isoil)=sqrt(mlayer(0)*mlayer(1))*
+     &                      ((mlayer(1)/mlayer(0))**(isoil-1))
+       enddo
+       write(*,*)' =>  layer: ',layer
+      else ! read mlayer() from file
+#ifdef NC_DOUBLE
+        ierr = NF_GET_VAR_DOUBLE(nid,nvarid,mlayer)
+#else
+        ierr = NF_GET_VAR_REAL(nid,nvarid,mlayer)
+#endif
+       if (ierr .NE. NF_NOERR) then
+         PRINT*, "lect_start_archive: Failed reading <soildepth>"
+         CALL abort
+       endif
+       ! Also build (default) soil interlayer depth layer(:)
+       do isoil=1,nsoilmx
+         layer(isoil)=sqrt(mlayer(0)*mlayer(1))*
+     &                      ((mlayer(1)/mlayer(0))**(isoil-1))
+       enddo
+      endif ! of if (depthinterpol)
+
+c-----------------------------------------------------------------------
+c 3.5 Read Soil thermal inertia
+c-----------------------------------------------------------------------
+
+      ierr=NF_INQ_VARID(nid,"inertiedat",nvarid)
+      if (ierr.ne.NF_NOERR) then
+       write(*,*)'lect_start_archive: Could not find <inertiedat>'
+       write(*,*)' => Assuming this is an archive in old format'
+       therminertia_3D=.false.
+       write(*,*)' => Thermal inertia will be read from reference file'
+       volcapa=1.e6
+       write(*,*)'    and soil volumetric heat capacity is set to ',
+     &           volcapa
+      else
+#ifdef NC_DOUBLE
+        ierr = NF_GET_VAR_DOUBLE(nid,nvarid,inertiedatold)
+#else
+        ierr = NF_GET_VAR_REAL(nid,nvarid,inertiedatold)
+#endif
+       if (ierr .NE. NF_NOERR) then
+         PRINT*, "lect_start_archive: Failed reading <inertiedat>"
+         CALL abort
+       endif
+      endif
+
+c-----------------------------------------------------------------------
+c 3.6 Lecture geopotentiel au sol
+c-----------------------------------------------------------------------
+c
+      ierr = NF_INQ_VARID (nid, "phisinit", nvarid)
+      IF (ierr .NE. NF_NOERR) THEN
+         PRINT*, "lect_start_archive: <phisinit> is missing"
+         CALL abort
+      ENDIF
+#ifdef NC_DOUBLE
+      ierr = NF_GET_VAR_DOUBLE(nid, nvarid, phisold)
+#else
+      ierr = NF_GET_VAR_REAL(nid, nvarid, phisold)
+#endif
+      IF (ierr .NE. NF_NOERR) THEN
+         PRINT*, "lect_start_archive: Failed loading <phisinit>"
+         CALL abort
+      ENDIF
+
+C-----------------------------------------------------------------------
+c   lecture de "ptotalold" et "co2icetotalold"
+c-----------------------------------------------------------------------
+      ptotalold = tab_cntrl(tab0+49)
+      co2icetotalold = tab_cntrl(tab0+50)
+ 
+c-----------------------------------------------------------------------
+c 4. Lecture du temps et choix
+c-----------------------------------------------------------------------
+ 
+c  lecture du temps
+c
+      ierr = NF_INQ_DIMID (nid, "Time", nvarid)
+      IF (ierr .NE. NF_NOERR) THEN
+         ierr = NF_INQ_DIMID (nid, "temps", nvarid)
+         IF (ierr .NE. NF_NOERR) THEN
+            PRINT*, "lect_start_archive: <Time> is missing"
+            CALL abort
+         endif
+      ENDIF
+
+      ierr = NF_INQ_VARID (nid, "Time", nvarid)
+      IF (ierr .NE. NF_NOERR) THEN
+         ierr = NF_INQ_VARID (nid, "temps", nvarid)
+      endif 
+#ifdef NC_DOUBLE
+      ierr = NF_GET_VAR_DOUBLE(nid, nvarid, timelist)
+#else
+      ierr = NF_GET_VAR_REAL(nid, nvarid, timelist)
+#endif
+      IF (ierr .NE. NF_NOERR) THEN
+         PRINT*, "lect_start_archive: Failed loading <Time>"
+         CALL abort
+      ENDIF
+c
+      write(*,*)
+      write(*,*)
+      write(*,*) 'Dates of the stored initial states:'
+      write(*,*) '~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~'
+      pi=2.*ASIN(1.)
+      do i=1,timelen
+c       call solarlong(timelist(i),sollong(i))
+c       sollong(i) = sollong(i)*180./pi
+c        write(*,*) 'initial state at martian day: ',int(timelist(i))
+        write(*,*) 'initial state at martian day: ',timelist(i)
+c       write(*,6) nint(timelist(i)),nint(mod(timelist(i),669)),
+c    .    sollong(i)
+      end do
+
+   6  FORMAT(i7,i7,f9.3)
+ 
+      write(*,*)
+      write(*,*) 'Choose the martian day to use'
+ 123  read(*,*,iostat=ierr) date
+      if(ierr.ne.0) goto 123
+      memo = 0
+      do i=1,timelen
+c        if (date.eq.int(timelist(i))) then
+        if (abs(date-timelist(i)).lt.0.01) then
+            memo = i
+        endif
+      end do
+ 
+      if (memo.eq.0) then
+        write(*,*)
+        write(*,*)
+        write(*,*) 'Wrong value for day number !!'
+        write(*,*)
+        write(*,*) 'Dates of the stored initial states:'
+        write(*,*) '~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~'
+        do i=1,timelen
+          write(*,*) 'initial state at martian day: ',timelist(i)
+c         write(*,6) nint(timelist(i)),nint(mod(timelist(i),669))
+        end do
+        goto 123
+      endif
+      
+!-----------------------------------------------------------------------
+! 5. Read (time-dependent) data from datafile
+!-----------------------------------------------------------------------
+
+
+c-----------------------------------------------------------------------
+c 5.1 Lecture des champs 2D (co2ice, emis,ps,tsurf,Tg[10], q2surf, tauscaling)
+c-----------------------------------------------------------------------
+ 
+      start=(/1,1,memo,0/)
+      count=(/imold+1,jmold+1,1,0/)
+       
+      ierr = NF_INQ_VARID (nid, "co2ice", nvarid)
+      IF (ierr .NE. NF_NOERR) THEN
+         PRINT*, "lect_start_archive: <co2ice> is missing"
+         CALL abort
+      ENDIF
+#ifdef NC_DOUBLE
+      ierr = NF_GET_VARA_DOUBLE(nid, nvarid,start,count,co2iceold)
+#else
+      ierr = NF_GET_VARA_REAL(nid, nvarid,start,count,co2iceold)
+#endif
+      IF (ierr .NE. NF_NOERR) THEN
+         PRINT*, "lect_start_archive: Failed loading <co2ice>"
+         PRINT*, NF_STRERROR(ierr)
+         CALL abort
+      ENDIF
+c
+      ierr = NF_INQ_VARID (nid, "emis", nvarid)
+      IF (ierr .NE. NF_NOERR) THEN
+         PRINT*, "lect_start_archive: <emis> is missing"
+         CALL abort
+      ENDIF
+#ifdef NC_DOUBLE
+      ierr = NF_GET_VARA_DOUBLE(nid, nvarid,start,count,emisold)
+#else
+      ierr = NF_GET_VARA_REAL(nid, nvarid,start,count,emisold)
+#endif
+      IF (ierr .NE. NF_NOERR) THEN
+         PRINT*, "lect_start_archive: Failed loading <emis>"
+         CALL abort
+      ENDIF
+c
+      ierr = NF_INQ_VARID (nid, "ps", nvarid)
+      IF (ierr .NE. NF_NOERR) THEN
+         PRINT*, "lect_start_archive: <ps> is missing"
+         CALL abort
+      ENDIF
+#ifdef NC_DOUBLE
+      ierr = NF_GET_VARA_DOUBLE(nid, nvarid,start,count,psold)
+#else
+      ierr = NF_GET_VARA_REAL(nid, nvarid,start,count,psold)
+#endif
+      IF (ierr .NE. NF_NOERR) THEN
+         PRINT*, "lect_start_archive: Failed loading <ps>"
+         CALL abort
+      ENDIF
+c
+      ierr = NF_INQ_VARID (nid, "tsurf", nvarid)
+      IF (ierr .NE. NF_NOERR) THEN
+         PRINT*, "lect_start_archive: <tsurf> is missing"
+         CALL abort
+      ENDIF
+#ifdef NC_DOUBLE
+      ierr = NF_GET_VARA_DOUBLE(nid, nvarid,start,count,tsurfold)
+#else
+      ierr = NF_GET_VARA_REAL(nid, nvarid,start,count,tsurfold)
+#endif
+      IF (ierr .NE. NF_NOERR) THEN
+         PRINT*, "lect_start_archive: Failed loading <tsurf>"
+         CALL abort
+      ENDIF
+c
+      ierr = NF_INQ_VARID (nid, "q2surf", nvarid)
+      IF (ierr .NE. NF_NOERR) THEN
+         PRINT*, "lect_start_archive: <q2surf> is missing"
+         CALL abort
+      ENDIF
+#ifdef NC_DOUBLE
+      ierr = NF_GET_VARA_DOUBLE(nid, nvarid,start,count,q2old)
+#else
+      ierr = NF_GET_VARA_REAL(nid, nvarid,start,count,q2old)
+#endif
+      IF (ierr .NE. NF_NOERR) THEN
+         PRINT*, "lect_start_archive: Failed loading <q2surf>"
+         CALL abort
+      ENDIF
+c
+      ierr = NF_INQ_VARID (nid, "tauscaling", nvarid)
+      IF (ierr .NE. NF_NOERR) THEN
+         PRINT*, "lect_start_archive: <tauscaling> not in file"
+         tauscalingold(:,:) = -1
+      ELSE
+#ifdef NC_DOUBLE
+        ierr = NF_GET_VARA_DOUBLE(nid, nvarid,start,count,tauscalingold)
+#else
+        ierr = NF_GET_VARA_REAL(nid, nvarid,start,count,tauscalingold)
+#endif
+        IF (ierr .NE. NF_NOERR) THEN
+           PRINT*, "lect_start_archive: Failed loading <tauscaling>"
+           PRINT*, NF_STRERROR(ierr)
+           CALL abort
+        ENDIF
+      ENDIF
+c
+      write(*,*)"lect_start_archive: rlonuold:"
+     &           ,rlonuold," rlatvold:",rlatvold
+      write(*,*)
+c
+
+c tracers: the 2 last ones are kept the 2 last one. 
+c the others keep their rank. ! No longer true.
+c -------------------------------------------
+! Surface tracers:      
+      qsurfold(1:imold+1,1:jmold+1,1:nqtot)=0
+
+      DO iq=1,nqtot
+        IF (oldtracernames) THEN
+          txt=" "
+          write(txt,'(a5,i2.2)')'qsurf',iq
+        ELSE
+          txt=trim(tname(iq))//"_surf"
+          if (txt.eq."h2o_vap") then
+            ! There is no surface tracer for h2o_vap;
+            ! "h2o_ice" should be loaded instead
+            txt="h2o_ice_surf"
+            write(*,*) 'lect_start_archive: loading surface tracer',
+     &                     ' h2o_ice instead of h2o_vap'
+          endif
+        ENDIF ! of IF (oldtracernames)
+        write(*,*) "lect_start_archive: loading tracer ",trim(txt)
+        ierr = NF_INQ_VARID (nid,txt,nvarid)
+        IF (ierr .NE. NF_NOERR) THEN
+          PRINT*, "lect_start_archive: ",
+     &              " Tracer <",trim(txt),"> not found"
+          print*, "which (constant) value should it be initialized to?"
+          read(*,*) tmpval
+          qsurfold(1:imold+1,1:jmold+1,iq)=tmpval
+        ELSE ! tracer exists in file, load it
+#ifdef NC_DOUBLE
+          ierr = NF_GET_VARA_DOUBLE(nid, nvarid,start,count,
+     &          qsurfold(1,1,iq))
+#else
+          ierr = NF_GET_VARA_REAL(nid, nvarid,start,count,
+     &          qsurfold(1,1,iq))
+#endif
+          IF (ierr .NE. NF_NOERR) THEN
+            PRINT*, "lect_start_archive: ",
+     &             " Failed loading <",trim(txt),">"
+            stop
+          ENDIF
+        ENDIF
+
+      ENDDO ! of DO iq=1,nqtot
+
+!-----------------------------------------------------------------------
+! 5.2 Read 3D subterranean fields
+!-----------------------------------------------------------------------
+
+      start=(/1,1,1,memo/)
+      count=(/imold+1,jmold+1,nsoilold,1/)
+!
+! Read soil temperatures
+!
+      if (olddepthdef) then ! tsoil stored using the 'old format'
+         start=(/1,1,memo,0/)
+         count=(/imold+1,jmold+1,1,0/) ! because the "Tg" are 2D datasets
+       do isoil=1,nsoilold
+!        write(*,*)'isoil',isoil
+         write(str2,'(i2.2)') isoil
+c
+         ierr = NF_INQ_VARID (nid, "Tg"//str2, nvarid)
+         IF (ierr .NE. NF_NOERR) THEN
+            PRINT*, "lect_start_archive: ",
+     &              "Field <","Tg"//str2,"> not found"
+            CALL abort
+         ENDIF
+#ifdef NC_DOUBLE
+         ierr = NF_GET_VARA_DOUBLE(nid, nvarid,start,count,
+     &          tsoilold(1,1,isoil))
+#else
+         ierr = NF_GET_VARA_REAL(nid, nvarid,start,count,
+     &          tsoilold(1,1,isoil))
+#endif
+         IF (ierr .NE. NF_NOERR) THEN
+            PRINT*, "lect_start_archive: ",
+     &            "Failed reading <","Tg"//str2,">"
+            CALL abort
+         ENDIF
+c
+       enddo ! of do isoil=1,nsoilold
+      
+      ! reset 'start' and 'count' to "3D" behaviour
+      start=(/1,1,1,memo/)
+      count=(/imold+1,jmold+1,nsoilold,1/)
+      
+      else
+       write(*,*) "lect_start_archive: loading tsoil "
+       ierr=NF_INQ_VARID(nid,"tsoil",nvarid)
+       if (ierr.ne.NF_NOERR) then
+        write(*,*)"lect_start_archive: Cannot find <tsoil>"
+	call abort
+       else
+#ifdef NC_DOUBLE
+      ierr=NF_GET_VARA_DOUBLE(nid,nvarid,start,count,tsoilold)
+#else
+      ierr=NF_GET_VARA_REAL(nid,nvarid,start,count,tsoilold)
+#endif
+       endif ! of if (ierr.ne.NF_NOERR)
+       
+      endif ! of if (olddepthdef)
+
+!
+! Read soil thermal inertias
+!
+!      if (.not.olddepthdef) then ! no thermal inertia data in "old" archives
+!       ierr=NF_INQ_VARID(nid,"inertiedat",nvarid)
+!       if (ierr.ne.NF_NOERR) then
+!        write(*,*)"lect_start_archive: Cannot find <inertiedat>"
+!	call abort
+!       else
+!#ifdef NC_DOUBLE
+!      ierr=NF_GET_VARA_DOUBLE(nid,nvarid,start,count,inertiedatold)
+!#else
+!      ierr=NF_GET_VARA_REAL(nid,nvarid,start,count,inertiedatold)
+!#endif
+!       endif ! of if (ierr.ne.NF_NOERR)
+!      endif
+
+c-----------------------------------------------------------------------
+c 5.3	Lecture des champs 3D (t,u,v, q2atm,q)
+c-----------------------------------------------------------------------
+
+      start=(/1,1,1,memo/)
+      count=(/imold+1,jmold+1,lmold,1/)
+
+c
+      ierr = NF_INQ_VARID (nid,"temp", nvarid)
+      IF (ierr .NE. NF_NOERR) THEN
+         PRINT*, "lect_start_archive: <temp> is missing"
+         CALL abort
+      ENDIF
+#ifdef NC_DOUBLE
+      ierr = NF_GET_VARA_DOUBLE(nid, nvarid, start, count, told)
+#else
+      ierr = NF_GET_VARA_REAL(nid, nvarid, start, count, told)
+#endif
+      IF (ierr .NE. NF_NOERR) THEN
+         PRINT*, "lect_start_archive: Failed loading <temp>"
+         CALL abort
+      ENDIF
+c
+      ierr = NF_INQ_VARID (nid,"u", nvarid)
+      IF (ierr .NE. NF_NOERR) THEN
+         PRINT*, "lect_start_archive: <u> is missing"
+         CALL abort
+      ENDIF
+#ifdef NC_DOUBLE
+      ierr = NF_GET_VARA_DOUBLE(nid, nvarid,start,count,uold)
+#else
+      ierr = NF_GET_VARA_REAL(nid, nvarid,start,count,uold)
+#endif
+      IF (ierr .NE. NF_NOERR) THEN
+         PRINT*, "lect_start_archive: Failed loading <u>"
+         CALL abort
+      ENDIF
+c
+      ierr = NF_INQ_VARID (nid,"v", nvarid)
+      IF (ierr .NE. NF_NOERR) THEN
+         PRINT*, "lect_start_archive: <v> is missing"
+         CALL abort
+      ENDIF
+#ifdef NC_DOUBLE
+      ierr = NF_GET_VARA_DOUBLE(nid, nvarid,start,count,vold)
+#else
+      ierr = NF_GET_VARA_REAL(nid, nvarid,start,count,vold)
+#endif
+      IF (ierr .NE. NF_NOERR) THEN
+         PRINT*, "lect_start_archive: Failed loading <v>"
+         CALL abort
+      ENDIF
+c
+      ierr = NF_INQ_VARID (nid,"q2atm", nvarid)
+      IF (ierr .NE. NF_NOERR) THEN
+         PRINT*, "lect_start_archive: <q2atm> is missing"
+         CALL abort
+      ENDIF
+#ifdef NC_DOUBLE
+      ierr = NF_GET_VARA_DOUBLE(nid, nvarid,start,count,q2old(1,1,2))
+#else
+      ierr = NF_GET_VARA_REAL(nid, nvarid,start,count,q2old(1,1,2))
+#endif
+      IF (ierr .NE. NF_NOERR) THEN
+         PRINT*, "lect_start_archive: Failed loading <q2atm>"
+         CALL abort
+      ENDIF
+c
+
+c tracers: the 2 last ones are kept the 2 last one. 
+c the others keep their rank. ! No longer true.
+c -------------------------------------------
+! Tracers:
+      qold(1:imold+1,1:jmold+1,1:lmold,1:nqtot)=0
+
+      DO iq=1,nqtot
+        IF (oldtracernames) THEN
+          txt=" "
+          write(txt,'(a1,i2.2)')'q',iq
+        ELSE
+          txt=tname(iq)
+        ENDIF
+        write(*,*)"lect_start_archive: loading tracer ",trim(txt)
+        ierr = NF_INQ_VARID (nid,txt,nvarid)
+        IF (ierr .NE. NF_NOERR) THEN
+            PRINT*, "lect_start_archive: ",
+     &              " Tracer <",trim(txt),"> not found"
+          print*, "which (constant) value should it be initialized to?"
+          read(*,*) tmpval
+          qold(1:imold+1,1:jmold+1,1:lmold,iq)=tmpval
+        ELSE ! tracer exists in file, load it
+#ifdef NC_DOUBLE
+         ierr=NF_GET_VARA_DOUBLE(nid,nvarid,start,count,qold(1,1,1,iq))
+#else
+         ierr=NF_GET_VARA_REAL(nid,nvarid,start,count,qold(1,1,1,iq))
+#endif
+          IF (ierr .NE. NF_NOERR) THEN
+            PRINT*, "lect_start_archive: ",
+     &             "  Failed loading <",trim(txt),">"
+            stop
+          ENDIF
+        ENDIF
+
+      ENDDO ! of DO iq=1,nqtot
+
+
+c Chemin pour trouver les donnees de surface (albedo, relief, th.inertia...)
+c -------------------------------------------------------------------------
+
+!      datapath = '/users/forget/gcm/data_mars_gcm'
+
+
+!=======================================================================
+! 6. Interpolation from old grid to new grid
+!=======================================================================
+
+c=======================================================================
+c   INTERPOLATION DANS LA NOUVELLE GRILLE et initialisation des variables
+c=======================================================================
+c  Interpolation horizontale puis passage dans la grille physique pour 
+c  les variables physique 
+c  Interpolation verticale puis horizontale pour chaque variable 3D
+c=======================================================================
+
+c-----------------------------------------------------------------------
+c 6.1	Variable 2d :
+c-----------------------------------------------------------------------
+c Relief 
+      call interp_horiz (phisold,phisold_newgrid,imold,jmold,iim,jjm,1,
+     &                   rlonuold,rlatvold,rlonu,rlatv)
+
+c Glace CO2
+      call interp_horiz (co2iceold,co2ices,imold,jmold,iim,jjm,1,
+     &                   rlonuold,rlatvold,rlonu,rlatv)
+
+c Temperature de surface
+      call interp_horiz (tsurfold,tsurfs,imold,jmold,iim,jjm,1,
+     &                   rlonuold,rlatvold,rlonu,rlatv)
+      call gr_dyn_fi (1,iim+1,jjm+1,ngrid,tsurfs,tsurf)
+c     write(44,*) 'tsurf', tsurf
+
+c Temperature du sous-sol
+!      call interp_horiz(tsoilold,tsoils,
+!     &                  imold,jmold,iim,jjm,nsoilmx,
+!     &                   rlonuold,rlatvold,rlonu,rlatv)
+!      call gr_dyn_fi (nsoilmx,iim+1,jjm+1,ngrid,tsoils,tsoil)
+c     write(45,*) 'tsoil',tsoil
+
+c Emissivite de la surface
+      call interp_horiz (emisold,emiss,imold,jmold,iim,jjm,1,
+     &                   rlonuold,rlatvold,rlonu,rlatv)
+      call gr_dyn_fi (1,iim+1,jjm+1,ngrid,emiss,emis)
+
+c Dust conversion factor
+      call interp_horiz (tauscalingold,tauscalings,imold,jmold,iim,jjm,
+     &                   1,rlonuold,rlatvold,rlonu,rlatv)
+      call gr_dyn_fi (1,iim+1,jjm+1,ngrid,tauscalings,tauscaling)
+c     write(46,*) 'emis',emis
+c-----------------------------------------------------------------------
+c 6.1.2	Traitement special de la pression au sol :
+c-----------------------------------------------------------------------
+
+c  Extrapolation la pression dans la nouvelle grille
+      call interp_horiz(psold,ps,imold,jmold,iim,jjm,1,
+     &                   rlonuold,rlatvold,rlonu,rlatv)
+
+c-----------------------------------------------------------------------
+c	On assure la conservation de la masse de l'atmosphere + calottes
+c-----------------------------------------------------------------------
+
+      ptotal =  0.
+      co2icetotal = 0.
+      DO j=1,jjp1
+         DO i=1,iim
+            ptotal=ptotal+ps(i,j)*aire(i,j)/g
+            co2icetotal = co2icetotal + co2iceS(i,j)*aire(i,j)
+         END DO
+      END DO
+
+      write(*,*)
+      write(*,*)'Old grid: mass of the atmosphere :',ptotalold
+      write(*,*)'New grid: mass of the atmosphere :',ptotal
+      write (*,*) 'Ratio new atm / old atm =', ptotal/ptotalold 
+      write(*,*)
+      write(*,*)'Old grid: mass of CO2 ice:',co2icetotalold
+      write(*,*)'New grid: mass of CO2 ice:',co2icetotal
+      if (co2icetotalold.ne.0.) then
+       write(*,*)'Ratio new ice / old ice =',co2icetotal/co2icetotalold
+      endif
+      write(*,*)
+
+
+      DO j=1,jjp1
+         DO i=1,iip1
+            ps(i,j)=ps(i,j) * ptotalold/ptotal
+         END DO
+      END DO
+
+      if ( co2icetotalold.gt.0.) then 
+         DO j=1,jjp1
+            DO i=1,iip1
+               co2iceS(i,j)=co2iceS(i,j) * co2icetotalold/co2icetotal
+            END DO
+         END DO
+      end if
+
+c-----------------------------------------------------------------------
+c 6.2 Subterranean 3d variables:
+c-----------------------------------------------------------------------
+
+c-----------------------------------------------------------------------
+c 6.2.1 Thermal Inertia
+c       Note: recall that inertiedat is a common in "comsoil.h"
+c-----------------------------------------------------------------------
+
+      ! depth-wise interpolation, if required
+      if (depthinterpol.and.(.not.olddepthdef)) then
+        allocate(oldval(nsoilold))
+	allocate(newval(nsoilmx))
+        write(*,*)'lect_start_archive: WARNING: vertical interpolation o
+     &f soil thermal inertia; might be wiser to reset it.'
+        write(*,*)
+       
+        do i=1,imold+1
+         do j=1,jmold+1
+	   !copy old values
+	   oldval(1:nsoilold)=inertiedatold(i,j,1:nsoilold)
+	   !interpolate
+	   call interp_line(mlayerold,oldval,nsoilold,
+     &                     mlayer,newval,nsoilmx)
+           !copy interpolated values
+           inertiedatoldnew(i,j,1:nsoilmx)=newval(1:nsoilmx)
+	 enddo
+        enddo
+        ! cleanup
+	deallocate(oldval)
+	deallocate(newval)
+      endif !of if (depthinterpol)
+
+      if (therminertia_3D) then
+        ! We have inertiedatold
+       if((imold.ne.iim).or.(jmold.ne.jjm)) then
+       write(*,*)'lect_start_archive: WARNING: horizontal interpolation 
+     &of thermal inertia; might be better to reset it.'
+       write(*,*)
+       endif
+       
+        ! Do horizontal interpolation
+	if (depthinterpol) then
+	  call interp_horiz(inertiedatoldnew,inertiedatS,
+     &                  imold,jmold,iim,jjm,nsoilmx,
+     &                   rlonuold,rlatvold,rlonu,rlatv)
+	else
+          call interp_horiz(inertiedatold,inertiedatS,
+     &                  imold,jmold,iim,jjm,nsoilold,
+     &                   rlonuold,rlatvold,rlonu,rlatv)
+        endif ! of if (depthinterpol)
+
+      else ! no 3D thermal inertia data
+       write(*,*)'lect_start_archive: using reference surface inertia'
+        ! Use surface inertia (and extend it to all depths)
+        do i=1,nsoilmx
+         inertiedatS(1:iip1,1:jjp1,i)=surfith(1:iip1,1:jjp1)
+        enddo
+	! Build an old resolution surface thermal inertia
+	! (will be needed for tsoil interpolation)
+	call interp_horiz(surfith,surfithold,
+     &                    iim,jjm,imold,jmold,1,
+     &                    rlonu,rlatv,rlonuold,rlatvold)
+      endif
+
+
+      ! Reshape inertiedatS to scalar grid as inertiedat
+      call gr_dyn_fi (nsoilmx,iim+1,jjm+1,ngrid,
+     &                  inertiedatS,inertiedat)
+      
+c-----------------------------------------------------------------------
+c 6.2.2 Soil temperature
+c-----------------------------------------------------------------------
+!      write(*,*) 'Soil'
+      ! Recast temperatures along soil depth, if necessary
+      if (olddepthdef) then
+        allocate(oldgrid(nsoilold+1))
+        allocate(oldval(nsoilold+1))
+	allocate(newval(nsoilmx))
+        do i=1,imold+1
+	 do j=1,jmold+1
+	   ! copy values
+	   oldval(1)=tsurfold(i,j)
+	   oldval(2:nsoilold+1)=tsoilold(i,j,1:nsoilold)
+	   ! build vertical coordinate
+	   oldgrid(1)=0. ! ground
+	   oldgrid(2:nsoilold+1)=mlayerold(1:nsoilold)*
+     &                (surfithold(i,j)/1.e6)
+          ! Note; at this stage, we impose volcapa=1.e6 above
+	  ! since volcapa isn't set in old soil definitions
+
+	  ! interpolate
+	  call interp_line(oldgrid,oldval,nsoilold+1,
+     &                     mlayer,newval,nsoilmx)
+	 ! copy result in tsoilold
+	 tsoiloldnew(i,j,1:nsoilmx)=newval(1:nsoilmx)
+	 enddo
+	enddo
+        ! cleanup
+	deallocate(oldgrid)
+	deallocate(oldval)
+	deallocate(newval)
+
+      else
+       if (depthinterpol) then ! if vertical interpolation is required
+        allocate(oldgrid(nsoilold+1))
+        allocate(oldval(nsoilold+1))
+	allocate(newval(nsoilmx))
+        ! build vertical coordinate
+	oldgrid(1)=0. ! ground
+	oldgrid(2:nsoilold+1)=mlayerold(1:nsoilold)
+        do i=1,imold+1
+	 do j=1,jmold+1
+	   ! copy values
+	   oldval(1)=tsurfold(i,j)
+	   oldval(2:nsoilold+1)=tsoilold(i,j,1:nsoilold)
+	  ! interpolate
+	  call interp_line(oldgrid,oldval,nsoilold+1,
+     &                     mlayer,newval,nsoilmx)
+	 ! copy result in tsoilold
+	 tsoiloldnew(i,j,1:nsoilmx)=newval(1:nsoilmx)
+	 enddo
+	enddo
+!	write(*,*)'tsoiloldnew(1,1,1):',tsoiloldnew(1,1,1)
+        ! cleanup
+	deallocate(oldgrid)
+	deallocate(oldval)
+	deallocate(newval)
+       
+       else
+        tsoiloldnew(:,:,:)=tsoilold(:,:,:)
+       endif ! of if (depthinterpol)
+      endif ! of if (olddepthdef)
+
+      ! Do the horizontal interpolation
+       call interp_horiz(tsoiloldnew,tsoilS,
+     &                  imold,jmold,iim,jjm,nsoilmx,
+     &                   rlonuold,rlatvold,rlonu,rlatv)
+
+      ! Reshape tsoilS to scalar grid as tsoil
+       call gr_dyn_fi (nsoilmx,iim+1,jjm+1,ngrid,tsoilS,tsoil)
+
+
+
+c-----------------------------------------------------------------------
+c 6.3 Variable 3d :
+c-----------------------------------------------------------------------
+      
+c temperatures atmospheriques
+      write (*,*) 'lect_start_archive: told ', told (1,jmold+1,1)  ! INFO
+      call interp_vert
+     &    (told,var,lmold,llm,apsold,bpsold,aps,bps,
+     &     psold,(imold+1)*(jmold+1))
+      write (*,*) 'lect_start_archive: var ', var (1,jmold+1,1)  ! INFO
+      call interp_horiz(var,t,imold,jmold,iim,jjm,llm,
+     &                   rlonuold,rlatvold,rlonu,rlatv)
+      write (*,*) 'lect_start_archive: t ', t(1,jjp1,1)  ! INFO
+
+c q2 : pbl wind variance
+      write (*,*) 'lect_start_archive: q2old ', q2old (1,2,1)  ! INFO
+      call interp_vert (q2old,varp1,lmold+1,llm+1,
+     &     apsold,bpsold,ap,bp,psold,(imold+1)*(jmold+1))
+      write (*,*) 'lect_start_archive: varp1 ', varp1 (1,2,1)  ! INFO
+      call interp_horiz(varp1,q2s,imold,jmold,iim,jjm,llm+1,
+     &                   rlonuold,rlatvold,rlonu,rlatv)
+      write (*,*) 'lect_start_archive: q2s ', q2s (1,2,1)  ! INFO
+      call gr_dyn_fi (llm+1,iim+1,jjm+1,ngrid,q2s,q2)
+      write (*,*) 'lect_start_archive: q2 ', q2 (1,2)  ! INFO
+c     write(47,*) 'q2',q2
+
+c calcul des champ de vent; passage en vent covariant
+      write (*,*) 'lect_start_archive: uold ', uold (1,2,1)  ! INFO
+      call interp_vert
+     & (uold,var,lmold,llm,apsold,bpsold,aps,bps,
+     &  psold,(imold+1)*(jmold+1))
+      write (*,*) 'lect_start_archive: var ', var (1,2,1)  ! INFO
+      call interp_horiz(var,us,imold,jmold,iim,jjm,llm,
+     &                   rlonuold,rlatvold,rlonu,rlatv)
+      write (*,*) 'lect_start_archive: us ', us (1,2,1)   ! INFO
+
+      call interp_vert
+     & (vold,var,lmold,llm,
+     &  apsold,bpsold,aps,bps,psold,(imold+1)*(jmold+1))
+      call interp_horiz(var,vs,imold,jmold,iim,jjm,llm,
+     &                   rlonuold,rlatvold,rlonu,rlatv)
+      call scal_wind(us,vs,unat,vnat)
+      write (*,*) 'lect_start_archive: unat ', unat (1,1,1)    ! INFO
+      do l=1,llm
+        do j = 1, jjp1
+          do i=1,iip1
+            ucov( i,j,l ) = unat( i,j,l ) * cu(i,j)
+c           ucov( i,j,l ) = 0
+          end do
+        end do
+      end do 
+      write (*,*) 'lect_start_archive: ucov ', ucov (1,1,1)  ! INFO
+c     write(48,*) 'ucov',ucov
+      do l=1,llm
+        do j = 1, jjm
+          do i=1,iim
+            vcov( i,j,l ) = vnat( i,j,l ) * cv(i,j)
+c           vcov( i,j,l ) = 0
+          end do
+          vcov( iip1,j,l ) = vcov( 1,j,l )
+        end do
+      end do
+c     write(49,*) 'ucov',vcov
+
+c traceurs surface
+      do iq = 1, nqtot
+            call interp_horiz(qsurfold(1,1,iq) ,qsurfs(1,1,iq),
+     &                  imold,jmold,iim,jjm,1,
+     &                  rlonuold,rlatvold,rlonu,rlatv)
+      enddo
+
+      call gr_dyn_fi (nqtot,iim+1,jjm+1,ngrid,qsurfs,qsurf)
+
+c traceurs 3D
+      do  iq = 1, nqtot
+            call interp_vert(qold(1,1,1,iq),var,lmold,llm,
+     &        apsold,bpsold,aps,bps,psold,(imold+1)*(jmold+1))
+            call interp_horiz(var,q(1,1,1,iq),imold,jmold,iim,jjm,llm,
+     &                  rlonuold,rlatvold,rlonu,rlatv)
+      enddo
+cccccccccccccccccccccccccccccc      
+c  make sure that sum of q = 1      
+c dominent species is = 1 - sum(all other species)      
+cccccccccccccccccccccccccccccc      
+c      iqmax=1
+c      
+c      if (nqold.gt.10) then
+c       do l=1,llm
+c        do j=1,jjp1
+c          do i=1,iip1
+c           do iq=1,nqold
+c            if (q(i,j,l,iq).gt.q(i,j,l,iqmax)) then
+c              iqmax=iq
+c            endif
+c           enddo
+c           q(i,j,l,iqmax)=1.
+c           qtot(i,j,l)=0
+c           do iq=1,nqold
+c            if (iq.ne.iqmax) then        
+c              q(i,j,l,iqmax)=q(i,j,l,iqmax)-q(i,j,l,iq)        
+c            endif
+c           enddo !iq
+c           do iq=1,nqold
+c            qtot(i,j,l)=qtot(i,j,l)+q(i,j,l,iq)
+c            if (i.eq.1.and.j.eq.1.and.l.Eq.1) write(*,*)' qtot(i,j,l)',
+c     $    qtot(i,j,l)
+c           enddo !iq
+c          enddo !i   
+c         enddo !j   
+c       enddo !l  
+c      endif
+ccccccccccccccccccccccccccccccc
+
+c     Periodicite :
+      do  iq = 1, nqtot
+         do l=1, llm
+            do j = 1, jjp1
+               q(iip1,j,l,iq) = q(1,j,l,iq)
+            end do
+         end do
+      enddo
+      
+      call gr_dyn_fi (1,iim+1,jjm+1,ngrid,co2ices,co2ice)
+
+c-----------------------------------------------------------------------
+c   Initialisation  h:	(passage de t -> h)
+c-----------------------------------------------------------------------
+
+      DO l=1,llm
+         DO j=1,jjp1
+            DO i=1,iim
+               h(i,j,l) = t(i,j,l)*((ps(i,j)/preff)**kappa)
+            END DO
+            h(iip1,j,l) =  h(1,j,l)
+         END DO
+      END DO
+
+
+c***********************************************************************
+c***********************************************************************
+c     Fin subroutine lecture ini
+c***********************************************************************
+c***********************************************************************
+
+      deallocate(timelist)
+      deallocate(rlonuold, rlatvold)
+      deallocate(rlonvold, rlatuold)
+      deallocate(apsold,bpsold)
+      deallocate(uold)
+      deallocate(vold)
+      deallocate(told)
+      deallocate(psold)
+      deallocate(phisold)
+      deallocate(qold)
+      deallocate(co2iceold)
+      deallocate(tsurfold)
+      deallocate(emisold)
+      deallocate(q2old)
+      deallocate(tsoilold)
+      deallocate(tsoiloldnew)
+      deallocate(inertiedatold)
+      deallocate(inertiedatoldnew)
+      deallocate(surfithold)
+      deallocate(mlayerold)
+      deallocate(qsurfold)
+      deallocate(tauscalingold)
+      deallocate(var,varp1)
+
+!      write(*,*)'lect_start_archive: END'
+      return
+      end
Index: trunk/LMDZ.MARS/libf/dynphy_lonlat/phymars/newstart.F
===================================================================
--- trunk/LMDZ.MARS/libf/dynphy_lonlat/phymars/newstart.F	(revision 1540)
+++ trunk/LMDZ.MARS/libf/dynphy_lonlat/phymars/newstart.F	(revision 1540)
@@ -0,0 +1,1784 @@
+C======================================================================
+      PROGRAM newstart
+c=======================================================================
+c
+c
+c   Auteur:   Christophe Hourdin/Francois Forget/Yann Wanherdrick
+c   ------
+c             Derniere modif : 12/03
+c
+c
+c   Objet:  Create or modify the initial state for the LMD Mars GCM
+c   -----           (fichiers NetCDF start et startfi)
+c
+c
+c=======================================================================
+
+      use ioipsl_getincom, only: getin 
+      use infotrac, only: infotrac_init, nqtot, tname
+      use tracer_mod, only: noms, mmol,
+     &                      igcm_dust_number, igcm_dust_mass,
+     &                      igcm_ccn_number, igcm_ccn_mass,
+     &                      igcm_h2o_vap, igcm_h2o_ice, igcm_co2,
+     &                      igcm_n2, igcm_ar, igcm_o2, igcm_co
+      use surfdat_h, only: phisfi, z0, zmea, zstd, zsig, zgam, zthe,
+     &                     albedodat, z0_default, qsurf, tsurf,
+     &                     co2ice, emis
+      use comsoil_h, only: inertiedat, layer, mlayer, nsoilmx, tsoil
+      use control_mod, only: day_step, iphysiq, anneeref, planet_type
+      use phyredem, only: physdem0, physdem1
+      use iostart, only: open_startphy
+      use comgeomphy, only: initcomgeomphy
+!      use planete_h
+      use dimradmars_mod, only: tauscaling
+      use turb_mod, only: q2
+      use comgeomfi_h, only: ini_fillgeom
+      use filtreg_mod, only: inifilr
+      USE comvert_mod, ONLY: ap,bp,pa,preff
+      USE comconst_mod, ONLY: lllm,daysec,dtphys,dtvr,
+     .			cpp,kappa,rad,omeg,g,r,pi
+      USE serre_mod, ONLY: alphax
+      USE temps_mod, ONLY: day_ini,hour_ini
+      USE ener_mod, ONLY: etot0,ptot0,ztot0,stot0,ang0
+      USE phys_state_var_init_mod, ONLY: phys_state_var_init
+
+      implicit none
+
+#include "dimensions.h"
+      integer, parameter :: ngridmx = (2+(jjm-1)*iim - 1/jjm) 
+#include "paramet.h"
+#include "comgeom2.h"
+#include "comdissnew.h"
+#include "clesph0.h"
+#include "netcdf.inc"
+#include "datafile.h"
+c=======================================================================
+c   Declarations
+c=======================================================================
+
+c Variables dimension du fichier "start_archive"
+c------------------------------------
+      CHARACTER	relief*3
+
+c et autres:
+c----------
+
+c Variables pour les lectures NetCDF des fichiers "start_archive" 
+c--------------------------------------------------
+      INTEGER nid_dyn, nid_fi,nid,nvarid
+      INTEGER tab0
+
+      REAL  date
+      REAL p_rad,p_omeg,p_g,p_mugaz,p_daysec
+
+c Variable histoire 
+c------------------
+      REAL vcov(iip1,jjm,llm),ucov(iip1,jjp1,llm) ! vents covariants
+      REAL phis(iip1,jjp1)
+      REAL,ALLOCATABLE :: q(:,:,:,:)               ! champs advectes
+
+c autre variables dynamique nouvelle grille
+c------------------------------------------
+      REAL pks(iip1,jjp1)
+      REAL w(iip1,jjp1,llm+1)
+      REAL pbaru(ip1jmp1,llm),pbarv(ip1jm,llm)
+!      REAL dv(ip1jm,llm),du(ip1jmp1,llm)
+!      REAL dh(ip1jmp1,llm),dp(ip1jmp1)
+      REAL phi(iip1,jjp1,llm)
+
+      integer klatdat,klongdat
+      PARAMETER (klatdat=180,klongdat=360)
+
+c Physique sur grille scalaire 
+c----------------------------
+      real zmeaS(iip1,jjp1),zstdS(iip1,jjp1)
+      real zsigS(iip1,jjp1),zgamS(iip1,jjp1),ztheS(iip1,jjp1)
+      real z0S(iip1,jjp1)
+
+c variable physique
+c------------------
+      REAL tauscadyn(iip1,jjp1) ! dust conversion factor on the dynamics grid
+      real alb(iip1,jjp1),albfi(ngridmx) ! albedos
+      real ith(iip1,jjp1,nsoilmx),ithfi(ngridmx,nsoilmx) ! thermal inertia (3D)
+      real surfith(iip1,jjp1),surfithfi(ngridmx) ! surface thermal inertia (2D)
+      REAL latfi(ngridmx),lonfi(ngridmx),airefi(ngridmx)
+
+      INTEGER i,j,l,isoil,ig,idum
+      real mugaz ! molar mass of the atmosphere
+
+      integer ierr  !, nbetat
+
+c Variables on the new grid along scalar points 
+c------------------------------------------------------
+!      REAL p(iip1,jjp1)
+      REAL t(iip1,jjp1,llm)
+      real phisold_newgrid(iip1,jjp1)
+      REAL :: teta(iip1, jjp1, llm)
+      REAL :: pk(iip1,jjp1,llm)
+      REAL :: pkf(iip1,jjp1,llm)
+      REAL :: ps(iip1, jjp1)
+      REAL :: masse(iip1,jjp1,llm)
+      REAL :: xpn,xps,xppn(iim),xpps(iim)
+      REAL :: p3d(iip1, jjp1, llm+1)
+      REAL :: beta(iip1,jjp1,llm)
+!      REAL dteta(ip1jmp1,llm)
+
+c Variable de l'ancienne grille 
+c------------------------------
+      real time
+      real tab_cntrl(100)
+      real tab_cntrl_bis(100)
+
+c variables diverses
+c-------------------
+      real choix_1 ! ==0 : read start_archive file ; ==1: read start files
+      character*80      fichnom
+      integer Lmodif,iq
+      integer flagthermo, flagh2o
+      character modif*20
+      real tsud,albsud,alb_bb,ith_bb,Tiso
+      real ptoto,pcap,patm,airetot,ptotn,patmn
+!      real ssum
+      character*1 yes
+      logical :: flagiso=.false. ,  flagps0=.false.
+      real val, val2, val3 ! to store temporary variables
+      real :: iceith=2000 ! thermal inertia of subterranean ice
+      real :: iceithN,iceithS ! values of thermal inertias in N & S hemispheres
+      integer iref,jref
+
+      INTEGER :: itau
+      
+      INTEGER :: numvanle
+      character(len=50) :: txt ! to store some text
+      integer :: count
+      real :: profile(llm+1) ! to store an atmospheric profile + surface value
+
+! MONS data:
+      real :: MONS_Hdn(iip1,jjp1) ! Hdn: %WEH=Mass fraction of H2O
+      real :: MONS_d21(iip1,jjp1) ! ice table "depth" (in kg/m2)
+      ! coefficient to apply to convert d21 to 'true' depth (m)
+      real :: MONS_coeff
+      real :: MONS_coeffS ! coeff for southern hemisphere
+      real :: MONS_coeffN ! coeff for northern hemisphere
+!      real,parameter :: icedepthmin=1.e-3 ! Ice begins at most at that depth
+! Reference position for composition
+      real :: latref,lonref,dlatmin,dlonmin
+! Variable used to change composition
+      real :: Svmr,Smmr,Smmr_old,Smmr_new,Sn
+      real :: Mair_old,Mair_new,vmr_old,vmr_new
+      real,allocatable :: coefvmr(:)  ! Correction coefficient when changing composition
+      integer :: iloc(1), iqmax
+
+c sortie visu pour les champs dynamiques
+c---------------------------------------
+!      INTEGER :: visuid
+!      real :: time_step,t_ops,t_wrt
+!      CHARACTER*80 :: visu_file
+
+      cpp    = 744.499 ! for Mars, instead of 1004.70885 (Earth)
+      preff  = 610.    ! for Mars, instead of 101325. (Earth)
+      pa= 20           ! for Mars, instead of 500 (Earth)
+      planet_type="mars"
+
+! initialize "serial/parallel" related stuff
+      CALL init_phys_lmdz(iim,jjp1,llm,1,(/(jjm-1)*iim+2/))
+      call initcomgeomphy
+
+! Load tracer number and names:
+!      call iniadvtrac(nqtot,numvanle)
+      call infotrac_init
+! allocate arrays
+      allocate(q(iip1,jjp1,llm,nqtot))
+      allocate(coefvmr(nqtot))
+
+c=======================================================================
+c   Choice of the start file(s) to use
+c=======================================================================
+
+      write(*,*) 'From which kind of files do you want to create new',
+     .  'start and startfi files'
+      write(*,*) '    0 - from a file start_archive'
+      write(*,*) '    1 - from files start and startfi'
+ 
+c-----------------------------------------------------------------------
+c   Open file(s) to modify (start or start_archive)
+c-----------------------------------------------------------------------
+
+      DO
+         read(*,*,iostat=ierr) choix_1
+         if ((choix_1 /= 0).OR.(choix_1 /=1)) EXIT
+      ENDDO
+
+c     Open start_archive
+c     ~~~~~~~~~~~~~~~~~~~~~~~~~~
+      if (choix_1.eq.0) then
+
+        write(*,*) 'Creating start files from:'
+        write(*,*) './start_archive.nc'
+        write(*,*)
+        fichnom = 'start_archive.nc'
+        ierr = NF_OPEN (fichnom, NF_NOWRITE,nid)
+        IF (ierr.NE.NF_NOERR) THEN
+          write(6,*)' Problem opening file:',fichnom
+          write(6,*)' ierr = ', ierr
+          CALL ABORT
+        ENDIF
+        tab0 = 50 
+        Lmodif = 1
+
+c     OR open start and startfi files
+c     ~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~
+      else
+        write(*,*) 'Creating start files from:'
+        write(*,*) './start.nc and ./startfi.nc'
+        write(*,*)
+        fichnom = 'start.nc'
+        ierr = NF_OPEN (fichnom, NF_NOWRITE,nid_dyn)
+        IF (ierr.NE.NF_NOERR) THEN
+          write(6,*)' Problem opening file:',fichnom
+          write(6,*)' ierr = ', ierr
+          CALL ABORT
+        ENDIF
+ 
+        fichnom = 'startfi.nc'
+        ierr = NF_OPEN (fichnom, NF_NOWRITE,nid_fi)
+        IF (ierr.NE.NF_NOERR) THEN
+          write(6,*)' Problem opening file:',fichnom
+          write(6,*)' ierr = ', ierr
+          CALL ABORT
+        ENDIF
+
+        tab0 = 0 
+        Lmodif = 0
+
+      endif
+
+c-----------------------------------------------------------------------
+c Lecture du tableau des parametres du run (pour la dynamique)
+c-----------------------------------------------------------------------
+
+      if (choix_1.eq.0) then
+
+        write(*,*) 'reading tab_cntrl START_ARCHIVE'
+c
+        ierr = NF_INQ_VARID (nid, "controle", nvarid)
+#ifdef NC_DOUBLE
+        ierr = NF_GET_VAR_DOUBLE(nid, nvarid, tab_cntrl)
+#else
+        ierr = NF_GET_VAR_REAL(nid, nvarid, tab_cntrl)
+#endif
+c
+      else if (choix_1.eq.1) then
+
+        write(*,*) 'reading tab_cntrl START'
+c
+        ierr = NF_INQ_VARID (nid_dyn, "controle", nvarid)
+#ifdef NC_DOUBLE
+        ierr = NF_GET_VAR_DOUBLE(nid_dyn, nvarid, tab_cntrl)
+#else
+        ierr = NF_GET_VAR_REAL(nid_dyn, nvarid, tab_cntrl)
+#endif
+c
+        write(*,*) 'reading tab_cntrl STARTFI'
+c
+        ierr = NF_INQ_VARID (nid_fi, "controle", nvarid)
+#ifdef NC_DOUBLE
+        ierr = NF_GET_VAR_DOUBLE(nid_fi, nvarid, tab_cntrl_bis)
+#else
+        ierr = NF_GET_VAR_REAL(nid_fi, nvarid, tab_cntrl_bis)
+#endif
+c
+        do i=1,50
+          tab_cntrl(i+50)=tab_cntrl_bis(i)
+        enddo
+      write(*,*) 'printing tab_cntrl', tab_cntrl
+      do i=1,100
+        write(*,*) i,tab_cntrl(i)
+      enddo
+      
+      endif
+c-----------------------------------------------------------------------
+c		Initialisation des constantes dynamique
+c-----------------------------------------------------------------------
+
+      kappa = tab_cntrl(9) 
+      etot0 = tab_cntrl(12)
+      ptot0 = tab_cntrl(13)
+      ztot0 = tab_cntrl(14)
+      stot0 = tab_cntrl(15)
+      ang0 = tab_cntrl(16)
+      write(*,*) "Newstart: kappa,etot0,ptot0,ztot0,stot0,ang0"
+      write(*,*) kappa,etot0,ptot0,ztot0,stot0,ang0
+
+c-----------------------------------------------------------------------
+c   Lecture du tab_cntrl et initialisation des constantes physiques
+c  - pour start:  Lmodif = 0 => pas de modifications possibles
+c                  (modif dans le tabfi de readfi + loin)
+c  - pour start_archive:  Lmodif = 1 => modifications possibles
+c-----------------------------------------------------------------------
+      if (choix_1.eq.0) then
+         ! tabfi requires that input file be first opened by open_startphy(fichnom)
+         fichnom = 'start_archive.nc'
+         call open_startphy(fichnom)
+         call tabfi (nid,Lmodif,tab0,day_ini,lllm,p_rad,
+     .            p_omeg,p_g,p_mugaz,p_daysec,time)
+      else if (choix_1.eq.1) then
+         fichnom = 'startfi.nc'
+         call open_startphy(fichnom)
+         call tabfi (nid_fi,Lmodif,tab0,day_ini,lllm,p_rad,
+     .            p_omeg,p_g,p_mugaz,p_daysec,time)
+      endif
+
+      rad = p_rad
+      omeg = p_omeg
+      g = p_g
+      mugaz = p_mugaz
+      daysec = p_daysec
+!      write(*,*) 'aire',aire
+
+
+c=======================================================================
+c  INITIALISATIONS DIVERSES
+c=======================================================================
+
+      day_step=180 !?! Note: day_step is a common in "control.h"
+      CALL defrun_new( 99, .TRUE. )
+      CALL iniconst 
+      CALL inigeom
+      idum=-1
+      idum=0
+
+c Initialisation coordonnees /aires
+c -------------------------------
+! Note: rlatu(:) and rlonv(:) are commons defined in "comgeom.h"
+!       rlatu() and rlonv() are given in radians
+      latfi(1)=rlatu(1)
+      lonfi(1)=0.
+      DO j=2,jjm
+         DO i=1,iim
+            latfi((j-2)*iim+1+i)=rlatu(j)
+            lonfi((j-2)*iim+1+i)=rlonv(i)
+         ENDDO
+      ENDDO
+      latfi(ngridmx)=rlatu(jjp1)
+      lonfi(ngridmx)=0.
+      
+      ! build airefi(), mesh area on physics grid
+      CALL gr_dyn_fi(1,iip1,jjp1,ngridmx,aire,airefi)
+      ! Poles are single points on physics grid
+      airefi(1)=sum(aire(1:iim,1))
+      airefi(ngridmx)=sum(aire(1:iim,jjm+1))
+
+! also initialize various physics flags/settings which might be needed
+!    (for instance initracer needs to know about some flags, and/or
+!      'datafile' path may be changed by user)
+      call phys_state_var_init(ngridmx,llm,nqtot,
+     &                         day_ini,hour_ini,daysec,dtphys,
+     &                         rad,g,r,cpp)
+      call ini_fillgeom(ngridmx,latfi,lonfi,airefi)
+      call conf_phys(ngridmx,llm,nqtot)
+
+c=======================================================================
+c   lecture topographie, albedo, inertie thermique, relief sous-maille
+c=======================================================================
+
+      if (choix_1.ne.1) then  ! pour ne pas avoir besoin du fichier 
+                              ! surface.dat dans le cas des start
+
+c do while((relief(1:3).ne.'mol').AND.(relief(1:3).ne.'pla'))
+c       write(*,*)
+c       write(*,*) 'choix du relief (mola,pla)'
+c       write(*,*) '(Topographie MGS MOLA, plat)'
+c       read(*,fmt='(a3)') relief
+        relief="mola"
+c     enddo
+
+      CALL datareadnc(relief,phis,alb,surfith,z0S,
+     &          zmeaS,zstdS,zsigS,zgamS,ztheS)
+
+      CALL gr_dyn_fi(1,iip1,jjp1,ngridmx,phis,phisfi)
+!      CALL gr_dyn_fi(1,iip1,jjp1,ngridmx,ith,ithfi)
+      CALL gr_dyn_fi(1,iip1,jjp1,ngridmx,surfith,surfithfi)
+      CALL gr_dyn_fi(1,iip1,jjp1,ngridmx,alb,albfi)
+      CALL gr_dyn_fi(1,iip1,jjp1,ngridmx,z0S,z0)
+      CALL gr_dyn_fi(1,iip1,jjp1,ngridmx,zmeaS,zmea)
+      CALL gr_dyn_fi(1,iip1,jjp1,ngridmx,zstdS,zstd)
+      CALL gr_dyn_fi(1,iip1,jjp1,ngridmx,zsigS,zsig)
+      CALL gr_dyn_fi(1,iip1,jjp1,ngridmx,zgamS,zgam)
+      CALL gr_dyn_fi(1,iip1,jjp1,ngridmx,ztheS,zthe)
+
+      endif ! of if (choix_1.ne.1)
+
+
+c=======================================================================
+c  Lecture des fichiers (start ou start_archive)
+c=======================================================================
+
+      if (choix_1.eq.0) then
+
+        write(*,*) 'Reading file START_ARCHIVE'
+        CALL lect_start_archive(ngridmx,llm,nqtot,
+     &   date,tsurf,tsoil,emis,q2,
+     &   t,ucov,vcov,ps,co2ice,teta,phisold_newgrid,q,qsurf,
+     &   tauscaling,surfith,nid)
+        write(*,*) "OK, read start_archive file"
+	! copy soil thermal inertia
+	ithfi(:,:)=inertiedat(:,:)
+	
+        ierr= NF_CLOSE(nid)
+
+      else if (choix_1.eq.1) then !  c'est l'appel a tabfi de phyeta0 qui
+                                  !  permet de changer les valeurs du 
+                                  !  tab_cntrl Lmodif=1
+        tab0=0
+        Lmodif=1 ! Lmodif set to 1 to allow modifications in phyeta0                           
+        write(*,*) 'Reading file START'
+        fichnom = 'start.nc'
+        CALL dynetat0(fichnom,vcov,ucov,teta,q,masse,
+     .       ps,phis,time)
+
+        write(*,*) 'Reading file STARTFI'
+        fichnom = 'startfi.nc'
+        CALL phyetat0 (fichnom,tab0,Lmodif,nsoilmx,ngridmx,llm,nqtot,
+     .        day_ini,time,
+     .        tsurf,tsoil,emis,q2,qsurf,co2ice,tauscaling)
+        
+        ! copy albedo and soil thermal inertia
+        do i=1,ngridmx
+          albfi(i) = albedodat(i)
+	  do j=1,nsoilmx
+           ithfi(i,j) = inertiedat(i,j)
+	  enddo
+        ! build a surfithfi(:) using 1st layer of ithfi(:), which might
+        ! be neede later on if reinitializing soil thermal inertia
+          surfithfi(i)=ithfi(i,1)
+        enddo
+
+      else 
+        CALL exit(1)
+      endif
+
+      dtvr   = daysec/REAL(day_step)
+      dtphys   = dtvr * REAL(iphysiq)
+
+c=======================================================================
+c 
+c=======================================================================
+! If tracer names follow 'old' convention (q01, q02, ...) then
+! rename them
+      count=0
+      do iq=1,nqtot
+        txt=" "
+        write(txt,'(a1,i2.2)') 'q',iq
+        if (txt.eq.tname(iq)) then
+          count=count+1
+        endif
+      enddo ! of do iq=1,nqtot
+      
+      ! initialize tracer names noms(:) and indexes (igcm_co2, igcm_h2o_vap, ...)
+      call initracer(ngridmx,nqtot,qsurf)
+      
+      if (count.eq.nqtot) then
+        write(*,*) 'Newstart: updating tracer names'
+        ! copy noms(:) to tname(:) to have matching tracer names in physics
+        ! and dynamics
+        tname(1:nqtot)=noms(1:nqtot)
+      endif
+
+c=======================================================================
+c 
+c=======================================================================
+
+      do ! infinite loop on list of changes
+
+      write(*,*)
+      write(*,*)
+      write(*,*) 'List of possible changes :'
+      write(*,*) '~~~~~~~~~~~~~~~~~~~~~~~~~~'
+      write(*,*)
+      write(*,*) 'flat         : no topography ("aquaplanet")'
+      write(*,*) 'bilball      : uniform albedo and thermal inertia'
+      write(*,*) 'z0           : set a uniform surface roughness length'
+      write(*,*) 'coldspole    : cold subsurface and high albedo at
+     $ S.Pole'
+      write(*,*) 'qname        : change tracer name'
+      write(*,*) 'q=0          : ALL tracer =zero'
+      write(*,*) 'q=x          : give a specific uniform value to one
+     $ tracer'
+      write(*,*) 'q=profile    : specify a profile for a tracer'
+      write(*,*) 'freedust     : rescale dust to a true value'
+      write(*,*) 'ini_q        : tracers initialization for chemistry
+     $ and water vapour'
+      write(*,*) 'ini_q-h2o    : tracers initialization for chemistry
+     $ only'
+      write(*,*) 'composition  : change atm main composition: CO2,N2,Ar,
+     $ O2,CO'
+      write(*,*) 'ini_h2osurf  : reinitialize surface water ice '
+      write(*,*) 'noglacier    : Remove tropical H2O ice if |lat|<45'
+      write(*,*) 'watercapn    : H20 ice on permanent N polar cap '
+      write(*,*) 'watercaps    : H20 ice on permanent S polar cap '
+      write(*,*) 'wetstart     : start with a wet atmosphere'
+      write(*,*) 'isotherm     : Isothermal Temperatures, wind set to
+     $ zero'
+      write(*,*) 'co2ice=0     : remove CO2 polar cap'
+      write(*,*) 'ptot         : change total pressure'
+      write(*,*) 'therm_ini_s  : set soil thermal inertia to reference
+     $ surface values'
+      write(*,*) 'subsoilice_n : put deep underground ice layer in
+     $ northern hemisphere'
+      write(*,*) 'subsoilice_s : put deep underground ice layer in
+     $ southern hemisphere'
+      write(*,*) 'mons_ice     : put underground ice layer according
+     $ to MONS derived data'
+
+        write(*,*)
+        write(*,*) 'Change to perform ?'
+        write(*,*) '   (enter keyword or return to end)'
+        write(*,*)
+
+        read(*,fmt='(a20)') modif
+        if (modif(1:1) .eq. ' ') exit ! exit loop on changes
+
+        write(*,*)
+        write(*,*) trim(modif) , ' : '
+
+c       'flat : no topography ("aquaplanet")'
+c       -------------------------------------
+        if (trim(modif) .eq. 'flat') then
+c         set topo to zero 
+          phis(:,:)=0
+          CALL gr_dyn_fi(1,iip1,jjp1,ngridmx,phis,phisfi)
+          write(*,*) 'topography set to zero.'
+          write(*,*) 'WARNING : the subgrid topography parameters',
+     &    ' were not set to zero ! => set calllott to F'                    
+
+c        Choice for surface pressure
+         yes=' '
+         do while ((yes.ne.'y').and.(yes.ne.'n'))
+            write(*,*) 'Do you wish to choose homogeneous surface',
+     &                 'pressure (y) or let newstart interpolate ',
+     &                 ' the previous field  (n)?'
+             read(*,fmt='(a)') yes
+         end do
+         if (yes.eq.'y') then
+           flagps0=.true.
+           write(*,*) 'New value for ps (Pa) ?'
+ 201       read(*,*,iostat=ierr) patm
+            if(ierr.ne.0) goto 201
+             write(*,*)
+             write(*,*) ' new ps everywhere (Pa) = ', patm
+             write(*,*)
+             do j=1,jjp1
+               do i=1,iip1
+                 ps(i,j)=patm
+               enddo
+             enddo
+         end if
+
+c       bilball : albedo, inertie thermique uniforme
+c       --------------------------------------------
+        else if (trim(modif) .eq. 'bilball') then
+          write(*,*) 'constante albedo and iner.therm:'
+          write(*,*) 'New value for albedo (ex: 0.25) ?'
+ 101      read(*,*,iostat=ierr) alb_bb
+          if(ierr.ne.0) goto 101
+          write(*,*)
+          write(*,*) ' uniform albedo (new value):',alb_bb
+          write(*,*)
+
+          write(*,*) 'New value for thermal inertia (eg: 247) ?'
+ 102      read(*,*,iostat=ierr) ith_bb
+          if(ierr.ne.0) goto 102
+          write(*,*) 'uniform thermal inertia (new value):',ith_bb
+          DO j=1,jjp1
+             DO i=1,iip1
+                alb(i,j) = alb_bb	! albedo
+		do isoil=1,nsoilmx
+                  ith(i,j,isoil) = ith_bb	! thermal inertia
+		enddo
+             END DO
+          END DO
+!          CALL gr_dyn_fi(1,iip1,jjp1,ngridmx,ith,ithfi)
+          CALL gr_dyn_fi(nsoilmx,iip1,jjp1,ngridmx,ith,ithfi)
+          CALL gr_dyn_fi(1,iip1,jjp1,ngridmx,alb,albfi)
+        
+         ! also reset surface roughness length to default value
+         write(*,*) 'surface roughness length set to:',z0_default,' m'
+         z0(:)=z0_default
+
+!       z0 : set surface roughness length to a constant value
+!       -----------------------------------------------------
+        else if (trim(modif) .eq. 'z0') then
+          write(*,*) 'set a uniform surface roughness length'
+          write(*,*) ' value for z0_default (ex: ',z0_default,')?'
+          ierr=1
+          do while (ierr.ne.0)
+            read(*,*,iostat=ierr) z0_default
+          enddo
+          z0(:)=z0_default
+
+c       coldspole : sous-sol de la calotte sud toujours froid
+c       -----------------------------------------------------
+        else if (trim(modif) .eq. 'coldspole') then
+          write(*,*)'new value for the subsurface temperature',
+     &   ' beneath the permanent southern polar cap ? (eg: 141 K)'
+ 103      read(*,*,iostat=ierr) tsud
+          if(ierr.ne.0) goto 103
+          write(*,*)
+          write(*,*) ' new value of the subsurface temperature:',tsud
+c         nouvelle temperature sous la calotte permanente
+          do l=2,nsoilmx
+               tsoil(ngridmx,l) =  tsud
+          end do
+
+
+          write(*,*)'new value for the albedo',
+     &   'of the permanent southern polar cap ? (eg: 0.75)'
+ 104      read(*,*,iostat=ierr) albsud
+          if(ierr.ne.0) goto 104
+          write(*,*)
+
+c         ~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~
+c         Option 1:  only the albedo of the pole is modified :    
+          albfi(ngridmx)=albsud
+          write(*,*) 'ig=',ngridmx,'   albedo perennial cap ',
+     &    albfi(ngridmx)
+
+c         ~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~ 
+c          Option 2 A haute resolution : coordonnee de la vrai calotte ~    
+c           DO j=1,jjp1
+c             DO i=1,iip1
+c                ig=1+(j-2)*iim +i
+c                if(j.eq.1) ig=1
+c                if(j.eq.jjp1) ig=ngridmx
+c                if ((rlatu(j)*180./pi.lt.-84.).and.
+c     &            (rlatu(j)*180./pi.gt.-91.).and.
+c     &            (rlonv(i)*180./pi.gt.-91.).and.
+c     &            (rlonv(i)*180./pi.lt.0.))         then
+cc    albedo de la calotte permanente fixe a albsud
+c                   alb(i,j)=albsud
+c                   write(*,*) 'lat=',rlatu(j)*180./pi,
+c     &                      ' lon=',rlonv(i)*180./pi
+cc     fin de la condition sur les limites de la calotte permanente
+c                end if
+c             ENDDO
+c          ENDDO
+c      ~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~
+
+c         CALL gr_dyn_fi(1,iip1,jjp1,ngridmx,alb,albfi)
+
+
+c       ptot : Modification of the total pressure: ice + current atmosphere 
+c       -------------------------------------------------------------------
+        else if (trim(modif) .eq. 'ptot') then
+
+c         calcul de la pression totale glace + atm actuelle
+          patm=0.
+          airetot=0.
+          pcap=0.
+          DO j=1,jjp1
+             DO i=1,iim
+                ig=1+(j-2)*iim +i
+                if(j.eq.1) ig=1
+                if(j.eq.jjp1) ig=ngridmx
+                patm = patm + ps(i,j)*aire(i,j)
+                airetot= airetot + aire(i,j)
+                pcap = pcap + aire(i,j)*co2ice(ig)*g
+             ENDDO
+          ENDDO
+          ptoto = pcap + patm
+
+          print*,'Current total pressure at surface (co2 ice + atm) ',
+     &       ptoto/airetot
+
+          print*,'new value?'
+          read(*,*) ptotn
+          ptotn=ptotn*airetot
+          patmn=ptotn-pcap
+          print*,'ptoto,patm,ptotn,patmn'
+          print*,ptoto,patm,ptotn,patmn
+          print*,'Mult. factor for pressure (atm only)', patmn/patm
+          do j=1,jjp1
+             do i=1,iip1
+                ps(i,j)=ps(i,j)*patmn/patm
+             enddo
+          enddo
+
+c        Correction pour la conservation des traceurs
+         yes=' '
+         do while ((yes.ne.'y').and.(yes.ne.'n'))
+            write(*,*) 'Do you wish to conserve tracer total mass (y)',
+     &              ' or tracer mixing ratio (n) ?'
+             read(*,fmt='(a)') yes
+         end do
+
+         if (yes.eq.'y') then
+           write(*,*) 'OK : conservation of tracer total mass'
+           DO iq =1, nqtot
+             DO l=1,llm
+               DO j=1,jjp1
+                  DO i=1,iip1
+                    q(i,j,l,iq)=q(i,j,l,iq)*patm/patmn
+                  ENDDO
+               ENDDO
+             ENDDO
+           ENDDO
+          else
+            write(*,*) 'OK : conservation of tracer mixing ratio'
+          end if
+
+c       qname : change tracer name
+c       --------------------------
+        else if (trim(modif).eq.'qname') then
+         yes='y'
+         do while (yes.eq.'y')
+          write(*,*) 'Which tracer name do you want to change ?'
+          do iq=1,nqtot
+            write(*,'(i3,a3,a20)')iq,' : ',trim(tname(iq))
+          enddo
+          write(*,'(a35,i3)')
+     &            '(enter tracer number; between 1 and ',nqtot
+          write(*,*)' or any other value to quit this option)'
+          read(*,*) iq
+          if ((iq.ge.1).and.(iq.le.nqtot)) then
+            write(*,*)'Change tracer name ',trim(tname(iq)),' to ?'
+            read(*,*) txt
+            tname(iq)=txt
+            write(*,*)'Do you want to change another tracer name (y/n)?'
+            read(*,'(a)') yes 
+          else
+! inapropiate value of iq; quit this option
+            yes='n'
+          endif ! of if ((iq.ge.1).and.(iq.le.nqtot))
+         enddo ! of do while (yes.ne.'y')
+
+c       q=0 : set tracers to zero
+c       -------------------------
+        else if (trim(modif) .eq. 'q=0') then
+c          mise a 0 des q (traceurs)
+          write(*,*) 'Tracers set to 0 (1.E-30 in fact)'
+           DO iq =1, nqtot
+             DO l=1,llm
+               DO j=1,jjp1
+                  DO i=1,iip1
+                    q(i,j,l,iq)=1.e-30
+                  ENDDO
+               ENDDO
+             ENDDO
+           ENDDO
+
+c          set surface tracers to zero
+           DO iq =1, nqtot
+             DO ig=1,ngridmx
+                 qsurf(ig,iq)=0.
+             ENDDO
+           ENDDO
+
+c       q=x : initialise tracer manually 
+c       --------------------------------
+        else if (trim(modif) .eq. 'q=x') then
+             write(*,*) 'Which tracer do you want to modify ?'
+             do iq=1,nqtot
+               write(*,*)iq,' : ',trim(tname(iq))
+             enddo
+             write(*,*) '(choose between 1 and ',nqtot,')'
+             read(*,*) iq 
+             if ((iq.lt.1).or.(iq.gt.nqtot)) then
+               ! wrong value for iq, go back to menu
+               write(*,*) "wrong input value:",iq
+               cycle
+             endif
+             write(*,*)'mixing ratio of tracer ',trim(tname(iq)),
+     &                 ' ? (kg/kg)'
+             read(*,*) val
+             DO l=1,llm
+               DO j=1,jjp1
+                  DO i=1,iip1
+                    q(i,j,l,iq)=val
+                  ENDDO
+               ENDDO
+             ENDDO
+             write(*,*) 'SURFACE value of tracer ',trim(tname(iq)),
+     &                   ' ? (kg/m2)'
+             read(*,*) val
+             DO ig=1,ngridmx
+                 qsurf(ig,iq)=val
+             ENDDO
+
+c       q=profile : initialize tracer with a given profile
+c       --------------------------------------------------
+        else if (trim(modif) .eq. 'q=profile') then
+             write(*,*) 'Tracer profile will be sought in ASCII file'
+             write(*,*) "'profile_tracer' where 'tracer' is tracer name"
+             write(*,*) "(one value per line in file; starting with"
+             write(*,*) "surface value, the 1st atmospheric layer"
+             write(*,*) "followed by 2nd, etc. up to top of atmosphere)"
+             write(*,*) 'Which tracer do you want to set?'
+             do iq=1,nqtot
+               write(*,*)iq,' : ',trim(tname(iq))
+             enddo
+             write(*,*) '(choose between 1 and ',nqtot,')'
+             read(*,*) iq 
+             if ((iq.lt.1).or.(iq.gt.nqtot)) then
+               ! wrong value for iq, go back to menu
+               write(*,*) "wrong input value:",iq
+               cycle
+             endif
+             ! look for input file 'profile_tracer'
+             txt="profile_"//trim(tname(iq))
+             open(41,file=trim(txt),status='old',form='formatted',
+     &            iostat=ierr)
+             if (ierr.eq.0) then
+               ! OK, found file 'profile_...', load the profile
+               do l=1,llm+1
+                 read(41,*,iostat=ierr) profile(l)
+                 if (ierr.ne.0) then ! something went wrong
+                   exit ! quit loop
+                 endif
+               enddo
+               if (ierr.eq.0) then
+                 ! initialize tracer values
+                 qsurf(:,iq)=profile(1)
+                 do l=1,llm
+                   q(:,:,l,iq)=profile(l+1)
+                 enddo
+                 write(*,*)'OK, tracer ',trim(tname(iq)),
+     &               ' initialized ','using values from file ',trim(txt)
+               else
+                 write(*,*)'problem reading file ',trim(txt),' !'
+                 write(*,*)'No modifications to tracer ',trim(tname(iq))
+               endif
+             else
+               write(*,*)'Could not find file ',trim(txt),' !'
+               write(*,*)'No modifications to tracer ',trim(tname(iq))
+             endif
+             
+c       convert dust from virtual to true values
+c       --------------------------------------------------
+        else if (trim(modif) .eq. 'freedust') then
+         if (minval(tauscaling) .lt. 0) then
+           write(*,*) 'WARNING conversion factor negative'
+           write(*,*) 'This is probably because it was not present
+     &in the file'
+           write(*,*) 'A constant conversion is used instead.'
+           tauscaling(:) = 1.e-3
+         endif
+         CALL gr_fi_dyn(1,ngridmx,iip1,jjp1,tauscaling,tauscadyn)
+          do l=1,llm
+            do j=1,jjp1
+              do i=1,iip1
+                if (igcm_dust_number .ne. 0) 
+     &            q(i,j,l,igcm_dust_number) =
+     &            q(i,j,l,igcm_dust_number) * tauscadyn(i,j)
+                if (igcm_dust_mass .ne. 0) 
+     &            q(i,j,l,igcm_dust_mass) =
+     &            q(i,j,l,igcm_dust_mass) * tauscadyn(i,j)
+                if (igcm_ccn_number .ne. 0) 
+     &            q(i,j,l,igcm_ccn_number) =
+     &            q(i,j,l,igcm_ccn_number) * tauscadyn(i,j)
+                if (igcm_ccn_mass .ne. 0) 
+     &            q(i,j,l,igcm_ccn_mass) =
+     &            q(i,j,l,igcm_ccn_mass) * tauscadyn(i,j)
+              end do
+            end do
+          end do
+
+          tauscaling(:) = 1.
+
+         ! We want to have the very same value at lon -180 and lon 180
+          do l = 1,llm
+             do j = 1,jjp1
+                do iq = 1,nqtot
+                   q(iip1,j,l,iq) = q(1,j,l,iq)
+                end do
+             end do
+          end do
+
+          write(*,*) 'done rescaling to true vale'
+
+c       ini_q : Initialize tracers for chemistry
+c       -----------------------------------------------
+        else if (trim(modif) .eq. 'ini_q') then
+          flagh2o    = 1
+          flagthermo = 0
+          yes=' '
+c         For more than 32 layers, possible to initiate thermosphere only     
+          if (llm.gt.32) then 
+            do while ((yes.ne.'y').and.(yes.ne.'n'))
+            write(*,*)'',
+     &     'initialisation for thermosphere only? (y/n)'
+            read(*,fmt='(a)') yes
+            if (yes.eq.'y') then
+            flagthermo=1 
+            else
+            flagthermo=0
+            endif
+            enddo  
+          endif
+          
+          call inichim_newstart(ngridmx, nqtot, q, qsurf, ps, 
+     &                          flagh2o, flagthermo)
+
+         ! We want to have the very same value at lon -180 and lon 180
+          do l = 1,llm
+             do j = 1,jjp1
+                do iq = 1,nqtot
+                   q(iip1,j,l,iq) = q(1,j,l,iq)
+                end do
+             end do
+          end do
+
+          write(*,*) 'inichim_newstart: chemical species and
+     $ water vapour initialised'
+
+c       ini_q-h2o : as above except for the water vapour tracer 
+c       ------------------------------------------------------
+        else if (trim(modif) .eq. 'ini_q-h2o') then
+          flagh2o    = 0
+          flagthermo = 0
+          yes=' '
+          ! for more than 32 layers, possible to initiate thermosphere only     
+          if(llm.gt.32) then
+            do while ((yes.ne.'y').and.(yes.ne.'n'))
+            write(*,*)'',
+     &      'initialisation for thermosphere only? (y/n)'
+            read(*,fmt='(a)') yes
+            if (yes.eq.'y') then 
+            flagthermo=1 
+            else
+            flagthermo=0
+            endif
+            enddo
+          endif
+
+          call inichim_newstart(ngridmx, nqtot, q, qsurf, ps, 
+     &                          flagh2o, flagthermo)
+
+         ! We want to have the very same value at lon -180 and lon 180
+          do l = 1,llm
+             do j = 1,jjp1
+                do iq = 1,nqtot
+                   q(iip1,j,l,iq) = q(1,j,l,iq)
+                end do
+             end do
+          end do
+
+          write(*,*) 'inichim_newstart: chemical species initialised
+     $ (except water vapour)'
+
+c      composition : change main composition: CO2,N2,Ar,O2,CO (FF 03/2014)
+c      --------------------------------------------------------
+       else if (trim(modif) .eq. 'composition') then
+          write(*,*) "Lat (degN)  lon (degE) of the reference site ?"
+          write(*,*) "e.g. MSL : -4.5  137.  "
+ 301      read(*,*,iostat=ierr) latref, lonref
+          if(ierr.ne.0) goto 301
+
+
+        !  Select GCM point close to reference site
+          dlonmin =90.
+          DO i=1,iip1-1
+             if (abs(rlonv(i)*180./pi -lonref).lt.dlonmin)then
+                iref=i
+                dlonmin=abs(rlonv(i)*180./pi -lonref)
+             end if   
+          ENDDO
+          dlatmin =45.
+          DO j=1,jjp1
+             if (abs(rlatu(j)*180./pi -latref).lt.dlatmin)then
+                jref=j
+                dlatmin=abs(rlatu(j)*180./pi -latref)
+             end if   
+          ENDDO
+          write(*,*) "In GCM : lat= " ,  rlatu(jref)*180./pi
+          write(*,*) "In GCM : lon= " ,  rlonv(iref)*180./pi
+          write(*,*)
+
+        ! Compute air molar mass at reference site
+          Smmr=0
+          Sn = 0
+          do iq=1,nqtot 
+             if ((iq.eq.igcm_co2).or.(iq.eq.igcm_n2)
+     &      .or. (iq.eq.igcm_ar).or.(iq.eq.igcm_o2)
+     &      .or. (iq.eq.igcm_co)) then
+                 Smmr=Smmr+q(iref,jref,1,iq)
+                 Sn=Sn+q(iref,jref,1,iq)/mmol(iq) 
+             end if
+          end do
+          write(*,*) "At reference site :  "
+          write(*,*) "Sum of mass mix. ratio (should be about 1)=",Smmr
+          Mair_old =Smmr/Sn
+          write(*,*)
+     &     "Air molar mass (g/mol) at reference site= ",Mair_old
+
+        ! Ask for new volume mixing ratio at reference site
+          Svmr =0.
+          Sn =0.
+          do iq=1,nqtot 
+           coefvmr(iq) = 1.
+           if ((iq.eq.igcm_n2).or.(iq.eq.igcm_ar)
+     &     .or. (iq.eq.igcm_o2).or.(iq.eq.igcm_co)) then
+
+             vmr_old=q(iref,jref,1,iq)*Mair_old/mmol(iq)  
+             write(*,*) "Previous vmr("//trim(tname(iq))//")= ", vmr_old
+
+              if (iq.eq.igcm_n2) then
+                write(*,*) "New vmr(n2)? (MSL: 2.03e-02 at Ls~184)"
+              endif
+              if (iq.eq.igcm_ar) then
+                write(*,*) "New vmr(ar)? (MSL: 2.07e-02 at Ls~184)"
+              endif
+              if (iq.eq.igcm_o2) then
+                write(*,*) "New vmr(o2)? (MSL: 1.73e-03 at Ls~184)"
+              endif
+              if (iq.eq.igcm_co) then
+                write(*,*) "New vmr(co)? (MSL: 7.49e-04 at Ls~184)"
+              endif
+ 302          read(*,*,iostat=ierr) vmr_new
+              if(ierr.ne.0) goto 302
+              write(*,*) "New vmr("//trim(tname(iq))//")= ",vmr_new
+              write(*,*) 
+              coefvmr(iq) = vmr_new/vmr_old
+              Svmr=Svmr+vmr_new
+              Sn=Sn+vmr_new*mmol(iq)
+           end if
+          enddo ! of do iq=1,nqtot 
+      !  Estimation of new Air molar mass at reference site (assuming vmr_co2 = 1-Svmr)
+          Mair_new = Sn + (1-Svmr)*mmol(igcm_co2) 
+          write(*,*)
+     &     "NEW Air molar mass (g/mol) at reference site= ",Mair_new
+
+        ! Compute mass mixing ratio changes  
+          do iq=1,nqtot  
+            if ((iq.eq.igcm_n2).or.(iq.eq.igcm_ar)
+     &          .or. (iq.eq.igcm_o2).or.(iq.eq.igcm_co)) then
+             write(*,*) "Everywhere mmr("//trim(tname(iq))//
+     &        ") is multiplied by ",coefvmr(iq)*Mair_old/Mair_new
+            end if
+          end do
+
+        ! Recompute mass mixing ratios everywhere, and adjust mmr of most abundant species
+        ! to keep sum of mmr constant.
+          do l=1,llm
+           do j=1,jjp1
+            do i=1,iip1
+              Smmr_old = 0.
+              Smmr_new = 0.
+              do iq=1,nqtot  
+                if ((iq.eq.igcm_n2).or.(iq.eq.igcm_ar)
+     &         .or. (iq.eq.igcm_o2).or.(iq.eq.igcm_co)) then
+                   Smmr_old = Smmr_old + q(i,j,l,iq) ! sum of old mmr 
+                   q(i,j,l,iq)=q(i,j,l,iq)*coefvmr(iq)*Mair_old/Mair_new
+                   Smmr_new = Smmr_new + q(i,j,l,iq) ! sum of new mmr
+                end if 
+              enddo
+              iloc = maxloc(q(i,j,l,:))
+              iqmax = iloc(1)
+              q(i,j,l,iqmax) = q(i,j,l,iqmax) + Smmr_old - Smmr_new
+            enddo
+           enddo
+          enddo
+
+          write(*,*)
+     &   "The most abundant species is modified everywhere to keep "//
+     &   "sum of mmr constant"
+          write(*,*) 'At reference site vmr(CO2)=', 
+     &        q(iref,jref,1,igcm_co2)*Mair_new/mmol(igcm_co2)
+          write(*,*) "Compared to MSL observation: vmr(CO2)= 0.957 "//
+     &   "at Ls=184" 
+
+c      wetstart : wet atmosphere with a north to south gradient
+c      --------------------------------------------------------
+       else if (trim(modif) .eq. 'wetstart') then
+        ! check that there is indeed a water vapor tracer
+        if (igcm_h2o_vap.eq.0) then
+          write(*,*) "No water vapour tracer! Can't use this option"
+          stop
+        endif
+          DO l=1,llm
+            DO j=1,jjp1
+              DO i=1,iip1-1
+                q(i,j,l,igcm_h2o_vap)=150.e-6 * (rlatu(j)+pi/2.) / pi
+              ENDDO
+              ! We want to have the very same value at lon -180 and lon 180
+              q(iip1,j,l,igcm_h2o_vap) = q(1,j,l,igcm_h2o_vap)
+            ENDDO
+          ENDDO
+
+         write(*,*) 'Water mass mixing ratio at north pole='
+     *               ,q(1,1,1,igcm_h2o_vap)
+         write(*,*) '---------------------------south pole='
+     *               ,q(1,jjp1,1,igcm_h2o_vap)
+
+c      ini_h2osurf : reinitialize surface water ice
+c      --------------------------------------------------
+        else if (trim(modif) .eq. 'ini_h2osurf') then
+          write(*,*)'max surface ice left?(e.g. 0.2 kg/m2=200microns)'
+ 207      read(*,*,iostat=ierr) val
+          if(ierr.ne.0) goto 207
+          write(*,*)'also set negative values of surf ice to 0'
+           do ig=1,ngridmx
+              qsurf(ig,igcm_h2o_ice)=min(val,qsurf(ig,igcm_h2o_ice))
+              qsurf(ig,igcm_h2o_ice)=max(0.,qsurf(ig,igcm_h2o_ice))
+           end do
+
+c      noglacier : remove tropical water ice (to initialize high res sim)
+c      --------------------------------------------------
+        else if (trim(modif) .eq. 'noglacier') then
+           do ig=1,ngridmx
+             j=(ig-2)/iim +2
+              if(ig.eq.1) j=1
+              write(*,*) 'OK: remove surface ice for |lat|<45'
+              if (abs(rlatu(j)*180./pi).lt.45.) then
+                   qsurf(ig,igcm_h2o_ice)=0.
+              end if
+           end do
+
+
+c      watercapn : H20 ice on permanent northern cap
+c      --------------------------------------------------
+        else if (trim(modif) .eq. 'watercapn') then
+           do ig=1,ngridmx
+             j=(ig-2)/iim +2
+              if(ig.eq.1) j=1
+              if (rlatu(j)*180./pi.gt.80.) then
+                   qsurf(ig,igcm_h2o_ice)=1.e5
+                   write(*,*) 'ig=',ig,'    H2O ice mass (kg/m2)= ',
+     &              qsurf(ig,igcm_h2o_ice)
+                   write(*,*)'     ==> Ice mesh South boundary (deg)= ',
+     &              rlatv(j)*180./pi
+                end if
+           enddo
+
+c      watercaps : H20 ice on permanent southern cap
+c      -------------------------------------------------
+        else if (trim(modif) .eq. 'watercaps') then
+           do ig=1,ngridmx
+               j=(ig-2)/iim +2
+               if(ig.eq.1) j=1
+               if (rlatu(j)*180./pi.lt.-80.) then
+                   qsurf(ig,igcm_h2o_ice)=1.e5
+                   write(*,*) 'ig=',ig,'   H2O ice mass (kg/m2)= ',
+     &              qsurf(ig,igcm_h2o_ice)
+                   write(*,*)'     ==> Ice mesh North boundary (deg)= ',
+     &              rlatv(j-1)*180./pi
+               end if
+           enddo
+
+c       isotherm : Isothermal temperatures and no winds
+c       ------------------------------------------------
+        else if (trim(modif) .eq. 'isotherm') then
+
+          write(*,*)'Isothermal temperature of the atmosphere, 
+     &           surface and subsurface'
+          write(*,*) 'Value of this temperature ? :'
+ 203      read(*,*,iostat=ierr) Tiso
+          if(ierr.ne.0) goto 203
+
+          do ig=1, ngridmx
+            tsurf(ig) = Tiso
+          end do
+          do l=2,nsoilmx
+            do ig=1, ngridmx
+              tsoil(ig,l) = Tiso
+            end do
+          end do
+          flagiso=.true.
+          call initial0(llm*ip1jmp1,ucov)
+          call initial0(llm*ip1jm,vcov)
+          call initial0(ngridmx*(llm+1),q2)
+
+c       co2ice=0 : remove CO2 polar ice caps'
+c       ------------------------------------------------
+        else if (trim(modif) .eq. 'co2ice=0') then
+           do ig=1,ngridmx
+              co2ice(ig)=0
+              emis(ig)=emis(ngridmx/2)
+           end do
+        
+!       therm_ini_s: (re)-set soil thermal inertia to reference surface values
+!       ----------------------------------------------------------------------
+
+	else if (trim(modif).eq.'therm_ini_s') then
+!          write(*,*)"surfithfi(1):",surfithfi(1)
+	  do isoil=1,nsoilmx
+	    inertiedat(1:ngridmx,isoil)=surfithfi(1:ngridmx)
+	  enddo
+          write(*,*)'OK: Soil thermal inertia has been reset to referenc
+     &e surface values'
+!	  write(*,*)"inertiedat(1,1):",inertiedat(1,1)
+	  ithfi(:,:)=inertiedat(:,:)
+	 ! recast ithfi() onto ith()
+	 call gr_fi_dyn(nsoilmx,ngridmx,iip1,jjp1,ithfi,ith)
+! Check:
+!         do i=1,iip1
+!           do j=1,jjp1
+!             do isoil=1,nsoilmx
+!               write(77,*) i,j,isoil,"  ",ith(i,j,isoil)
+!             enddo
+!           enddo
+!	 enddo
+
+!       subsoilice_n: Put deep ice layer in northern hemisphere soil
+!       ------------------------------------------------------------
+
+	else if (trim(modif).eq.'subsoilice_n') then
+
+         write(*,*)'From which latitude (in deg.), up to the north pole,
+     &should we put subterranean ice?'
+	 ierr=1
+	 do while (ierr.ne.0)
+	  read(*,*,iostat=ierr) val
+	  if (ierr.eq.0) then ! got a value
+	    ! do a sanity check
+	    if((val.lt.0.).or.(val.gt.90)) then
+	      write(*,*)'Latitude should be between 0 and 90 deg. !!!'
+	      ierr=1
+	    else ! find corresponding jref (nearest latitude)
+	      ! note: rlatu(:) contains decreasing values of latitude
+	      !       starting from PI/2 to -PI/2
+	      do j=1,jjp1
+	        if ((rlatu(j)*180./pi.ge.val).and.
+     &              (rlatu(j+1)*180./pi.le.val)) then
+		  ! find which grid point is nearest to val:
+		  if (abs(rlatu(j)*180./pi-val).le.
+     &                abs((rlatu(j+1)*180./pi-val))) then
+		   jref=j
+		  else
+		   jref=j+1
+		  endif
+		 
+		 write(*,*)'Will use nearest grid latitude which is:',
+     &                     rlatu(jref)*180./pi
+		endif
+	      enddo ! of do j=1,jjp1
+	    endif ! of if((val.lt.0.).or.(val.gt.90))
+	  endif !of if (ierr.eq.0)
+	 enddo ! of do while
+
+         ! Build layers() (as in soil_settings.F)
+	 val2=sqrt(mlayer(0)*mlayer(1))
+	 val3=mlayer(1)/mlayer(0)
+	 do isoil=1,nsoilmx
+	   layer(isoil)=val2*(val3**(isoil-1))
+	 enddo
+
+         write(*,*)'At which depth (in m.) does the ice layer begin?'
+         write(*,*)'(currently, the deepest soil layer extends down to:'
+     &              ,layer(nsoilmx),')'
+	 ierr=1
+	 do while (ierr.ne.0)
+	  read(*,*,iostat=ierr) val2
+!	  write(*,*)'val2:',val2,'ierr=',ierr
+	  if (ierr.eq.0) then ! got a value, but do a sanity check
+	    if(val2.gt.layer(nsoilmx)) then
+	      write(*,*)'Depth should be less than ',layer(nsoilmx)
+	      ierr=1
+	    endif
+	    if(val2.lt.layer(1)) then
+	      write(*,*)'Depth should be more than ',layer(1)
+	      ierr=1
+	    endif
+	  endif
+         enddo ! of do while
+	 
+	 ! find the reference index iref the depth corresponds to
+!	 if (val2.lt.layer(1)) then
+!	  iref=1
+!	 else
+	  do isoil=1,nsoilmx-1
+	   if((val2.gt.layer(isoil)).and.(val2.lt.layer(isoil+1)))
+     &       then
+	     iref=isoil
+	     exit
+	   endif
+	  enddo
+!	 endif
+	 
+!	 write(*,*)'iref:',iref,'  jref:',jref
+!	 write(*,*)'layer',layer
+!	 write(*,*)'mlayer',mlayer
+         
+	 ! thermal inertia of the ice:
+	 ierr=1
+	 do while (ierr.ne.0)
+          write(*,*)'What is the value of subterranean ice thermal inert
+     &ia? (e.g.: 2000)'
+          read(*,*,iostat=ierr)iceith
+	 enddo ! of do while
+	 
+	 ! recast ithfi() onto ith()
+	 call gr_fi_dyn(nsoilmx,ngridmx,iip1,jjp1,ithfi,ith)
+	 
+	 do j=1,jref
+!	    write(*,*)'j:',j,'rlatu(j)*180./pi:',rlatu(j)*180./pi
+	    do i=1,iip1 ! loop on longitudes
+	     ! Build "equivalent" thermal inertia for the mixed layer
+	     ith(i,j,iref+1)=sqrt((layer(iref+1)-layer(iref))/
+     &                     (((val2-layer(iref))/(ith(i,j,iref)**2))+
+     &                      ((layer(iref+1)-val2)/(iceith)**2)))
+	     ! Set thermal inertia of lower layers
+	     do isoil=iref+2,nsoilmx
+	      ith(i,j,isoil)=iceith ! ice
+	     enddo
+	    enddo ! of do i=1,iip1 
+	 enddo ! of do j=1,jjp1
+	 
+
+	 CALL gr_dyn_fi(nsoilmx,iip1,jjp1,ngridmx,ith,ithfi)
+
+!         do i=1,nsoilmx
+!	  write(*,*)'i:',i,'ithfi(1,i):',ithfi(1,i)
+!	 enddo
+
+	
+!       subsoilice_s: Put deep ice layer in southern hemisphere soil
+!       ------------------------------------------------------------
+
+	else if (trim(modif).eq.'subsoilice_s') then
+
+         write(*,*)'From which latitude (in deg.), down to the south pol
+     &e, should we put subterranean ice?'
+	 ierr=1
+	 do while (ierr.ne.0)
+	  read(*,*,iostat=ierr) val
+	  if (ierr.eq.0) then ! got a value
+	    ! do a sanity check
+	    if((val.gt.0.).or.(val.lt.-90)) then
+	      write(*,*)'Latitude should be between 0 and -90 deg. !!!'
+	      ierr=1
+	    else ! find corresponding jref (nearest latitude)
+	      ! note: rlatu(:) contains decreasing values of latitude
+	      !       starting from PI/2 to -PI/2
+	      do j=1,jjp1
+	        if ((rlatu(j)*180./pi.ge.val).and.
+     &              (rlatu(j+1)*180./pi.le.val)) then
+		  ! find which grid point is nearest to val:
+		  if (abs(rlatu(j)*180./pi-val).le.
+     &                abs((rlatu(j+1)*180./pi-val))) then
+		   jref=j
+		  else
+		   jref=j+1
+		  endif
+		 
+		 write(*,*)'Will use nearest grid latitude which is:',
+     &                     rlatu(jref)*180./pi
+		endif
+	      enddo ! of do j=1,jjp1
+	    endif ! of if((val.lt.0.).or.(val.gt.90))
+	  endif !of if (ierr.eq.0)
+	 enddo ! of do while
+
+         ! Build layers() (as in soil_settings.F)
+	 val2=sqrt(mlayer(0)*mlayer(1))
+	 val3=mlayer(1)/mlayer(0)
+	 do isoil=1,nsoilmx
+	   layer(isoil)=val2*(val3**(isoil-1))
+	 enddo
+
+         write(*,*)'At which depth (in m.) does the ice layer begin?'
+         write(*,*)'(currently, the deepest soil layer extends down to:'
+     &              ,layer(nsoilmx),')'
+	 ierr=1
+	 do while (ierr.ne.0)
+	  read(*,*,iostat=ierr) val2
+!	  write(*,*)'val2:',val2,'ierr=',ierr
+	  if (ierr.eq.0) then ! got a value, but do a sanity check
+	    if(val2.gt.layer(nsoilmx)) then
+	      write(*,*)'Depth should be less than ',layer(nsoilmx)
+	      ierr=1
+	    endif
+	    if(val2.lt.layer(1)) then
+	      write(*,*)'Depth should be more than ',layer(1)
+	      ierr=1
+	    endif
+	  endif
+         enddo ! of do while
+	 
+	 ! find the reference index iref the depth corresponds to
+	  do isoil=1,nsoilmx-1
+	   if((val2.gt.layer(isoil)).and.(val2.lt.layer(isoil+1)))
+     &       then
+	     iref=isoil
+	     exit
+	   endif
+	  enddo
+	 
+!	 write(*,*)'iref:',iref,'  jref:',jref
+         
+	 ! thermal inertia of the ice:
+	 ierr=1
+	 do while (ierr.ne.0)
+          write(*,*)'What is the value of subterranean ice thermal inert
+     &ia? (e.g.: 2000)'
+          read(*,*,iostat=ierr)iceith
+	 enddo ! of do while
+	 
+	 ! recast ithfi() onto ith()
+	 call gr_fi_dyn(nsoilmx,ngridmx,iip1,jjp1,ithfi,ith)
+	 
+	 do j=jref,jjp1
+!	    write(*,*)'j:',j,'rlatu(j)*180./pi:',rlatu(j)*180./pi
+	    do i=1,iip1 ! loop on longitudes
+	     ! Build "equivalent" thermal inertia for the mixed layer
+	     ith(i,j,iref+1)=sqrt((layer(iref+1)-layer(iref))/
+     &                     (((val2-layer(iref))/(ith(i,j,iref)**2))+
+     &                      ((layer(iref+1)-val2)/(iceith)**2)))
+	     ! Set thermal inertia of lower layers
+	     do isoil=iref+2,nsoilmx
+	      ith(i,j,isoil)=iceith ! ice
+	     enddo
+	    enddo ! of do i=1,iip1 
+	 enddo ! of do j=jref,jjp1
+	 
+
+	 CALL gr_dyn_fi(nsoilmx,iip1,jjp1,ngridmx,ith,ithfi)
+
+c       'mons_ice' : use MONS data to build subsurface ice table
+c       --------------------------------------------------------
+        else if (trim(modif).eq.'mons_ice') then
+        
+       ! 1. Load MONS data
+        call load_MONS_data(MONS_Hdn,MONS_d21)
+        
+        ! 2. Get parameters from user
+        ierr=1
+	do while (ierr.ne.0)
+          write(*,*) "Coefficient to apply to MONS 'depth' in Northern",
+     &               " Hemisphere?"
+          write(*,*) " (should be somewhere between 3.2e-4 and 1.3e-3)"
+          read(*,*,iostat=ierr) MONS_coeffN
+        enddo
+        ierr=1
+	do while (ierr.ne.0)
+          write(*,*) "Coefficient to apply to MONS 'depth' in Southern",
+     &               " Hemisphere?"
+          write(*,*) " (should be somewhere between 3.2e-4 and 1.3e-3)"
+          read(*,*,iostat=ierr) MONS_coeffS
+        enddo
+        ierr=1
+        do while (ierr.ne.0)
+          write(*,*) "Value of subterranean ice thermal inertia ",
+     &               " in Northern hemisphere?"
+          write(*,*) " (e.g.: 2000, or perhaps 2290)"
+!          read(*,*,iostat=ierr) iceith
+          read(*,*,iostat=ierr) iceithN
+        enddo
+        ierr=1
+        do while (ierr.ne.0)
+          write(*,*) "Value of subterranean ice thermal inertia ",
+     &               " in Southern hemisphere?"
+          write(*,*) " (e.g.: 2000, or perhaps 2290)"
+!          read(*,*,iostat=ierr) iceith
+          read(*,*,iostat=ierr) iceithS
+        enddo
+        
+        ! 3. Build subterranean thermal inertia
+        
+        ! initialise subsurface inertia with reference surface values
+        do isoil=1,nsoilmx
+          ithfi(1:ngridmx,isoil)=surfithfi(1:ngridmx)
+        enddo
+        ! recast ithfi() onto ith()
+	call gr_fi_dyn(nsoilmx,ngridmx,iip1,jjp1,ithfi,ith)
+        
+        do i=1,iip1 ! loop on longitudes
+          do j=1,jjp1 ! loop on latitudes
+            ! set MONS_coeff
+            if (rlatu(j).ge.0) then ! northern hemisphere
+              ! N.B: rlatu(:) contains decreasing values of latitude
+	      !       starting from PI/2 to -PI/2
+              MONS_coeff=MONS_coeffN
+              iceith=iceithN
+            else ! southern hemisphere
+              MONS_coeff=MONS_coeffS
+              iceith=iceithS
+            endif
+            ! check if we should put subterranean ice
+            if (MONS_Hdn(i,j).ge.14.0) then ! no ice if Hdn<14%
+              ! compute depth at which ice lies:
+              val=MONS_d21(i,j)*MONS_coeff
+              ! compute val2= the diurnal skin depth of surface inertia
+              ! assuming a volumetric heat cap. of C=1.e6 J.m-3.K-1
+              val2=ith(i,j,1)*1.e-6*sqrt(88775./3.14159)
+              if (val.lt.val2) then
+                ! ice must be below the (surface inertia) diurnal skin depth
+                val=val2
+              endif
+              if (val.lt.layer(nsoilmx)) then ! subterranean ice
+                ! find the reference index iref that depth corresponds to
+                iref=0
+                do isoil=1,nsoilmx-1
+                 if ((val.ge.layer(isoil)).and.(val.lt.layer(isoil+1)))
+     &             then
+	           iref=isoil
+	           exit
+	         endif
+                enddo
+                ! Build "equivalent" thermal inertia for the mixed layer
+                ith(i,j,iref+1)=sqrt((layer(iref+1)-layer(iref))/
+     &                     (((val-layer(iref))/(ith(i,j,iref+1)**2))+
+     &                      ((layer(iref+1)-val)/(iceith)**2)))
+	        ! Set thermal inertia of lower layers
+                do isoil=iref+2,nsoilmx
+                  ith(i,j,isoil)=iceith 
+                enddo
+              endif ! of if (val.lt.layer(nsoilmx))
+            endif ! of if (MONS_Hdn(i,j).lt.14.0)
+          enddo ! do j=1,jjp1
+        enddo ! do i=1,iip1
+        
+! Check:
+!         do i=1,iip1
+!           do j=1,jjp1
+!             do isoil=1,nsoilmx
+!               write(77,*) i,j,isoil,"  ",ith(i,j,isoil)
+!             enddo
+!           enddo
+!	 enddo
+
+        ! recast ith() into ithfi()
+        CALL gr_dyn_fi(nsoilmx,iip1,jjp1,ngridmx,ith,ithfi)
+        
+	else
+          write(*,*) '       Unknown (misspelled?) option!!!'
+        end if ! of if (trim(modif) .eq. '...') elseif ...
+	
+       enddo ! of do ! infinite loop on liste of changes
+
+ 999  continue
+
+ 
+c=======================================================================
+c   Correct pressure on the new grid (menu 0)
+c=======================================================================
+
+      if (choix_1.eq.0) then
+        r = 1000.*8.31/mugaz
+
+        do j=1,jjp1
+          do i=1,iip1
+             ps(i,j) = ps(i,j) * 
+     .            exp((phisold_newgrid(i,j)-phis(i,j)) /
+     .                                  (t(i,j,1) * r))
+          end do
+        end do
+  
+c periodicity of surface ps in longitude
+        do j=1,jjp1
+          ps(1,j) = ps(iip1,j)
+        end do
+      end if
+
+c=======================================================================
+c=======================================================================
+
+c=======================================================================
+c    Initialisation de la physique / ecriture de newstartfi :
+c=======================================================================
+
+
+      CALL inifilr 
+      CALL pression(ip1jmp1, ap, bp, ps, p3d)
+
+c-----------------------------------------------------------------------
+c   Initialisation  pks:
+c-----------------------------------------------------------------------
+
+      CALL exner_hyb(ip1jmp1, ps, p3d, beta, pks, pk, pkf)
+! Calcul de la temperature potentielle teta
+
+      if (flagiso) then
+          DO l=1,llm
+             DO j=1,jjp1
+                DO i=1,iim
+                   teta(i,j,l) = Tiso * cpp/pk(i,j,l)
+                ENDDO
+                teta (iip1,j,l)= teta (1,j,l)
+             ENDDO
+          ENDDO
+      else if (choix_1.eq.0) then
+         DO l=1,llm
+            DO j=1,jjp1
+               DO i=1,iim
+                  teta(i,j,l) = t(i,j,l) * cpp/pk(i,j,l)
+               ENDDO
+               teta (iip1,j,l)= teta (1,j,l)
+            ENDDO
+         ENDDO
+      endif
+
+C Calcul intermediaire
+c
+      if (choix_1.eq.0) then
+         CALL massdair( p3d, masse  )
+c
+         print *,' ALPHAX ',alphax
+
+         DO  l = 1, llm
+           DO  i    = 1, iim
+             xppn(i) = aire( i, 1   ) * masse(  i     ,  1   , l )
+             xpps(i) = aire( i,jjp1 ) * masse(  i     , jjp1 , l )
+           ENDDO
+             xpn      = SUM(xppn)/apoln
+             xps      = SUM(xpps)/apols
+           DO i   = 1, iip1
+             masse(   i   ,   1     ,  l )   = xpn
+             masse(   i   ,   jjp1  ,  l )   = xps
+           ENDDO
+         ENDDO
+      endif
+      phis(iip1,:) = phis(1,:)
+
+c      CALL inidissip ( lstardis, nitergdiv, nitergrot, niterh,
+c     *                tetagdiv, tetagrot , tetatemp  )
+      itau=0
+      if (choix_1.eq.0) then
+         day_ini=int(date)
+         hour_ini=date-int(date)
+      endif
+c
+      CALL geopot  ( ip1jmp1, teta  , pk , pks,  phis  , phi   )
+
+      CALL caldyn0( itau,ucov,vcov,teta,ps,masse,pk,phis ,
+     *                phi,w, pbaru,pbarv,day_ini+time )
+c     CALL caldyn
+c    $  ( itau,ucov,vcov,teta,ps,masse,pk,pkf,phis ,
+c    $    phi,conser,du,dv,dteta,dp,w, pbaru,pbarv, day_ini )
+
+      CALL dynredem0("restart.nc",day_ini,phis)
+      CALL dynredem1("restart.nc",hour_ini,vcov,ucov,teta,q,
+     .               masse,ps)
+C
+C Ecriture etat initial physique
+C
+
+      call physdem0("restartfi.nc",lonfi,latfi,nsoilmx,ngridmx,llm,
+     .              nqtot,dtphys,real(day_ini),0.0,
+     .              airefi,albfi,ithfi,zmea,zstd,zsig,zgam,zthe)
+      call physdem1("restartfi.nc",nsoilmx,ngridmx,llm,nqtot,
+     .              dtphys,hour_ini,
+     .              tsurf,tsoil,co2ice,emis,q2,qsurf,tauscaling)
+
+c=======================================================================
+c	Formats 
+c=======================================================================
+
+   1  FORMAT(//10x,'la valeur de im =',i4,2x,'lue sur le fichier de dema
+     *rrage est differente de la valeur parametree iim =',i4//)
+   2  FORMAT(//10x,'la valeur de jm =',i4,2x,'lue sur le fichier de dema
+     *rrage est differente de la valeur parametree jjm =',i4//)
+   3  FORMAT(//10x,'la valeur de lllm =',i4,2x,'lue sur le fichier demar
+     *rage est differente de la valeur parametree llm =',i4//)
+
+      write(*,*) "newstart: All is well that ends well."
+
+      end
+
+!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!
+      subroutine load_MONS_data(MONS_Hdn,MONS_d21)
+      implicit none
+      ! routine to load Benedicte Diez MONS dataset, fill in date in southern
+      ! polar region, and interpolate the result onto the GCM grid
+#include"dimensions.h"
+#include"paramet.h"
+#include"datafile.h"
+#include"comgeom.h"
+      ! arguments:
+      real,intent(out) :: MONS_Hdn(iip1,jjp1) ! Hdn: %WEH=Mass fraction of H2O
+      real,intent(out) :: MONS_d21(iip1,jjp1) ! ice table "depth" (in kg/m2)
+      ! N.B MONS datasets should be of dimension (iip1,jjp1)
+      ! local variables:
+      character(len=88) :: filename="results_MONS_lat_lon_H_depth.txt"
+      character(len=88) :: txt ! to store some text
+      integer :: ierr,i,j
+      integer,parameter :: nblon=180 ! number of longitudes of MONS datasets
+      integer,parameter :: nblat=90 ! number of latitudes of MONS datasets
+      real :: pi
+      real :: longitudes(nblon) ! MONS dataset longitudes
+      real :: latitudes(nblat)  ! MONS dataset latitudes
+      ! MONS dataset: mass fraction of H2O where H is assumed to be in H2O
+      real :: Hdn(nblon,nblat)
+      real :: d21(nblon,nblat)! MONS dataset "depth" (g/cm2)
+
+      ! Extended MONS dataset (for interp_horiz)
+      real :: Hdnx(nblon+1,nblat)
+      real :: d21x(nblon+1,nblat)
+      real :: lon_bound(nblon+1) ! longitude boundaries
+      real :: lat_bound(nblat-1) ! latitude boundaries
+
+      ! 1. Initializations:
+
+      write(*,*) "Loading MONS data"
+
+      ! Open MONS datafile:
+      open(42,file=trim(datafile)//"/"//trim(filename),
+     &     status="old",iostat=ierr)
+      if (ierr/=0) then
+        write(*,*) "Error in load_MONS_data:"
+        write(*,*) "Failed opening file ",
+     &             trim(datafile)//"/"//trim(filename)
+        write(*,*)'1) You can change the path to the file in '
+        write(*,*)'   file phymars/datafile.h'
+        write(*,*)'2) If necessary ',trim(filename),
+     &                 ' (and other datafiles)'
+        write(*,*)'   can be obtained online at:'
+        write(*,*)'http://www.lmd.jussieu.fr/~lmdz/planets/mars/datadir'
+        CALL ABORT
+      else ! skip first line of file (dummy read)
+         read(42,*) txt
+      endif
+
+      pi=2.*asin(1.)
+      
+      !2. Load MONS data (on MONS grid)
+      do j=1,nblat
+        do i=1,nblon
+        ! swap latitude index so latitudes go from north pole to south pole:
+          read(42,*) latitudes(nblat-j+1),longitudes(i),
+     &               Hdn(i,nblat-j+1),d21(i,nblat-j+1)
+        ! multiply d21 by 10 to convert from g/cm2 to kg/m2
+          d21(i,nblat-j+1)=d21(i,nblat-j+1)*10.0
+        enddo
+      enddo
+      close(42)
+      
+      ! there is unfortunately no d21 data for latitudes -77 to -90
+      ! so we build some by linear interpolation between values at -75
+      ! and assuming d21=0 at the pole
+      do j=84,90 ! latitudes(84)=-77 ; latitudes(83)=-75
+        do i=1,nblon
+          d21(i,j)=d21(i,83)*((latitudes(j)+90)/15.0)
+        enddo
+      enddo
+
+      ! 3. Build extended MONS dataset & boundaries (for interp_horiz)
+      ! longitude boundaries (in radians):
+      do i=1,nblon
+        ! NB: MONS data is every 2 degrees in longitude
+        lon_bound(i)=(longitudes(i)+1.0)*pi/180.0
+      enddo
+      ! extra 'modulo' value
+      lon_bound(nblon+1)=lon_bound(1)+2.0*pi
+      
+      ! latitude boundaries (in radians):
+      do j=1,nblat-1
+        ! NB: Mons data is every 2 degrees in latitude
+        lat_bound(j)=(latitudes(j)-1.0)*pi/180.0
+      enddo
+      
+      ! MONS datasets:
+      do j=1,nblat
+        Hdnx(1:nblon,j)=Hdn(1:nblon,j)
+        Hdnx(nblon+1,j)=Hdnx(1,j)
+        d21x(1:nblon,j)=d21(1:nblon,j)
+        d21x(nblon+1,j)=d21x(1,j)
+      enddo
+      
+      ! Interpolate onto GCM grid
+      call interp_horiz(Hdnx,MONS_Hdn,nblon,nblat-1,iim,jjm,1,
+     &                  lon_bound,lat_bound,rlonu,rlatv)
+      call interp_horiz(d21x,MONS_d21,nblon,nblat-1,iim,jjm,1,
+     &                  lon_bound,lat_bound,rlonu,rlatv)
+      
+      end subroutine
Index: trunk/LMDZ.MARS/libf/dynphy_lonlat/phymars/readhead_NC.F
===================================================================
--- trunk/LMDZ.MARS/libf/dynphy_lonlat/phymars/readhead_NC.F	(revision 1540)
+++ trunk/LMDZ.MARS/libf/dynphy_lonlat/phymars/readhead_NC.F	(revision 1540)
@@ -0,0 +1,233 @@
+      SUBROUTINE readhead_NC (fichnom,
+     .           day0,
+     .           phis,constR)
+
+      USE comvert_mod, ONLY: aps,bps,preff
+      USE comconst_mod, ONLY: im,jm,lllm,daysec,dtvr,
+     .			rad,omeg,g,cpp,kappa,r
+      USE temps_mod, ONLY: day_ini
+      USE ener_mod, ONLY: etot0,ptot0,ztot0,stot0,ang0
+
+      IMPLICIT none
+c======================================================================
+c Auteur(s) Z.X. Li (LMD/CNRS) date: 19930818
+c  Adaptation à Mars : Yann Wanherdrick 
+c Objet: Lecture de l etat initial pour la physique
+c======================================================================
+#include "netcdf.inc"
+c====== includes de l ancien readhead ===
+#include "dimensions.h"
+#include "paramet.h"
+#include "comgeom.h"
+
+c======================================================================
+
+      CHARACTER*(*) fichnom
+      INTEGER nbsrf !Mars nbsrf a 1 au lieu de 4
+      PARAMETER (nbsrf=1) ! nombre de sous-fractions pour une maille
+
+      INTEGER radpas
+
+      REAL xmin, xmax
+c
+      INTEGER  i
+
+c   Variables
+c
+      INTEGER length,iq
+      PARAMETER (length = 100)
+      REAL tab_cntrl(length) ! tableau des parametres du run
+      INTEGER ierr, nid, nvarid
+      CHARACTER  str3*3
+
+c
+      INTEGER day0
+      REAL phis(ip1jmp1),constR
+c
+c Ouvrir le fichier contenant l etat initial:
+c
+      ierr = NF_OPEN (fichnom, NF_NOWRITE,nid)
+      IF (ierr.NE.NF_NOERR) THEN
+        write(6,*)' Pb d''ouverture du fichier '//fichnom
+        CALL ABORT
+      ENDIF
+c
+c Lecture des parametres de controle:
+c
+      ierr = NF_INQ_VARID (nid, "controle", nvarid)
+      IF (ierr.NE.NF_NOERR) THEN
+         PRINT*, 'readhead_NC: Le champ <controle> est absent'
+         CALL abort
+      ENDIF
+#ifdef NC_DOUBLE
+      ierr = NF_GET_VAR_DOUBLE(nid, nvarid, tab_cntrl)
+#else
+      ierr = NF_GET_VAR_REAL(nid, nvarid, tab_cntrl)
+#endif
+      IF (ierr.NE.NF_NOERR) THEN
+         PRINT*, 'readhead_NC: Lecture echouee pour <controle>'
+         CALL abort
+      ENDIF
+
+
+c Info sur la Planete Mars pour la dynamique 
+      im         = tab_cntrl(1)
+      jm         = tab_cntrl(2)
+      lllm       = tab_cntrl(3)
+      day_ini    = tab_cntrl(4)
+      rad        = tab_cntrl(5)
+      omeg       = tab_cntrl(6)
+      g          = tab_cntrl(7)
+c      mugaz      = tab_cntrl(8)
+      cpp        =  744.499
+      kappa      = tab_cntrl(9)
+      daysec     = tab_cntrl(10)
+      dtvr       = tab_cntrl(11)
+      etot0      = tab_cntrl(12)
+      ptot0      = tab_cntrl(13)
+      ztot0      = tab_cntrl(14)
+      stot0      = tab_cntrl(15)
+      ang0       = tab_cntrl(16)
+c pas vrai pour diagfi, seulement pour start      preff      = tab_cntrl(18)
+      preff=610.
+      WRITE (*,*) 'readhead -     preff ' , preff 
+c
+
+      day0=day_ini
+
+      constR=kappa*cpp
+      WRITE (*,*) 'constR = ' , constR
+      r=constR
+      IF(   im.ne.iim           )  THEN
+          PRINT 1,im,iim
+          STOP
+      ELSE  IF( jm.ne.jjm       )  THEN
+          PRINT 2,jm,jjm
+          STOP
+      ELSE  IF( lllm.ne.llm     )  THEN
+          PRINT 3,lllm,llm
+          STOP
+      ENDIF
+                                                                       
+      ierr = NF_INQ_VARID (nid, "rlonu", nvarid)
+      IF (ierr .NE. NF_NOERR) THEN
+         PRINT*, "readhead_NC: Le champ <rlonu> est absent"
+         CALL abort
+      ENDIF
+#ifdef NC_DOUBLE
+      ierr = NF_GET_VAR_DOUBLE(nid, nvarid, rlonu)
+#else
+      ierr = NF_GET_VAR_REAL(nid, nvarid, rlonu)
+#endif
+      IF (ierr .NE. NF_NOERR) THEN
+         PRINT*, "readhead_NC: Lecture echouee pour <rlonu>"
+         CALL abort
+      ENDIF
+                                                                       
+      ierr = NF_INQ_VARID (nid, "rlatv", nvarid)
+      IF (ierr .NE. NF_NOERR) THEN
+         PRINT*, "readhead_NC: Le champ <rlatv> est absent"
+         CALL abort
+      ENDIF
+#ifdef NC_DOUBLE
+      ierr = NF_GET_VAR_DOUBLE(nid, nvarid, rlatv)
+#else
+      ierr = NF_GET_VAR_REAL(nid, nvarid, rlatv)
+#endif
+      IF (ierr .NE. NF_NOERR) THEN
+         PRINT*, "readhead_NC: Lecture echouee pour rlatv"
+         CALL abort
+      ENDIF
+
+      ierr = NF_GET_VAR_REAL(nid, nvarid, cv)
+      IF (ierr .NE. NF_NOERR) THEN
+         PRINT*, "readhead_NC: Lecture echouee pour <cv>"
+         CALL abort
+      ENDIF
+c
+c Lecture des aires des mailles:
+c
+      ierr = NF_INQ_VARID (nid, "aire", nvarid)
+      IF (ierr.NE.NF_NOERR) THEN
+         PRINT*, 'readhead_NC: Le champ <aire> est absent'
+         CALL abort
+      ENDIF
+#ifdef NC_DOUBLE
+      ierr = NF_GET_VAR_DOUBLE(nid, nvarid, aire)
+#else
+      ierr = NF_GET_VAR_REAL(nid, nvarid, aire)
+#endif
+      IF (ierr.NE.NF_NOERR) THEN
+         PRINT*, 'readhead_NC: Lecture echouee pour <aire>'
+         CALL abort
+      ENDIF
+      xmin = 1.0E+20
+      xmax = -1.0E+20
+      xmin = MINVAL(aire)
+      xmax = MAXVAL(aire)
+      PRINT*,'Aires des mailles <aire>:', xmin, xmax
+c
+c Lecture du geopotentiel au sol:
+c
+      ierr = NF_INQ_VARID (nid, "phisinit", nvarid)
+      IF (ierr.NE.NF_NOERR) THEN
+         PRINT*, 'readhead_NC: Le champ <phisinit> est absent'
+         CALL abort
+      ENDIF
+#ifdef NC_DOUBLE
+      ierr = NF_GET_VAR_DOUBLE(nid, nvarid, phis)
+#else
+      ierr = NF_GET_VAR_REAL(nid, nvarid, phis)
+#endif
+      IF (ierr.NE.NF_NOERR) THEN
+         PRINT*, 'readhead_NC: Lecture echouee pour <phis>'
+         CALL abort
+      ENDIF
+c      PRINT*,'READHEAD_NC  Phis:',phis
+
+      ierr = NF_INQ_VARID (nid, "aps", nvarid)
+      IF (ierr .NE. NF_NOERR) THEN
+         PRINT*, "readhead_NC: Le champ <aps> est absent"
+         CALL abort
+      ENDIF
+#ifdef NC_DOUBLE
+      ierr = NF_GET_VAR_DOUBLE(nid, nvarid, aps)
+#else
+      ierr = NF_GET_VAR_REAL(nid, nvarid, aps)
+#endif
+      IF (ierr .NE. NF_NOERR) THEN
+         PRINT*, "readhead_NC: Lecture echouee pour <aps>"
+         CALL abort
+      ENDIF
+
+      ierr = NF_INQ_VARID (nid, "bps", nvarid)
+      IF (ierr .NE. NF_NOERR) THEN
+         PRINT*, "readhead_NC: Le champ <bps> est absent"
+         CALL abort
+      ENDIF
+#ifdef NC_DOUBLE
+      ierr = NF_GET_VAR_DOUBLE(nid, nvarid, bps)
+#else
+      ierr = NF_GET_VAR_REAL(nid, nvarid, bps)
+#endif
+      IF (ierr .NE. NF_NOERR) THEN
+         PRINT*, "readhead_NC: Lecture echouee pour <bps>"
+         CALL abort
+      ENDIF
+
+   1  FORMAT(//10x,'la valeur de im =',i4,2x,'lue sur le fichier de dema
+     *rrage est differente de la valeur parametree iim =',i4//)
+   2  FORMAT(//10x,'la valeur de jm =',i4,2x,'lue sur le fichier de dema
+     *rrage est differente de la valeur parametree jjm =',i4//)
+   3  FORMAT(//10x,'la valeur de lmax =',i4,2x,'lue sur le fichier demar
+     *rage est differente de la valeur parametree llm =',i4//)
+   4  FORMAT(//10x,'la valeur de dtrv =',i4,2x,'lue sur le fichier demar
+     *rage est differente de la valeur  dtinteg =',i4//)
+
+      
+c Fermer le fichier:
+c
+      ierr = NF_CLOSE(nid)
+c
+      RETURN
+      END
Index: trunk/LMDZ.MARS/libf/dynphy_lonlat/phymars/scal_wind.F
===================================================================
--- trunk/LMDZ.MARS/libf/dynphy_lonlat/phymars/scal_wind.F	(revision 1540)
+++ trunk/LMDZ.MARS/libf/dynphy_lonlat/phymars/scal_wind.F	(revision 1540)
@@ -0,0 +1,55 @@
+      SUBROUTINE scal_wind(xus,xvs,xu,xv)
+c=======================================================================
+c
+c
+c   Subject:
+c   ------
+c On passe  les variable xus, xvs  aux points de vent u et v (xu et xv)
+c
+c=======================================================================
+      IMPLICIT NONE
+c-----------------------------------------------------------------------
+c   Declararations:
+c   ---------------
+
+#include "dimensions.h"
+#include "paramet.h"
+#include "comgeom.h"
+
+c   Arguments:
+c   ----------
+
+      REAL xu(iip1,jjp1,llm),xv(iip1,jjm,llm)
+      REAL xus(iip1,jjp1,llm), xvs (iip1,jjp1,llm)
+
+c   Local:
+c   ------
+
+      INTEGER i,j,l
+
+c-----------------------------------------------------------------------
+
+c   transport zonal:
+c   ----------------
+      DO l=1,llm
+        Do j=1,jjp1
+	      DO i=1,iim
+            xu(i,j,l)=0.5*(xus(i,j,l)+xus(i+1,j,l))
+	      ENDDO
+          xu(iip1,j,l)=xu(1,j,l)
+	    ENDDO
+      ENDDO
+
+
+c   Transport meridien:
+c   -------------------
+      DO l=1,llm
+         DO j=1,jjm
+           do i=1 ,iip1
+	         xv(i,j,l)=.5*(xvs(i,j,l)+xvs(i,j+1,l))
+           end do
+	     ENDDO
+	  ENDDO
+
+      RETURN
+      END
Index: trunk/LMDZ.MARS/libf/dynphy_lonlat/phymars/sponge.h
===================================================================
--- trunk/LMDZ.MARS/libf/dynphy_lonlat/phymars/sponge.h	(revision 1540)
+++ trunk/LMDZ.MARS/libf/dynphy_lonlat/phymars/sponge.h	(revision 1540)
@@ -0,0 +1,1 @@
+link ../../dyn3d/sponge.h
Index: trunk/LMDZ.MARS/libf/dynphy_lonlat/phymars/start2archive.F
===================================================================
--- trunk/LMDZ.MARS/libf/dynphy_lonlat/phymars/start2archive.F	(revision 1540)
+++ trunk/LMDZ.MARS/libf/dynphy_lonlat/phymars/start2archive.F	(revision 1540)
@@ -0,0 +1,414 @@
+c=======================================================================
+      PROGRAM start2archive
+c=======================================================================
+c
+c
+c   Date:    01/1997
+c   ----
+c
+c
+c   Objet:   Passage des  fichiers netcdf d'etat initial "start" et
+c   -----    "startfi" a un fichier netcdf unique "start_archive" 
+c
+c  "start_archive" est une banque d'etats initiaux:
+c  On peut stocker plusieurs etats initiaux dans un meme fichier "start_archive"
+c    (Veiller dans ce cas avoir un day_ini different pour chacun des start)
+c 
+c
+c
+c=======================================================================
+
+      use infotrac, only: infotrac_init, nqtot, tname
+      use comsoil_h, only: nsoilmx, inertiedat
+      use surfdat_h, only: ini_surfdat_h, qsurf
+      use comsoil_h, only: ini_comsoil_h
+      use comgeomphy, only: initcomgeomphy
+      use filtreg_mod, only: inifilr
+      use control_mod, only: planet_type
+      USE comvert_mod, ONLY: ap,bp
+      USE comconst_mod, ONLY: g,cpp
+      USE logic_mod, ONLY: grireg
+      USE temps_mod, ONLY: day_ini,hour_ini
+      implicit none
+
+#include "dimensions.h"
+      integer, parameter :: ngridmx = (2+(jjm-1)*iim - 1/jjm) 
+#include "paramet.h"
+#include "comdissip.h"
+#include "comgeom.h"
+#include "netcdf.inc"
+
+c-----------------------------------------------------------------------
+c   Declarations
+c-----------------------------------------------------------------------
+
+c variables dynamiques du GCM
+c -----------------------------
+      REAL vcov(ip1jm,llm),ucov(ip1jmp1,llm) ! vents covariants
+      REAL teta(ip1jmp1,llm)                    ! temperature potentielle 
+      REAL,ALLOCATABLE :: q(:,:,:)   ! champs advectes
+      REAL pks(ip1jmp1)                      ! exner (f pour filtre)
+      REAL pk(ip1jmp1,llm)
+      REAL pkf(ip1jmp1,llm)
+      REAL beta(iip1,jjp1,llm)
+      REAL phis(ip1jmp1)                     ! geopotentiel au sol
+      REAL masse(ip1jmp1,llm)                ! masse de l'atmosphere
+      REAL ps(ip1jmp1)                       ! pression au sol
+      REAL p3d(iip1, jjp1, llm+1)            ! pression aux interfaces
+      
+c Variable Physiques (grille physique)
+c ------------------------------------
+      REAL tsurf(ngridmx)	! Surface temperature
+      REAL tsoil(ngridmx,nsoilmx) ! Soil temperature
+      REAL co2ice(ngridmx)	! CO2 ice layer
+      REAL tauscaling(ngridmx) ! dust conversion factor
+      REAL q2(ngridmx,llm+1)
+      REAL emis(ngridmx)
+      INTEGER start,length
+      PARAMETER (length = 100)
+      REAL tab_cntrl_fi(length) ! tableau des parametres de startfi
+      INTEGER*4 day_ini_fi
+
+c Variable naturelle / grille scalaire
+c ------------------------------------
+      REAL T(ip1jmp1,llm),us(ip1jmp1,llm),vs(ip1jmp1,llm)
+      REAL tsurfS(ip1jmp1)
+      REAL tsoilS(ip1jmp1,nsoilmx)
+      REAL ithS(ip1jmp1,nsoilmx) ! Soil Thermal Inertia
+      REAL co2iceS(ip1jmp1)
+      REAL tauscalingS(ip1jmp1)
+      REAL q2S(ip1jmp1,llm+1)
+      REAL,ALLOCATABLE :: qsurfS(:,:)
+      REAL emisS(ip1jmp1)
+
+c Variables intermediaires : vent naturel, mais pas coord scalaire
+c----------------------------------------------------------------
+      REAL vn(ip1jm,llm),un(ip1jmp1,llm)
+
+c Autres  variables
+c -----------------
+      LOGICAL startdrs
+      INTEGER Lmodif
+
+      REAL ptotal, co2icetotal
+      REAL timedyn,timefi !fraction du jour dans start, startfi
+      REAL date
+
+      CHARACTER*2 str2
+      CHARACTER*80 fichier 
+      data  fichier /'startfi'/
+
+      INTEGER ij, l,i,j,isoil,iq
+      character*80      fichnom
+      integer :: ierr,ntime
+      integer :: nq,numvanle
+      character(len=30) :: txt ! to store some text
+
+c Netcdf
+c-------
+      integer varid,dimid,timelen 
+      INTEGER nid,nid1
+
+c-----------------------------------------------------------------------
+c   Initialisations 
+c-----------------------------------------------------------------------
+
+      CALL defrun_new(99, .TRUE. )
+      grireg   = .TRUE.
+! initialize "serial/parallel" related stuff
+      CALL init_phys_lmdz(iim,jjp1,llm,1,(/(jjm-1)*iim+2/))
+      call initcomgeomphy
+      planet_type='mars'
+
+c=======================================================================
+c Lecture des donnees
+c=======================================================================
+! Load tracer number and names:
+!      call iniadvtrac(nqtot,numvanle)
+      call infotrac_init
+
+! allocate arrays:
+      allocate(q(ip1jmp1,llm,nqtot))
+      allocate(qsurfS(ip1jmp1,nqtot))
+      call ini_surfdat_h(ngridmx,nqtot)
+      call ini_comsoil_h(ngridmx)
+      
+
+      fichnom = 'start.nc'
+      CALL dynetat0(fichnom,vcov,ucov,teta,q,masse,
+     .       ps,phis,timedyn)
+
+
+      fichnom = 'startfi.nc'
+      Lmodif=0
+
+      CALL phyetat0 (fichnom,0,Lmodif,nsoilmx,ngridmx,llm,nqtot,
+     &      day_ini_fi,timefi,tsurf,tsoil,emis,q2,qsurf,co2ice,
+     &      tauscaling)
+
+       ierr = NF_OPEN (fichnom, NF_NOWRITE,nid1)
+       IF (ierr.NE.NF_NOERR) THEN
+         write(6,*)' Pb d''ouverture du fichier'//fichnom
+        CALL ABORT
+       ENDIF
+                                                
+      ierr = NF_INQ_VARID (nid1, "controle", varid)
+      IF (ierr .NE. NF_NOERR) THEN
+       PRINT*, "start2archive: Le champ <controle> est absent"
+       CALL abort
+      ENDIF
+#ifdef NC_DOUBLE
+       ierr = NF_GET_VAR_DOUBLE(nid1, varid, tab_cntrl_fi)
+#else
+      ierr = NF_GET_VAR_REAL(nid1, varid, tab_cntrl_fi)
+#endif
+       IF (ierr .NE. NF_NOERR) THEN
+          PRINT*, "start2archive: Lecture echoue pour <controle>"
+          CALL abort
+       ENDIF
+
+      ierr = NF_CLOSE(nid1)
+
+c-----------------------------------------------------------------------
+c Controle de la synchro
+c-----------------------------------------------------------------------
+!mars a voir      if ((day_ini_fi.ne.day_ini).or.(abs(timefi-timedyn).gt.1.e-10)) 
+      if ((day_ini_fi.ne.day_ini)) 
+     &  stop ' Probleme de Synchro entre start et startfi !!!'
+
+
+c *****************************************************************
+c    Option : Reinitialisation des dates dans la premieres annees :
+       do while (day_ini.ge.669)
+          day_ini=day_ini-669
+       enddo
+c *****************************************************************
+
+c-----------------------------------------------------------------------
+c   Initialisations 
+c-----------------------------------------------------------------------
+
+      CALL defrun_new(99, .FALSE. )
+      call iniconst
+      call inigeom
+      call inifilr
+      CALL pression(ip1jmp1, ap, bp, ps, p3d)
+      call exner_hyb(ip1jmp1, ps, p3d, beta, pks, pk, pkf)
+
+c=======================================================================
+c Transformation EN VARIABLE NATURELLE / GRILLE SCALAIRE si necessaire
+c=======================================================================
+c  Les variables modeles dependent de la resolution. Il faut donc
+c  eliminer les facteurs responsables de cette dependance
+c  (pour utiliser newstart)
+c=======================================================================
+
+c-----------------------------------------------------------------------
+c Vent   (depend de la resolution horizontale) 
+c-----------------------------------------------------------------------
+c
+c ucov --> un  et  vcov --> vn
+c un --> us  et   vn --> vs
+c
+c-----------------------------------------------------------------------
+
+      call covnat(llm,ucov, vcov, un, vn) 
+      call wind_scal(un,vn,us,vs) 
+
+c-----------------------------------------------------------------------
+c Temperature  (depend de la resolution verticale => de "sigma.def")
+c-----------------------------------------------------------------------
+c
+c h --> T
+c
+c-----------------------------------------------------------------------
+
+      DO l=1,llm
+         DO ij=1,ip1jmp1
+            T(ij,l)=teta(ij,l)*pk(ij,l)/cpp !mars deduit de l'equation dans newstart
+         ENDDO
+      ENDDO
+
+c-----------------------------------------------------------------------
+c Variable physique 
+c-----------------------------------------------------------------------
+c
+c tsurf --> tsurfS
+c co2ice --> co2iceS
+c tsoil --> tsoilS
+c emis --> emisS
+c q2 --> q2S
+c qsurf --> qsurfS
+c tauscaling --> tauscalingS
+c
+c-----------------------------------------------------------------------
+
+      call gr_fi_dyn(1,ngridmx,iip1,jjp1,tsurf,tsurfS)
+      call gr_fi_dyn(1,ngridmx,iip1,jjp1,co2ice,co2iceS)
+      call gr_fi_dyn(nsoilmx,ngridmx,iip1,jjp1,tsoil,tsoilS)
+      ! Note: thermal inertia "inertiedat" is in comsoil.h
+      call gr_fi_dyn(nsoilmx,ngridmx,iip1,jjp1,inertiedat,ithS)
+      call gr_fi_dyn(1,ngridmx,iip1,jjp1,emis,emisS)
+      call gr_fi_dyn(llm+1,ngridmx,iip1,jjp1,q2,q2S)
+      call gr_fi_dyn(nqtot,ngridmx,iip1,jjp1,qsurf,qsurfS)
+      call gr_fi_dyn(1,ngridmx,iip1,jjp1,tauscaling,tauscalingS)
+
+c=======================================================================
+c Info pour controler
+c=======================================================================
+
+      ptotal =  0.
+      co2icetotal = 0.
+      DO j=1,jjp1
+         DO i=1,iim
+           ptotal=ptotal+aire(i+(iim+1)*(j-1))*ps(i+(iim+1)*(j-1))/g
+           co2icetotal = co2icetotal + 
+     &            co2iceS(i+(iim+1)*(j-1))*aire(i+(iim+1)*(j-1))
+         ENDDO
+      ENDDO
+      write(*,*)'Ancienne grille : masse de l''atm :',ptotal
+      write(*,*)'Ancienne grille : masse de la glace CO2 :',co2icetotal
+
+c-----------------------------------------------------------------------
+c Passage de "ptotal" et "co2icetotal" par tab_cntrl_fi
+c-----------------------------------------------------------------------
+
+      tab_cntrl_fi(49) = ptotal
+      tab_cntrl_fi(50) = co2icetotal
+
+c=======================================================================
+c Ecriture dans le fichier  "start_archive"
+c=======================================================================
+
+c-----------------------------------------------------------------------
+c Ouverture de "start_archive" 
+c-----------------------------------------------------------------------
+
+      ierr = NF_OPEN ('start_archive.nc', NF_WRITE,nid)
+ 
+c-----------------------------------------------------------------------
+c  si "start_archive" n'existe pas:
+c    1_ ouverture
+c    2_ creation de l'entete dynamique ("ini_archive")
+c-----------------------------------------------------------------------
+c ini_archive:
+c On met dans l'entete le tab_cntrl dynamique (1 a 16) 
+c  On y ajoute les valeurs du tab_cntrl_fi (a partir de 51)
+c  En plus les deux valeurs ptotal et co2icetotal (99 et 100)
+c-----------------------------------------------------------------------
+
+      if (ierr.ne.NF_NOERR) then
+         write(*,*)'OK, Could not open file "start_archive.nc"'
+         write(*,*)'So let s create a new "start_archive"'
+         ierr = NF_CREATE('start_archive.nc', 
+     &  IOR(NF_CLOBBER,NF_64BIT_OFFSET), nid)
+         call ini_archive(nid,day_ini,phis,ithS,tab_cntrl_fi)
+      endif
+
+c-----------------------------------------------------------------------
+c Ecriture de la coordonnee temps (date en jours)
+c-----------------------------------------------------------------------
+
+      date = day_ini + hour_ini
+      ierr= NF_INQ_VARID(nid,"Time",varid)
+      ierr= NF_INQ_DIMID(nid,"Time",dimid)
+      ierr= NF_INQ_DIMLEN(nid,dimid,timelen)
+      ntime=timelen+1
+
+      write(*,*) "******************"
+      write(*,*) "ntime",ntime
+      write(*,*) "******************"
+#ifdef NC_DOUBLE
+      ierr= NF_PUT_VARA_DOUBLE(nid,varid,ntime,1,date)
+#else
+      ierr= NF_PUT_VARA_REAL(nid,varid,ntime,1,date)
+#endif
+      if (ierr.ne.NF_NOERR) then
+         write(*,*) "time matter ",NF_STRERROR(ierr)
+         stop
+      endif
+
+c-----------------------------------------------------------------------
+c Ecriture des champs  (co2ice,emis,ps,Tsurf,T,u,v,q2,q,qsurf)
+c-----------------------------------------------------------------------
+c ATTENTION: q2 a une couche de plus!!!!
+c    Pour creer un fichier netcdf lisible par grads,
+c    On passe donc une des couches de q2 a part
+c    comme une variable 2D (la couche au sol: "q2surf")
+c    Les lmm autres couches sont nommees "q2atm" (3D) 
+c-----------------------------------------------------------------------
+
+      call write_archive(nid,ntime,'co2ice','couche de glace co2',
+     &  'kg/m2',2,co2iceS)
+      call write_archive(nid,ntime,'tauscaling',
+     &  'dust conversion factor',' ',2,tauscalingS)
+      call write_archive(nid,ntime,'emis','grd emis',' ',2,emisS)
+      call write_archive(nid,ntime,'ps','Psurf','Pa',2,ps)
+      call write_archive(nid,ntime,'tsurf','surf T','K',2,tsurfS)
+      call write_archive(nid,ntime,'temp','temperature','K',3,t)
+      call write_archive(nid,ntime,'u','Vent zonal','m.s-1',3,us)
+      call write_archive(nid,ntime,'v','Vent merid','m.s-1',3,vs)
+      call write_archive(nid,ntime,'q2surf','wind variance','m2.s-2',2,
+     .              q2S)
+      call write_archive(nid,ntime,'q2atm','wind variance','m2.s-2',3,
+     .              q2S(1,2))
+
+c-----------------------------------------------------------------------
+c Ecriture du champs  q  ( q[1,nqtot] )
+c-----------------------------------------------------------------------
+      do iq=1,nqtot
+c       write(str2,'(i2.2)') iq
+c        call write_archive(nid,ntime,'q'//str2,'tracer','kg/kg',
+c     .         3,q(1,1,iq))
+        call write_archive(nid,ntime,tname(iq),'tracer','kg/kg',
+     &         3,q(1,1,iq))
+      end do
+c-----------------------------------------------------------------------
+c Ecriture du champs  qsurf  ( qsurf[1,nqtot] )
+c-----------------------------------------------------------------------
+      do iq=1,nqtot
+c       write(str2,'(i2.2)') iq
+c       call write_archive(nid,ntime,'qsurf'//str2,'Tracer on surface',
+c     $  'kg.m-2',2,qsurfS(1,iq))
+        txt=trim(tname(iq))//"_surf"
+        call write_archive(nid,ntime,txt,'Tracer on surface',
+     &  'kg.m-2',2,qsurfS(1,iq))
+      enddo
+
+
+c-----------------------------------------------------------------------
+c Ecriture du champs  tsoil  ( Tg[1,10] )
+c-----------------------------------------------------------------------
+c "tsoil" Temperature au sol definie dans 10 couches dans le sol
+c   Les 10 couches sont lues comme 10 champs 
+c  nommees Tg[1,10]
+
+c      do isoil=1,nsoilmx
+c       write(str2,'(i2.2)') isoil
+c       call write_archive(nid,ntime,'Tg'//str2,'Ground Temperature ',
+c     .   'K',2,tsoilS(1,isoil))
+c      enddo
+
+! Write soil temperatures tsoil
+      call write_archive(nid,ntime,'tsoil','Soil temperature',
+     &     'K',-3,tsoilS)
+
+! Write soil thermal inertia
+      call write_archive(nid,ntime,'inertiedat',
+     &     'Soil thermal inertia',
+     &     'J.s-1/2.m-2.K-1',-3,ithS)
+
+! Write (0D) volumetric heat capacity (stored in comsoil.h)
+!      call write_archive(nid,ntime,'volcapa',
+!     &     'Soil volumetric heat capacity',
+!     &     'J.m-3.K-1',0,volcapa)
+! Note: no need to write volcapa, it is stored in "controle" table
+
+      ierr=NF_CLOSE(nid)
+c-----------------------------------------------------------------------
+c Fin 
+c-----------------------------------------------------------------------
+
+      write(*,*) "startarchive: all is well that ends well"
+      
+      end 
Index: trunk/LMDZ.MARS/libf/dynphy_lonlat/phymars/wind_scal.F
===================================================================
--- trunk/LMDZ.MARS/libf/dynphy_lonlat/phymars/wind_scal.F	(revision 1540)
+++ trunk/LMDZ.MARS/libf/dynphy_lonlat/phymars/wind_scal.F	(revision 1540)
@@ -0,0 +1,55 @@
+      SUBROUTINE wind_scal(pbaru,pbarv,us,vs)
+c=======================================================================
+c
+c
+c   Subject:
+c   ------
+c   On ramene les flux de masse /vents  aux points scalaires.
+c
+c=======================================================================
+      IMPLICIT NONE
+c-----------------------------------------------------------------------
+c   Declararations:
+c   ---------------
+
+#include "dimensions.h"
+#include "paramet.h"
+#include "comgeom.h"
+
+c   Arguments:
+c   ----------
+
+      REAL pbaru(ip1jmp1,llm),pbarv(ip1jm,llm)
+      REAL us(ip1jmp1,llm), vs (ip1jmp1,llm)
+
+c   Local:
+c   ------
+
+      INTEGER ij,l
+
+c-----------------------------------------------------------------------
+
+c   transport zonal:
+c   ----------------
+      DO l=1,llm
+	 DO ij=2,ip1jmp1
+            us(ij,l)=.5*(pbaru(ij,l)+pbaru(ij-1,l))
+	 ENDDO
+      ENDDO
+      CALL SCOPY(jjp1*llm,us(iip1,1),iip1,us(1,1),iip1)
+
+
+c   Transport meridien:
+c   -------------------
+      DO l=1,llm
+         DO ij=iip2,ip1jm
+	    vs(ij,l)=.5*(pbarv(ij,l)+pbarv(ij-iip1,l))
+	 ENDDO
+	 DO ij=1,iip1
+	    vs(ij,l)=0.
+	    vs(ip1jm+ij,l)=0.
+	 ENDDO
+      ENDDO
+
+      RETURN
+      END
Index: trunk/LMDZ.MARS/libf/dynphy_lonlat/phymars/write_archive.F
===================================================================
--- trunk/LMDZ.MARS/libf/dynphy_lonlat/phymars/write_archive.F	(revision 1540)
+++ trunk/LMDZ.MARS/libf/dynphy_lonlat/phymars/write_archive.F	(revision 1540)
@@ -0,0 +1,249 @@
+c=======================================================================
+      subroutine write_archive(nid,ntime,nom,titre,unite,dim,px)
+c=======================================================================
+c
+c
+c   Date:    01/1997
+c   ----
+c
+c   Objet:   Ecriture de champs sur grille scalaire (iip1*jjp1)
+c   -----    dans un fichier DRS nomme "start_archive"
+c
+c    Il faut au prealable avoir cree un entete avec un "call ini_archive".
+c    Ces variables peuvent etre 3d (ex: temperature), 2d (ex: temperature
+c    de surface), ou 0d (pour un scalaire qui ne depend que du temps)
+c    (ex: la longitude solaire)
+c
+c
+c   Arguments: 
+c   ----------
+c
+c     Inputs:
+c     ------
+c
+c		  nid      Unite logique du fichier "start_archive"
+c         nom      nom du champ a ecrire dans le fichier "start_archive"
+c         titre    titre de la variable dans le fichier DRS "start_archive"
+c         unite    unite de la variable ....
+c         dim      dimension de la variable a ecrire
+c         px       tableau contenant la variable a ecrire
+c
+c
+c=======================================================================
+
+      use comsoil_h, only: nsoilmx
+      implicit none
+
+#include "dimensions.h"
+#include "paramet.h"
+!#include "control.h"
+#include "comgeom.h"
+#include "netcdf.inc"
+
+c-----------------------------------------------------------------------
+c	Declarations   
+c-----------------------------------------------------------------------
+
+c Arguments:
+
+      INTEGER nid
+      integer ntime ! time index
+      integer dim 
+      REAL px(iip1,jjp1,llm) 
+
+      CHARACTER*(*) nom, titre, unite
+
+      integer ierr
+
+
+c local
+      integer, dimension(4) :: edges,corner,id
+      integer :: varid,i,j,l
+c-----------------------------------------------------------------------
+c      Ecriture du champs dans le fichier            (3 cas)      
+c-----------------------------------------------------------------------
+
+! For an atmospheric 3D Variable
+!--------------------------------
+        if (dim.eq.3) then
+
+!         Ecriture du champs
+
+! nom de la variable
+           ierr= NF_INQ_VARID(nid,nom,varid)
+           if (ierr /= NF_NOERR) then
+! choix du nom des coordonnees
+              ierr= NF_INQ_DIMID(nid,"longitude",id(1))
+              ierr= NF_INQ_DIMID(nid,"latitude",id(2))
+              ierr= NF_INQ_DIMID(nid,"altitude",id(3))
+              ierr= NF_INQ_DIMID(nid,"Time",id(4))
+
+! Creation de la variable si elle n'existait pas
+
+              write (*,*) "====================="
+              write (*,*) "creation de ",nom
+              call def_var(nid,nom,titre,unite,4,id,varid,ierr)
+
+           endif
+
+! mars s'arranger pour qu'il n'y ai plus besoin de ca
+
+c          do l=1,llm
+c             do j=1,jjp1
+c                do i=1,iip1
+c                   pxbis(i,j,l)=px(i,j,llm-l+1)
+c                enddo
+c             enddo
+c          enddo
+           corner(1)=1
+           corner(2)=1
+           corner(3)=1
+           corner(4)=ntime
+
+           edges(1)=iip1
+           edges(2)=jjp1
+           edges(3)=llm
+           edges(4)=1
+#ifdef NC_DOUBLE
+           ierr= NF_PUT_VARA_DOUBLE(nid,varid,corner,edges,px)
+#else
+           ierr= NF_PUT_VARA_REAL(nid,varid,corner,edges,px)
+#endif
+
+           if (ierr.ne.NF_NOERR) then
+              write(*,*) "***** PUT_VAR matter in write_archive"
+              write(*,*) "***** with ",nom," ",nf_STRERROR(ierr)
+              call abort
+           endif
+
+
+! For a subterranean 3D Variable
+!-------------------------------
+
+        else if (dim.eq.-3) then
+	! get variables' ID, if it exists
+	ierr=NF_INQ_VARID(nid,nom,varid)
+	
+	 if (ierr.ne.NF_NOERR) then ! variable not defined yet
+	  ! build related coordinates
+	  ierr=NF_INQ_DIMID(nid,"longitude",id(1))
+	  ierr=NF_INQ_DIMID(nid,"latitude",id(2))
+	  ierr=NF_INQ_DIMID(nid,"subsurface_layers",id(3))
+	  if (ierr.ne.NF_NOERR) then
+	   write(*,*)"write_archive: dimension <subsurface_layers>",
+     &               " is missing !!!"
+	   call abort
+	  endif
+          ierr=NF_INQ_DIMID(nid,"Time",id(4))
+	  
+	  ! define the variable
+	  write(*,*)"====================="
+	  write(*,*)"defining ",nom
+	  call def_var(nid,nom,titre,unite,4,id,varid,ierr)
+	  
+	 endif
+
+        ! build cedges and corners
+        corner(1)=1
+        corner(2)=1
+        corner(3)=1
+        corner(4)=ntime
+
+        edges(1)=iip1
+        edges(2)=jjp1
+        edges(3)=nsoilmx
+        edges(4)=1
+#ifdef NC_DOUBLE
+           ierr= NF_PUT_VARA_DOUBLE(nid,varid,corner,edges,px)
+#else
+           ierr= NF_PUT_VARA_REAL(nid,varid,corner,edges,px)
+#endif
+
+
+! For a surface 2D Variable
+!--------------------------
+
+        else if (dim.eq.2) then
+
+!         Ecriture du champs
+
+           ierr= NF_INQ_VARID(nid,nom,varid)
+           if (ierr /= NF_NOERR) then
+!  choix du nom des coordonnees
+              ierr= NF_INQ_DIMID(nid,"longitude",id(1))
+              ierr= NF_INQ_DIMID(nid,"latitude",id(2))
+              ierr= NF_INQ_DIMID(nid,"Time",id(3))
+
+! Creation de la variable si elle n'existait pas
+
+              write (*,*) "====================="
+              write (*,*) "creation de ",nom
+
+              call def_var(nid,nom,titre,unite,3,id,varid,ierr)
+
+           endif
+
+           corner(1)=1
+           corner(2)=1
+           corner(3)=ntime
+           edges(1)=iip1
+           edges(2)=jjp1
+           edges(3)=1
+
+
+#ifdef NC_DOUBLE
+           ierr = NF_PUT_VARA_DOUBLE (nid,varid,corner,edges,px)
+#else         
+           ierr= NF_PUT_VARA_REAL(nid,varid,corner,edges,px)
+#endif     
+
+           if (ierr.ne.NF_NOERR) then
+              write(*,*) "***** PUT_VAR matter in write_archive"
+              write(*,*) "***** with ",nom,nf_STRERROR(ierr)
+              call abort
+           endif
+
+
+!Cas Variable 0D (scalaire dependant du temps)
+!---------------------------------------------
+
+        else if (dim.eq.0) then
+
+!         Ecriture du champs
+
+           ierr= NF_INQ_VARID(nid,nom,varid)
+           if (ierr /= NF_NOERR) then
+!  choix du nom des coordonnees
+              ierr= NF_INQ_DIMID(nid,"Time",id(1))
+
+! Creation de la variable si elle n'existait pas
+
+              write (*,*) "====================="
+              write (*,*) "creation de ",nom
+
+              call def_var(nid,nom,titre,unite,1,id,varid,ierr)
+
+           endif
+
+           corner(1)=ntime
+           edges(1)=1
+
+#ifdef NC_DOUBLE
+           ierr = NF_PUT_VARA_DOUBLE (nid,varid,corner,edges,px)
+#else
+           ierr= NF_PUT_VARA_REAL(nid,varid,corner,edges,px)
+#endif
+           if (ierr.ne.NF_NOERR) then
+              write(*,*) "***** PUT_VAR matter in write_archive"
+              write(*,*) "***** with ",nom,nf_STRERROR(ierr)
+              call abort
+           endif
+
+        else
+	  write(*,*) "write_archive: dim=",dim," ?!?"
+	  call abort
+        endif ! of if (dim.eq.3) else if (dim.eq.-3) ....
+
+      return
+      end
+
Index: trunk/LMDZ.MARS/libf/dynphy_lonlat/phymars/xvik.F
===================================================================
--- trunk/LMDZ.MARS/libf/dynphy_lonlat/phymars/xvik.F	(revision 1540)
+++ trunk/LMDZ.MARS/libf/dynphy_lonlat/phymars/xvik.F	(revision 1540)
@@ -0,0 +1,542 @@
+      PROGRAM xvik
+
+      USE filtreg_mod, ONLY: inifilr
+      USE comconst_mod, ONLY: dtvr,g,r,pi
+
+      IMPLICIT NONE
+c=======================================================================
+c
+c  Pression au site Viking
+c
+c=======================================================================
+c-----------------------------------------------------------------------
+c   declarations:
+c   -------------
+
+
+#include "dimensions.h"
+#include "paramet.h"
+#include "comdissip.h"
+#include "comgeom2.h"
+!#include "control.h"
+#include "netcdf.inc"      
+
+
+      INTEGER itau,nbpas,nbpasmx
+      PARAMETER(nbpasmx=1000000)
+      REAL temps(nbpasmx)
+      INTEGER unitlec
+      INTEGER i,j,l,jj
+      REAL constR
+
+c   Declarations NCDF:
+c   -----------------
+      CHARACTER*100  varname
+      INTEGER ierr,nid,nvarid,dimid
+      LOGICAL nc
+      INTEGER start_ps(3),start_temp(4),start_co2ice(3)
+      INTEGER count_ps(3),count_temp(4),count_co2ice(3)
+
+c   declarations pour les points viking:
+c   ------------------------------------
+      INTEGER ivik(2),jvik(2),ifile(2),iv
+      REAL lonvik(2),latvik(2),phivik(2),phisim(2)
+      REAL unanj
+
+c   variables meteo:
+c   ----------------
+      REAL vnat(iip1,jjm,llm),unat(iip1,jjp1,llm)
+      REAL t(iip1,jjp1,llm),ps(iip1,jjp1),pstot, phis(iip1,jjp1)
+      REAL co2ice(iip1,jjp1), captotN,captotS
+      real t7(iip1,jjp1) ! temperature in 7th atmospheric layer
+
+      REAL zp1,zp2,zp2_sm,zu,zv,zw(0:1,0:1,2),zalpha,zbeta
+
+      LOGICAL firstcal,lcal,latcal,lvent,day_ls
+      INTEGER*4 day0
+
+      REAL ziceco2(iip1,jjp1)
+      REAL day,zt,sollong,sol,dayw
+      REAL airtot1,gh
+
+      INTEGER ii,iyear,kyear
+
+      CHARACTER*2 chr2
+
+       
+c   declarations de l'interface avec mywrite:
+c   -----------------------------------------
+
+      CHARACTER file*80
+      CHARACTER pathchmp*80,pathsor*80,nomfich*80
+
+c   externe:
+c   --------
+
+      EXTERNAL iniconst,inigeom,covcont,mywrite
+      EXTERNAL exner,pbar
+      EXTERNAL solarlong,coordij,moy2
+      EXTERNAL SSUM
+      REAL SSUM
+
+cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc
+
+c-----------------------------------------------------------------------
+c   initialisations:
+c   ----------------
+
+      unanj=667.9
+      print*,'WARNING!!!',unanj,'Jours/an'
+      nc=.true.
+      lcal=.true.
+      latcal=.true.
+      lvent=.false.
+      day_ls=.true.
+
+c lecture du fichier xvik.def
+
+      phivik(1)=-3627
+      phivik(2)=-4505
+
+
+
+      OPEN(99,file='xvik.def',form='formatted')
+
+      READ(99,*) 
+      READ(99,*,iostat=ierr) phivik
+      IF(ierr.NE.0) GOTO 105
+
+      READ(99,*,END=105)
+      READ(99,'(a)',END=105) pathchmp
+      READ(99,*,END=105)
+      READ(99,'(a)',END=105) pathsor
+      READ(99,*,END=105)
+c     READ(99,'(l1)',END=105) day_ls
+      READ(99,'(l1)',END=105)
+      READ(99,'(l1)',END=105) lcal
+      READ(99,'(l1)',END=105)
+      READ(99,'(l1)',END=105) lvent
+      READ(99,'(l1)',END=105)
+      READ(99,'(l1)',END=105) latcal
+ 
+ 105  CONTINUE
+      CLOSE(99)
+      write (*,*)'>>>>>>>>>>>>>>>>', phivik,g
+      DO iv=1,2
+         phivik(iv)=phivik(iv)*3.73
+      END DO
+
+      write(*,*) ' pathchmp:',trim(pathchmp)
+      write(*,*) ' pathsor:',trim(pathsor)
+      
+c-----------------------------------------------------------------------
+c-----------------------------------------------------------------------
+c   ouverture des fichiers xgraph:
+c   ------------------------------
+
+      ifile(1)=12
+      ifile(2)=13
+      kyear=-1
+c      OPEN(77,file='xlongday',form='formatted')
+
+      unitlec=11
+c
+      PRINT*,'entrer le nom du fichier NC'
+      READ(5,'(a)') nomfich
+
+      PRINT *,'nomfich : ',nomfich
+
+
+c%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%
+c   grande boucle sur les fichiers histoire:
+c%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%
+
+      firstcal=.true.
+      DO WHILE(len_trim(nomfich).GT.0.AND.len_trim(nomfich).LT.50)
+      PRINT *,'>>>  nomfich : ',trim(nomfich)
+
+c%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%
+
+      file=pathchmp(1:len_trim(pathchmp))//'/'//
+     s     nomfich(1:len_trim(nomfich))
+      PRINT*,'file.nc: ', file(1:len_trim(file))//'.nc'
+      PRINT*,'timestep ',dtvr
+
+      IF(nc) THEN
+      ierr= NF_OPEN(file(1:len_trim(file))//'.nc',NF_NOWRITE,nid)        
+      ELSE
+         PRINT*,'Ouverture binaire ',file
+         OPEN(unitlec,file=file,status='old',form='unformatted',
+     .   iostat=ierr)
+      ENDIF
+
+c----------------------------------------------------------------------
+c   initialisation de la physique:
+c   ------------------------------
+
+      CALL readhead_NC(file(1:len_trim(file))//'.nc',day0,phis,constR)
+
+      WRITE (*,*) 'day0 = ' , day0
+
+      CALL iniconst
+      CALL inigeom
+      CALL inifilr
+
+
+c   Lecture temps :
+
+      ierr= NF_INQ_DIMID (nid,"Time",dimid)
+        IF (ierr.NE.NF_NOERR) THEN
+          PRINT*, 'xvik: Le champ <Time> est absent'
+          CALL abort
+        ENDIF
+
+      ierr= NF_INQ_DIMLEN (nid,dimid,nbpas)
+
+      ierr = NF_INQ_VARID (nid, "Time", nvarid)
+#ifdef NC_DOUBLE
+      ierr = NF_GET_VAR_DOUBLE(nid, nvarid, temps)
+#else
+      ierr = NF_GET_VAR_REAL(nid, nvarid, temps)
+#endif
+        IF (ierr.NE.NF_NOERR) THEN
+          PRINT*, 'xvik: Lecture echouee pour <Time>'
+          CALL abort
+        ENDIF
+
+        PRINT*,'temps',(temps(itau),itau=1,10)
+              
+c-----------------------------------------------------------------------
+c   coordonnees des point Viking:
+c   -----------------------------
+
+      latvik(1)=22.27*pi/180.
+      lonvik(1)=-47.9*pi/180.
+      latvik(2)=47.67*pi/180.
+      lonvik(2)=(360.-225.71)*pi/180.
+
+c   ponderations pour les 4 points autour de Viking
+      DO iv=1,2
+         CALL coordij(lonvik(iv),latvik(iv),ivik(iv),jvik(iv))
+         IF(lonvik(iv).lt.rlonv(ivik(iv))) THEN
+            ivik(iv)=ivik(iv)-1
+         ENDIF
+         IF(latvik(iv).gt.rlatu(jvik(iv))) THEN
+            jvik(iv)=jvik(iv)-1
+         ENDIF
+         zalpha=(lonvik(iv)-rlonv(ivik(iv)))/
+     s          (rlonv(ivik(iv)+1)-rlonv(ivik(iv)))
+         zbeta=(latvik(iv)-rlatu(jvik(iv)))/
+     s          (rlatu(jvik(iv)+1)-rlatu(jvik(iv)))
+         zw(0,0,iv)=(1.-zalpha)*(1.-zbeta)
+         zw(1,0,iv)=zalpha*(1.-zbeta)
+         zw(0,1,iv)=(1.-zalpha)*zbeta
+         zw(1,1,iv)=zalpha*zbeta
+      ENDDO
+
+c   altitude reelle et modele aux points Viking
+      DO iv=1,2
+         phisim(iv)=0.
+         DO jj=0,1
+            j=jvik(iv)+jj
+            DO ii=0,1
+               i=ivik(iv)+ii
+               phisim(iv)=phisim(iv)+zw(ii,jj,iv)*phis(i,j)
+            ENDDO
+         ENDDO
+      ENDDO
+      PRINT*,'relief aux points Viking pour les sorties:',phivik
+
+c----------------------------------------------------------------------
+c   lectures des etats:
+c   -------------------
+
+       airtot1=1./(SSUM(ip1jmp1,aire,1)-SSUM(jjp1,aire,iip1))
+
+c======================================================================
+c   debut de la boucle sur les etats dans un fichier histoire:
+c======================================================================
+       count_ps=(/iip1,jjp1,1/)
+       count_co2ice=(/iip1,jjp1,1/)
+       count_temp=(/iip1,jjp1,llm,1/)
+       
+       DO itau=1,nbpas
+
+       start_ps=(/1,1,itau/)
+       start_co2ice=(/1,1,itau/)
+       start_temp=(/1,1,1,itau/)
+c   lecture drs des champs:
+c   -----------------------
+c         varname='u'
+c         ierr=drsread (unitlec,varname,unat,itau)
+c         PRINT*,'unat',unat(iip1/2,jjp1/2,llm/2)
+c         varname='v'
+c         ierr=drsread (unitlec,varname,vnat,itau)
+c         PRINT*,'vnat',vnat(iip1/2,jjp1/2,llm/2)
+
+ccccccccc  LECTURE Ps ccccccccccccccccccccccccccc
+          ierr = NF_INQ_VARID (nid, "ps", nvarid)
+#ifdef NC_DOUBLE
+          ierr = NF_GET_VARA_DOUBLE(nid, nvarid,start_ps,count_ps, ps)
+#else
+          ierr = NF_GET_VARA_REAL(nid, nvarid,start_ps,count_ps, ps)
+#endif
+          IF (ierr.NE.NF_NOERR) THEN
+            PRINT*, 'xvik: Lecture echouee pour <ps>'
+            CALL abort
+          ENDIF
+          
+          PRINT*,'ps',ps(iip1/2,jjp1/2)
+
+ccccccccc  LECTURE Temperature ccccccccccccccccccccccccccc
+          ierr = NF_INQ_VARID (nid, "temp", nvarid)
+#ifdef NC_DOUBLE
+          ierr = NF_GET_VARA_DOUBLE(nid,nvarid,start_temp,count_temp, t)
+#else
+          ierr = NF_GET_VARA_REAL(nid,nvarid,start_temp,count_temp, t)
+#endif
+          IF (ierr.NE.NF_NOERR) THEN
+            PRINT*, 'xvik: Lecture echouee pour <temp>'
+            ! Ehouarn: proceed anyways
+            ! CALL abort
+            write(*,*)'--> Setting temperature to zero !!!'
+            t(1:iip1,1:jjp1,1:llm)=0.0
+            write(*,*)'--> looking for temp7 (temp in 7th layer)'
+            ierr=NF_INQ_VARID(nid,"temp7", nvarid)
+            if (ierr.eq.NF_NOERR) then
+            write(*,*) "    OK, found temp7 variable"
+#ifdef NC_DOUBLE
+            ierr=NF_GET_VARA_DOUBLE(nid,nvarid,start_ps,count_ps,t7)
+#else
+            ierr=NF_GET_VARA_REAL(nid,nvarid,start_ps,count_ps,t7)
+#endif
+              if (ierr.ne.NF_NOERR) then
+                write(*,*)'xvik: failed loading temp7 !'
+                stop
+              endif
+            else ! no 'temp7' variable
+              write(*,*)'  No temp7 variable either !'
+              write(*,*)'  Will have to to without ...'
+              t7(1:iip1,1:jjp1)=0.0
+            endif
+          ELSE ! t() was successfully loaded, copy 7th layer to t7()
+            t7(1:iip1,1:jjp1)=t(1:iip1,1:jjp1,7)
+          ENDIF
+
+c          PRINT*,'t',t(iip1/2,jjp1/2,llm/2)
+
+ccccccccc  LECTURE co2ice ccccccccccccccccccccccccccc
+          ierr = NF_INQ_VARID (nid, "co2ice", nvarid)
+#ifdef NC_DOUBLE
+          ierr = NF_GET_VARA_DOUBLE(nid,nvarid,start_co2ice,
+     &    count_co2ice,  co2ice)
+#else
+          ierr = NF_GET_VARA_REAL(nid, nvarid,start_co2ice,
+     &    count_co2ice, co2ice)
+#endif
+          IF (ierr.NE.NF_NOERR) THEN
+            PRINT*, 'xvik: Lecture echouee pour <co2ice>'
+            CALL abort
+          ENDIF
+
+
+c Gestion du temps
+c ----------------
+          day=temps(itau)
+          PRINT*,'day ',day
+          CALL solarlong(day+day0,sollong)
+          sol=day+day0+461.
+          iyear=sol/unanj
+          WRITE (*,*) 'iyear',iyear
+          sol=sol-iyear*unanj
+c
+c Ouverture / fermeture des fichiers
+c ----------------------------------
+          IF (iyear.NE.kyear) THEN
+             WRITE(chr2(1:1),'(i1)') iyear+1
+             WRITE (*,*) 'iyear bis',iyear
+             WRITE (*,*) 'chr2'
+             WRITE (*,*)  chr2
+             IF(iyear.GE.9) WRITE(chr2,'(i2)') iyear+1
+             kyear=iyear
+             DO ii=1,2
+                CLOSE(10+ifile(ii))
+                CLOSE(2+ifile(ii))
+                CLOSE(4+ifile(ii))
+                CLOSE(6+ifile(ii))
+                CLOSE(8+ifile(ii))
+                CLOSE(16+ifile(ii))
+                CLOSE(12+ifile(ii))
+                CLOSE(14+ifile(ii))
+                CLOSE(97)
+                CLOSE(98)
+             ENDDO
+             CLOSE(5+ifile(1))
+             OPEN(ifile(1)+10,file='xpsol1'//chr2,form='formatted')
+             OPEN(ifile(2)+10,file='xpsol2'//chr2,form='formatted')
+c            OPEN(ifile(1)+8,file='xbpsol1'//chr2,form='formatted')
+c            OPEN(ifile(2)+8,file='xbpsol2'//chr2,form='formatted')
+c            OPEN(ifile(1)+2,file='xlps1'//chr2,form='formatted')
+c            OPEN(ifile(2)+2,file='xlps2'//chr2,form='formatted')
+             IF(lcal) THEN
+c               OPEN(ifile(2)+4,file='xpressud'//chr2,form='formatted')
+c               OPEN(ifile(1)+4,file='xpresnord'//chr2,form='formatted')
+c               OPEN(ifile(1)+6,file='xpm2'//chr2,form='formatted')
+             ENDIF
+                         IF(latcal) THEN
+c               OPEN(ifile(2)+14,file='xlats'//chr2,form='formatted')
+c               OPEN(ifile(1)+14,file='xlatn'//chr2,form='formatted')
+                         ENDIF
+             IF(lvent) THEN
+c               OPEN(ifile(1)+16,file='xu1'//chr2,form='formatted')
+c               OPEN(ifile(2)+16,file='xu2'//chr2,form='formatted')
+c               OPEN(ifile(1)+12,file='xv1'//chr2,form='formatted')
+c               OPEN(ifile(2)+12,file='xv2'//chr2,form='formatted')
+             ENDIF
+             OPEN(97,file='xprestot'//chr2,form='formatted')
+c            OPEN(98,file='xlat37_'//chr2,form='formatted')
+           WRITE(98,'(f5.1,16f7.1)') 0.,(rlonv(i)*180./pi,i=1,iim,4)
+          ENDIF
+ 
+
+          sollong=sollong*180./pi
+          IF(day_ls) THEN
+             dayw=sol
+             write(*,*) 'dayw', dayw
+          ELSE
+             dayw=sollong
+          ENDIF
+
+c Calcul de la moyenne planetaire
+c -------------------------------
+          pstot=0.
+          captotS=0.
+          captotN=0.
+          DO j=1,jjp1
+             DO i=1,iim
+                pstot=pstot+aire(i,j)*ps(i,j)
+             ENDDO
+          ENDDO
+ 
+              DO j=1,jjp1/2
+                 DO i=1,iim
+                    captotN = captotN  +aire(i,j)*co2ice(i,j)
+                 ENDDO
+              ENDDO
+              DO j=jjp1/2+1, jjp1
+                 DO i=1,iim
+                    captotS = captotS  +aire(i,j)*co2ice(i,j)
+                 ENDDO
+              ENDDO
+              WRITE(97,'(4e16.6)') dayw,pstot*airtot1
+     &       , captotN*g*airtot1, captotS*g*airtot1          
+
+          IF(.NOT.firstcal) THEN
+         WRITE(98,'(f5.1,16f7.3)')
+     s    dayw,(ps(i,37),i=1,iim,4)
+
+c boucle sur les sites vikings:
+c ----------------------------
+
+          DO iv=1,2
+
+c interpolation de la temperature dans la 7eme couche, de la pression
+c de surface et des vents aux points viking.
+
+             zp1=0.
+             zp2=0.
+             zp2_sm=0.
+             zt=0.
+             zu=0.
+             zv=0.
+             DO jj=0,1
+                j=jvik(iv)+jj
+                DO ii=0,1
+                   i=ivik(iv)+ii
+!                   zt=zt+zw(ii,jj,iv)*t(i,j,7)
+                   zt=zt+zw(ii,jj,iv)*t7(i,j)
+!                   zp1=zp1+zw(ii,jj,iv)*ps(i,j)
+                   zp1=zp1+zw(ii,jj,iv)*log(ps(i,j)) ! interpolate in log(P)
+                    WRITE (*,*) 'ps autour iv',ps(i,j),iv
+                   zu=zu+zw(ii,jj,iv)*unat(i,j,1)/cu(i,j)
+                   zv=zv+zw(ii,jj,iv)*vnat(i,j,1)/cv(i,j)
+                ENDDO
+             ENDDO
+             zp1=exp(zp1) ! because of the bilinear interpolation in log(P)
+ 
+c               pression au sol extrapolee a partir de la temp. 7eme couche
+           WRITE (*,*) 'constR ',constR 
+           WRITE (*,*) 'zt ',zt
+             gh=constR*zt
+             if (gh.eq.0) then ! if we don't have temperature values
+               ! assume a scale height of 10km
+               zp2=zp1*exp(-(phivik(iv)-phisim(iv))/(3.73*1.e4))
+             else
+               zp2=zp1*exp(-(phivik(iv)-phisim(iv))/gh)
+             endif
+           WRITE (*,*) 'iv,pstot,zp2, zp1, phivik(iv),phisim(iv),gh'
+           WRITE (*,*) iv,pstot*airtot1,zp2,zp1,phivik(iv),phisim(iv),gh
+!           WRITE(ifile(iv)+10,'(2e15.5)') dayw,zp1
+           WRITE(ifile(iv)+10,'(3e15.5)') dayw,zp2,zp1
+           
+c   sorties eventuelles de vent
+             IF(lvent) THEN
+                WRITE(ifile(iv)+16,'(2e15.5)')
+     s          dayw,zu
+                WRITE(ifile(iv)+12,'(2e15.5)')
+     s          dayw,zv
+             ENDIF
+          ENDDO
+c         IF (lcal) THEN
+c            WRITE(ifile(1)+4,'(2e15.6)') dayw,airtot1*g*.01*
+c    s       (SSUM(ip1jmp1/2,ziceco2,1)-SSUM(jjp1/2,ziceco2,iip1))
+c            WRITE(ifile(2)+4,'(2e15.6)') dayw,airtot1*g*.01*
+c    s       (SSUM(iip1*jjm/2,ziceco2(1,jjm/2+2),1)-
+c    s       SSUM(jjm/2,ziceco2(1,jjm/2+2),iip1))
+c         ENDIF
+c            IF(latcal) THEN
+c               CALL icelat(iim,jjm,ziceco2,rlatv,zicelat)
+c               WRITE(ifile(1)+14,'(2e15.6)') dayw,zicelat(1)*180./pi
+c               WRITE(ifile(2)+14,'(2e15.6)') dayw,zicelat(2)*180./pi
+c            ENDIF
+         ENDIF
+         firstcal=.false.
+
+c======================================================================
+c   Fin de la boucle sur les etats du fichier histoire:
+c======================================================================
+      ENDDO
+
+      ierr= NF_CLOSE(nid)
+
+      PRINT*,'Fin du fichier',nomfich
+      print*,'Entrer un nouveau fichier ou return pour finir'
+      READ(5,'(a)',err=9999) nomfich
+
+c%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%
+c   Fin de la boucle sur les fichiers histoire:
+c%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%
+
+      ENDDO
+
+      PRINT*,'relief du point V1',.001*phis(ivik(1),jvik(1))/g
+      PRINT*,'relief du point V2',.001*phis(ivik(2),jvik(2))/g
+      DO iv=1,2
+         PRINT*,'Viking',iv,'   i=',ivik(iv),'j  =',jvik(iv)
+         WRITE(6,7777)
+     s   (rlonv(i)*180./pi,i=ivik(iv)-1,ivik(iv)+2)
+         print*
+         DO j=jvik(iv)-1,jvik(iv)+2
+            WRITE(6,'(f8.1,10x,5f7.1)')
+     s   rlatu(j)*180./pi,(phis(i,j)/(g*1000.),i=ivik(iv)-1,ivik(iv)+2)
+         ENDDO
+         print*
+         print*,'zw'
+         write(6,'(2(2f10.4/))') ((zw(ii,jj,iv),ii=0,1),jj=0,1)
+         print*,'altitude interpolee (km) ',phisim(iv)/1000./g
+      ENDDO
+      PRINT*,'R=',r
+ 9999  PRINT*,'Fin '
+
+7777  FORMAT ('latitude/longitude',4f7.1)
+      END
Index: trunk/LMDZ.MARS/libf/misc/iniprint.h
===================================================================
--- trunk/LMDZ.MARS/libf/misc/iniprint.h	(revision 1540)
+++ trunk/LMDZ.MARS/libf/misc/iniprint.h	(revision 1540)
@@ -0,0 +1,11 @@
+!
+! $Id: $
+!
+!
+! handle debug and output levels
+! lunout:    unit of file where outputs will be sent
+!                           (default is 6, standard output)
+! prt_level: level of informative output messages (0 = minimum)
+!
+      INTEGER lunout, prt_level
+      COMMON /comprint/ lunout, prt_level
